![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/pdf.gif) | 3 South Shore.pdf | 2024-02-23 15:00 | 86K | |
![[ ]](/icons/pdf.gif) | 5 Year Fin Plan Gen Fund.pdf | 2022-01-27 10:31 | 77K | |
![[ ]](/icons/pdf.gif) | 5 Year Fin Plan Sewer & Water.pdf | 2022-01-27 10:31 | 1.2M | |
![[ ]](/icons/pdf.gif) | 5a 25-07-08CW.pdf | 2025-09-05 15:24 | 249K | |
![[ ]](/icons/pdf.gif) | 5a 25-09-16REG.pdf | 2025-10-24 16:07 | 308K | |
![[ ]](/icons/pdf.gif) | 5a 25-10-28REG.pdf | 2025-11-21 09:11 | 323K | |
![[ ]](/icons/pdf.gif) | 5a 25-11-25REG.pdf | 2025-12-12 16:19 | 323K | |
![[ ]](/icons/pdf.gif) | 5a 25-12-16REG.pdf | 2026-01-23 14:56 | 294K | |
![[ ]](/icons/pdf.gif) | 5a 26-01-27REG.pdf | 2026-02-20 15:13 | 401K | |
![[ ]](/icons/pdf.gif) | 5a 26-02-24REG.pdf | 2026-03-20 11:31 | 389K | |
![[ ]](/icons/pdf.gif) | 5a 26-04-28REG.pdf | 2026-05-22 15:17 | 404K | |
![[ ]](/icons/pdf.gif) | 5b 25-10-14CW.pdf | 2025-10-24 16:07 | 282K | |
![[ ]](/icons/pdf.gif) | 5b 25-11-04CW.pdf | 2025-11-21 09:11 | 272K | |
![[ ]](/icons/pdf.gif) | 5b 25-12-09CW.pdf | 2025-12-12 16:19 | 247K | |
![[ ]](/icons/pdf.gif) | 5b 25-12-23SPEC.pdf | 2026-01-23 14:56 | 219K | |
![[ ]](/icons/pdf.gif) | 5b 26-01-22APC.pdf | 2026-02-20 15:13 | 317K | |
![[ ]](/icons/pdf.gif) | 5b 26-03-24REG.pdf | 2026-04-23 16:34 | 373K | |
![[ ]](/icons/pdf.gif) | 5b 26-04-23APC.pdf | 2026-05-22 15:17 | 213K | |
![[ ]](/icons/pdf.gif) | 5c 26-01-13CW.pdf | 2026-01-23 14:56 | 267K | |
![[ ]](/icons/pdf.gif) | 5c 26-02-10Budget.pdf | 2026-02-23 10:15 | 376K | |
![[ ]](/icons/pdf.gif) | 5c 26-04-14CW.pdf | 2026-04-23 16:21 | 357K | |
![[ ]](/icons/pdf.gif) | 5c 26-05-12CW.pdf | 2026-05-22 15:16 | 323K | |
![[ ]](/icons/pdf.gif) | 5d 26-03-26APC.pdf | 2026-04-23 16:23 | 301K | |
![[ ]](/icons/pdf.gif) | 5d 26-05-12SPEC.pdf | 2026-05-22 15:16 | 313K | |
![[ ]](/icons/pdf.gif) | 5e 26-04-14PTRRP.pdf | 2026-04-23 16:23 | 291K | |
![[ ]](/icons/pdf.gif) | 6a 2026 Mtg Schedule.pdf | 2025-12-05 15:11 | 128K | |
![[ ]](/icons/pdf.gif) | 6a Action Resolutions 25-11-04CW.pdf | 2025-11-21 09:11 | 221K | |
![[ ]](/icons/pdf.gif) | 6a Action Resolutions 25-12-09CW.pdf | 2025-12-12 16:19 | 186K | |
![[ ]](/icons/pdf.gif) | 6a Action Resolutions 26-01-13CW.pdf | 2026-01-23 14:56 | 204K | |
![[ ]](/icons/pdf.gif) | 6a Action Resolutions 26-02-10Budget.pdf | 2026-02-23 10:15 | 273K | |
![[ ]](/icons/pdf.gif) | 6a Action Resolutions 26-04-14CW.pdf | 2026-04-23 16:23 | 197K | |
![[ ]](/icons/pdf.gif) | 6a Action Resolutions 26-05-12CW.pdf | 2026-05-22 15:16 | 266K | |
![[ ]](/icons/pdf.gif) | 6b 2026-30 FinPlan.pdf | 2026-02-23 16:12 | 2.5M | |
![[ ]](/icons/pdf.gif) | 6b Actionable Resolutions 25-10-14CW.pdf | 2025-10-24 16:07 | 197K | |
![[ ]](/icons/pdf.gif) | 6b Motion 84-25 amend for deposit.pdf | 2026-01-23 14:53 | 325K | |
![[ ]](/icons/pdf.gif) | 6c 2026 Proposed Budget Meetings.pdf | 2026-01-23 16:00 | 225K | |
![[ ]](/icons/pdf.gif) | 7a 340 Grants Lake Rd present.pdf | 2025-10-10 16:10 | 1.9M | |
![[ ]](/icons/pdf.gif) | 7a 2025 DRAFT FINANCIAL STATEMENTS.pdf | 2026-05-08 17:14 | 1.1M | |
![[ ]](/icons/pdf.gif) | 7a 2026-03-11 CVRD.pdf | 2026-05-08 17:27 | 504K | |
![[ ]](/icons/pdf.gif) | 7a 20260303MosaicTLCMayorCouncilPresentation.pdf | 2026-04-10 15:05 | 2.6M | |
![[ ]](/icons/pdf.gif) | 7b TLC STP Upgrades - Presentation to Council - 202510-09.pdf | 2025-10-10 16:11 | 1.7M | |
![[ ]](/icons/pdf.gif) | 7b Tourism Cowichan MRDT.pdf | 2026-03-06 16:47 | 3.7M | |
![[ ]](/icons/pdf.gif) | 7c Lake Cowichan Education Questionnaire - Google Forms.pdf | 2026-03-20 11:44 | 281K | |
![[ ]](/icons/pdf.gif) | 8a 2025 10 21 VIRL Board Appointment Letter_Lake Cowichan.pdf | 2025-10-31 12:46 | 268K | |
![[ ]](/icons/pdf.gif) | 8a 2025 12 09 LTR on Private Bills and Private Members Bill M216.pdf | 2026-01-09 15:09 | 1.8M | |
![[ ]](/icons/pdf.gif) | 8a 2025 Cowichan Bulletin #1_Sept 12.pdf | 2025-10-10 16:24 | 1.4M | |
![[ ]](/icons/pdf.gif) | 8a 2025 Cowichan Bulletin Sept 12.pdf | 2025-10-14 11:21 | 1.4M | |
![[ ]](/icons/pdf.gif) | 8a 20260130 Town of Lake Cowichan - Cowichan River land aquistition.pdf | 2026-03-06 16:57 | 423K | |
![[ ]](/icons/pdf.gif) | 8a 20260413 - Permanent Daylight Saving Letter and Resolution.pdf | 2026-04-23 16:24 | 2.9M | |
![[ ]](/icons/pdf.gif) | 8a AVICC-Strategic-Priorities-2026-2030.pdf | 2026-06-05 12:36 | 3.8M | |
![[ ]](/icons/pdf.gif) | 8a FW_ Important Message from the ALC Chair.pdf | 2026-04-10 15:46 | 226K | |
![[ ]](/icons/pdf.gif) | 8a Kinsmen Beer Garden request for Lake Days 2026.pdf | 2026-05-22 15:18 | 632K | |
![[ ]](/icons/pdf.gif) | 8a Lake Cowichan CWF 2024-34 Year 2 Payment 1.pdf | 2025-09-05 15:26 | 173K | |
![[ ]](/icons/pdf.gif) | 8a N024V - Adjacent Property Letters.pdf | 2026-03-06 17:00 | 118K | |
![[ ]](/icons/pdf.gif) | 8a Nonoka Art Proposal.pdf | 2025-10-24 16:07 | 2.2M | |
![[ ]](/icons/pdf.gif) | 8a SPARCBC Accessible Parking Awareness Month.pdf | 2025-11-21 09:12 | 3.2M | |
![[ ]](/icons/pdf.gif) | 8a VIC_December2025_Newsletter.pdf | 2025-12-12 16:19 | 1.9M | |
![[ ]](/icons/pdf.gif) | 8a legion crosswalk.pdf | 2025-12-05 15:12 | 449K | |
![[ ]](/icons/pdf.gif) | 8b 2025 Youth Parliament.pdf | 2025-10-10 16:11 | 3.5M | |
![[ ]](/icons/pdf.gif) | 8b Bail and Sentencing Reform Act_ FCM response and technical briefing sign-up.pdf | 2025-10-31 12:32 | 164K | |
![[ ]](/icons/pdf.gif) | 8b Cowichan Valley Annual Report 2025.pdf | 2026-01-09 15:11 | 18M | |
![[ ]](/icons/pdf.gif) | 8b FW_ Emergency Man-LINKED to WEBSITE.pdf | 2026-03-06 16:58 | 246K | |
![[ ]](/icons/pdf.gif) | 8b Health Link Registry.pdf | 2025-12-12 16:19 | 1.1M | |
![[ ]](/icons/pdf.gif) | 8b IGRS Local Government Communique.pdf | 2026-06-05 12:36 | 176K | |
![[ ]](/icons/pdf.gif) | 8b Ohtaki visit to LC from Mayor.pdf | 2025-12-05 15:11 | 149K | |
![[ ]](/icons/pdf.gif) | 8b Proclamation Request National Dental Care Day October 10-26.pdf | 2026-05-22 15:43 | 18M | |
![[ ]](/icons/pdf.gif) | 8b VIC_November2025_Newsletter.pdf | 2025-11-21 09:12 | 1.2M | |
![[ ]](/icons/pdf.gif) | 8b What We Heard Report Mosaic.pdf | 2026-03-06 16:58 | 673K | |
![[ ]](/icons/pdf.gif) | 8b Youbou Area Harvest Plans 2026 to 2028.pdf | 2026-04-23 16:24 | 420K | |
![[ ]](/icons/pdf.gif) | 8b apc db mc ltr.pdf | 2025-10-24 16:07 | 325K | |
![[ ]](/icons/pdf.gif) | 8c 2025 Summary Report Lake Cowichan CrimeStoppers.pdf | 2026-03-06 16:58 | 85K | |
![[ ]](/icons/pdf.gif) | 8c AVICC Education and Engagement Opportunities.pdf | 2025-10-24 16:07 | 392K | |
![[ ]](/icons/pdf.gif) | 8c As Parliament returns FCM leads on community priorities.pdf | 2025-10-10 16:12 | 159K | |
![[ ]](/icons/pdf.gif) | 8c Correspondence.pdf | 2025-11-21 09:12 | 748K | |
![[ ]](/icons/pdf.gif) | 8c Correspondence to Minister Boyle - Concerns Regarding Bill M 216 2025 Professional Reliance Act.pdf | 2025-12-05 15:11 | 154K | |
![[ ]](/icons/pdf.gif) | 8c Fw_ Request for Letter of Support - Reaching Home.pdf | 2025-12-12 16:19 | 293K | |
![[ ]](/icons/pdf.gif) | 8c Letter of Motion_LGCAP Funding-2026May19.pdf | 2026-05-22 15:17 | 253K | |
![[ ]](/icons/pdf.gif) | 8c Ltr re Response to Bill M216 - District of Highlands - January 13-2026.pdf | 2026-01-23 15:04 | 113K | |
![[ ]](/icons/pdf.gif) | 8c TOOLKIT _ Add your voice to municipal priorities ahead of Budget 2025.pdf | 2025-10-31 12:32 | 171K | |
![[ ]](/icons/pdf.gif) | 8c memo_project_updates_CLECS_17April2026.pdf | 2026-04-23 16:23 | 118K | |
![[ ]](/icons/pdf.gif) | 8c take hike ltr.pdf | 2026-01-09 15:09 | 867K | |
![[ ]](/icons/pdf.gif) | 8d 2025-12-01 Joint letter to Minister Health_repurposing Cowichan District Hospital.pdf | 2025-12-05 15:11 | 235K | |
![[ ]](/icons/pdf.gif) | 8d 2026 - City of Prince George - Mayor_Letter-Public_Safety_Petition.pdf | 2026-03-06 16:48 | 144K | |
![[ ]](/icons/pdf.gif) | 8d Bears Association Informal Update 2025-11-18.pdf | 2025-11-21 09:11 | 851K | |
![[ ]](/icons/pdf.gif) | 8d Event Invite Lake Cowichan May 8th 2026 FINAL.pdf | 2026-04-23 16:23 | 342K | |
![[ ]](/icons/pdf.gif) | 8d FCM Voice_ Build Canada Homes _ AC2025 Digital Magazine _ Collective webinar _ and more.pdf | 2025-10-10 16:12 | 209K | |
![[ ]](/icons/pdf.gif) | 8d Lake Cowichan CWF 2024-34 Year 2 Payment.pdf | 2025-12-12 16:19 | 179K | |
![[ ]](/icons/pdf.gif) | 8d Spring 2026 LT Borrowing Opportunity.pdf | 2025-10-31 12:32 | 125K | |
![[ ]](/icons/pdf.gif) | 8d The 2026 Canadas Volunteer Awards Call for Nominations.pdf | 2026-05-22 15:29 | 689K | |
![[ ]](/icons/pdf.gif) | 8d Virtual Town Hall 26-02-03 Invite.pdf | 2026-01-23 15:04 | 183K | |
![[ ]](/icons/pdf.gif) | 8e 2025-12-11-CVRD News Release - CVRD Adopts OCP Bylaw 4373-Final.pdf | 2025-12-12 16:19 | 165K | |
![[ ]](/icons/pdf.gif) | 8e 2026 AVICC AGM & Convention - Resolutions Nominations Sessions and Students.pdf | 2025-10-31 12:32 | 1.2M | |
![[ ]](/icons/pdf.gif) | 8e 2026 LGLA Forum-Register Now.pdf | 2026-03-06 17:00 | 365K | |
![[ ]](/icons/pdf.gif) | 8e Bill M 216 2025 Professional Reliance Act-MIABC.pdf | 2025-12-05 15:11 | 249K | |
![[ ]](/icons/pdf.gif) | 8e Island Coastal Economic Trust Letter of Support.pdf | 2026-05-22 15:56 | 181K | |
![[ ]](/icons/pdf.gif) | 8e VIC_September_Newsletter2025.pdf | 2025-10-10 16:13 | 5.1M | |
![[ ]](/icons/pdf.gif) | 8f Community Leaders Program letter.pdf | 2025-10-31 12:32 | 119K | |
![[ ]](/icons/pdf.gif) | 8f Forestry is a Solution - Letter to Councillor Dawn Vomacka of the Town of Lake Cowichan.pdf | 2026-03-06 16:48 | 1.0M | |
![[ ]](/icons/pdf.gif) | 8f Joy McLennan - NP 25-11-19.pdf | 2025-12-05 15:11 | 1.2M | |
![[ ]](/icons/pdf.gif) | 8f Ltr to the Minister of Housing and Municipal Affairs - Request for Additional Funding.pdf | 2026-05-22 15:17 | 274K | |
![[ ]](/icons/pdf.gif) | 8f legion crosswalk.pdf | 2025-10-10 16:14 | 1.9M | |
![[ ]](/icons/pdf.gif) | 8g 2026 AVICC AGM Convention - REGISTRATION.pdf | 2026-03-06 16:48 | 1.0M | |
![[ ]](/icons/pdf.gif) | 8g 2026 AVICC Call for Resolutions_FINAL.pdf | 2025-10-31 12:32 | 399K | |
![[ ]](/icons/pdf.gif) | 8h 2026 AVICC Student Participation Application_FILLABLE.pdf | 2025-10-31 12:32 | 131K | |
![[ ]](/icons/pdf.gif) | 8h City of Abbotsford - Request for Support - UBCM Motions.pdf | 2026-03-06 16:47 | 330K | |
![[ ]](/icons/pdf.gif) | 8i 2026 Call for Nominations and Nomination Form_FINAL_Fillable.pdf | 2025-10-31 12:32 | 192K | |
![[ ]](/icons/pdf.gif) | 8i AVICC 2026 conference.pdf | 2026-03-20 11:44 | 772K | |
![[ ]](/icons/pdf.gif) | 9a Appointment to Committees Boards and Commission for Members of Council.pdf | 2025-10-31 12:32 | 220K | |
![[ ]](/icons/pdf.gif) | 9a April 2026 Month End Building Report.pdf | 2026-05-08 17:14 | 321K | |
![[ ]](/icons/pdf.gif) | 9a Building Inspection Report Nov 2025.pdf | 2025-12-05 15:11 | 216K | |
![[ ]](/icons/pdf.gif) | 9a EMC 2026 Emergency Management Grants 2025-10-03.pdf | 2026-03-06 16:46 | 903K | |
![[ ]](/icons/pdf.gif) | 9a STAFF REPORT - Administration Quarterly Report ending 2025.pdf | 2026-01-09 15:08 | 144K | |
![[ ]](/icons/pdf.gif) | 9a STAFF REPORT - Administrations Quarterly Report.pdf | 2025-09-05 15:24 | 155K | |
![[ ]](/icons/pdf.gif) | 9a STAFF REPORT - Administrations Quarterly Report March 2026.pdf | 2026-04-10 15:06 | 145K | |
![[ ]](/icons/pdf.gif) | 9a Strategic Planning Workshop.pdf | 2025-10-10 16:14 | 336K | |
![[ ]](/icons/pdf.gif) | 9b - UBCM Grant Application - CEPF - Backup Generator.pdf | 2026-01-09 15:08 | 596K | |
![[ ]](/icons/pdf.gif) | 9b 2026 Meeting Schedule.pdf | 2025-10-31 12:55 | 475K | |
![[ ]](/icons/pdf.gif) | 9b BI Sept Report 25.pdf | 2025-10-10 16:14 | 230K | |
![[ ]](/icons/pdf.gif) | 9b Building Jan26.pdf | 2026-03-06 16:46 | 321K | |
![[ ]](/icons/pdf.gif) | 9b Building inspection month end March 2026.pdf | 2026-04-10 16:21 | 319K | |
![[ ]](/icons/pdf.gif) | 9b FDNov25.pdf | 2025-12-05 15:11 | 1.0M | |
![[ ]](/icons/pdf.gif) | 9b May 2026 Month End Building Report.pdf | 2026-06-05 12:36 | 322K | |
![[ ]](/icons/pdf.gif) | 9b RG Memo Finance Report April 30 2026.pdf | 2026-05-08 17:27 | 727K | |
![[ ]](/icons/pdf.gif) | 9b Staff Report - Strategic Plan Update.pdf | 2025-09-05 15:51 | 202K | |
![[ ]](/icons/pdf.gif) | 9bii TLC Strategic Plan 2025.pdf | 2025-09-05 15:28 | 422K | |
![[ ]](/icons/pdf.gif) | 9c - ICBL Agreement and Bylaw.pdf | 2026-01-09 15:07 | 734K | |
![[ ]](/icons/pdf.gif) | 9c 135 NORTH SHORE RD INSPECTION.pdf | 2025-10-10 16:14 | 224K | |
![[ ]](/icons/pdf.gif) | 9c 2025 UBCM.pdf | 2025-09-05 15:53 | 251K | |
![[ ]](/icons/pdf.gif) | 9c Accessibility Committee.pdf | 2025-10-31 12:31 | 636K | |
![[ ]](/icons/pdf.gif) | 9c Building Report Feb26.pdf | 2026-03-06 16:46 | 306K | |
![[ ]](/icons/pdf.gif) | 9c FD Underwriters Report 2025.pdf | 2025-12-05 15:11 | 793K | |
![[ ]](/icons/pdf.gif) | 9c RG Memo 2026 Grant-in-Aid.pdf | 2026-04-10 15:06 | 3.5M | |
![[ ]](/icons/pdf.gif) | 9c RG Memo Finance Report May 31 2026.pdf | 2026-06-05 12:35 | 721K | |
![[ ]](/icons/pdf.gif) | 9ci Election Officer.pdf | 2026-05-08 17:14 | 308K | |
![[ ]](/icons/pdf.gif) | 9cii Election Bylaw.pdf | 2026-05-08 17:13 | 669K | |
![[ ]](/icons/pdf.gif) | 9d 25-10-23APC.pdf | 2025-11-21 09:11 | 253K | |
![[ ]](/icons/pdf.gif) | 9d 2025-12-09 COW staff report Bylaw R-3 zone setback.pdf | 2025-12-05 15:10 | 598K | |
![[ ]](/icons/pdf.gif) | 9d 2026-05-14 Food Trucks_Mobile Vending COW rpt DRAFT.pdf | 2026-05-08 17:14 | 2.5M | |
![[ ]](/icons/pdf.gif) | 9d Building inspection month end report December 2025.pdf | 2026-01-09 15:07 | 235K | |
![[ ]](/icons/pdf.gif) | 9d Community Recognition.pdf | 2025-10-31 14:21 | 139K | |
![[ ]](/icons/pdf.gif) | 9d Finance - Financial Report - January to September 2025.pdf | 2025-10-10 16:15 | 1.2M | |
![[ ]](/icons/pdf.gif) | 9d Fire Department Incident for March 2026.pdf | 2026-04-10 15:06 | 1.0M | |
![[ ]](/icons/pdf.gif) | 9d Fire Department Report - January 2026.pdf | 2026-03-06 16:46 | 1.0M | |
![[ ]](/icons/pdf.gif) | 9d RG Memo Prov Budget 2026.pdf | 2026-06-05 12:36 | 300K | |
![[ ]](/icons/pdf.gif) | 9d finaug25.pdf | 2025-09-08 15:03 | 299K | |
![[ ]](/icons/pdf.gif) | 9e 2025 PDF.pdf | 2025-09-05 15:26 | 663K | |
![[ ]](/icons/pdf.gif) | 9e 2026-04-14 Bylaw 1125 Council rprt Dev Approval Procedures.pdf | 2026-04-10 16:20 | 861K | |
![[ ]](/icons/pdf.gif) | 9e April 2026 Fire Department monthly staff report - Feedback.pdf | 2026-06-05 12:35 | 1.0M | |
![[ ]](/icons/pdf.gif) | 9e Building Inspection Report October 2025.pdf | 2025-10-31 14:20 | 215K | |
![[ ]](/icons/pdf.gif) | 9e FD Dec25.pdf | 2026-01-09 15:07 | 922K | |
![[ ]](/icons/pdf.gif) | 9e Finance - Proposed 2026 Financial Plan Process.pdf | 2025-10-10 16:15 | 231K | |
![[ ]](/icons/pdf.gif) | 9e Fire Department Report Feburary 2026.pdf | 2026-03-06 16:46 | 924K | |
![[ ]](/icons/pdf.gif) | 9f Draft Bylaw 1129 Alt Means Notice Bylaw.pdf | 2026-04-10 15:06 | 127K | |
![[ ]](/icons/pdf.gif) | 9f FDept UBCM Funding Community.pdf | 2026-03-06 16:46 | 2.3M | |
![[ ]](/icons/pdf.gif) | 9f May 2026 Fire Department monthly staff report.pdf | 2026-06-05 12:35 | 1.0M | |
![[ ]](/icons/pdf.gif) | 9f Parking Study Memo-2025.pdf | 2025-10-31 14:20 | 199K | |
![[ ]](/icons/pdf.gif) | 9f bijul25.pdf | 2025-09-05 15:27 | 61K | |
![[ ]](/icons/pdf.gif) | 9f fdsep25.pdf | 2025-10-10 16:16 | 973K | |
![[ ]](/icons/pdf.gif) | 9f findec25.pdf | 2026-01-09 15:06 | 1.2M | |
![[ ]](/icons/pdf.gif) | 9g-PW-Pay-Parking-Plan-Report-2026-JT.pdf | 2026-06-05 14:15 | 773K | |
![[ ]](/icons/pdf.gif) | 9g CVRD Referral - OCP.pdf | 2026-03-06 16:47 | 333K | |
![[ ]](/icons/pdf.gif) | 9g Draft Fee Bylaw Amendment Bylaw 1130.pdf | 2026-04-10 15:06 | 326K | |
![[ ]](/icons/pdf.gif) | 9g LT - Ministers - Lake Cowichan Weir - Mayor.pdf | 2025-12-05 15:11 | 200K | |
![[ ]](/icons/pdf.gif) | 9g Parks Review Memo -2025.pdf | 2025-10-31 14:20 | 194K | |
![[ ]](/icons/pdf.gif) | 9g biaug25.pdf | 2025-09-05 15:25 | 52K | |
![[ ]](/icons/pdf.gif) | 9h-PW-Sewer-Modelling.pdf | 2026-06-05 14:14 | 372K | |
![[ ]](/icons/pdf.gif) | 9h 2025 November Finance Memo.pdf | 2025-12-05 15:10 | 1.2M | |
![[ ]](/icons/pdf.gif) | 9h Notice TUP 2026-01.pdf | 2026-01-09 15:08 | 226K | |
![[ ]](/icons/pdf.gif) | 9h PW STP Detailed design work 2026 - JT.pdf | 2026-06-05 12:35 | 372K | |
![[ ]](/icons/pdf.gif) | 9h RG Memo Lake Days BBQ.pdf | 2026-04-14 13:22 | 179K | |
![[ ]](/icons/pdf.gif) | 9h fdjul25r.pdf | 2025-09-05 15:26 | 715K | |
![[ ]](/icons/pdf.gif) | 9i Proposed Development bylaw 1125.pdf | 2026-01-09 15:07 | 453K | |
![[ ]](/icons/pdf.gif) | 9i Town of Lake Cowichan Audit Service Plan 2025.pdf | 2025-12-05 15:11 | 2.0M | |
![[ ]](/icons/pdf.gif) | 9i fdaug25r.pdf | 2025-09-05 15:25 | 801K | |
![[ ]](/icons/pdf.gif) | 9j Firesmart.pdf | 2025-09-05 15:24 | 514K | |
![[ ]](/icons/pdf.gif) | 9j Storage Containers COW report.pdf | 2026-01-09 15:07 | 232K | |
![[ ]](/icons/pdf.gif) | 9k Summer of 2025 Highlights for Mayor and Council.pdf | 2025-09-05 15:25 | 104K | |
![[ ]](/icons/pdf.gif) | 9l Lakeview Park Campground 2025 Highlights.pdf | 2025-09-05 15:25 | 163K | |
![[ ]](/icons/pdf.gif) | 9m Lake Cowichan Visitor Centre Summer - 2025 summary.pdf | 2025-09-05 15:25 | 102K | |
![[ ]](/icons/pdf.gif) | 9n 2025-06-25 Neilsen Strategies-Update to Board.pdf | 2025-09-05 15:37 | 119K | |
![[ ]](/icons/pdf.gif) | 10.33x6_LivingNewNormal_AD.pdf | 2019-05-06 11:57 | 878K | |
![[ ]](/icons/pdf.gif) | 10a 63 Cowichan Lake Rd.pdf | 2025-09-05 15:25 | 32K | |
![[ ]](/icons/pdf.gif) | 10a FDgrant25.pdf | 2025-10-10 16:17 | 662K | |
![[ ]](/icons/pdf.gif) | 10a RMCP LC_Stats_2025.pdf | 2025-11-21 09:12 | 74K | |
![[ ]](/icons/pdf.gif) | 10b Copy of 2026Itinerary Ohtaki.pdf | 2026-04-23 16:23 | 73K | |
![[ ]](/icons/pdf.gif) | 10b Fern Rd.pdf | 2025-09-05 15:25 | 31K | |
![[ ]](/icons/pdf.gif) | 10b PW Sidewalk Concrete.pdf | 2025-10-10 16:17 | 391K | |
![[ ]](/icons/pdf.gif) | 10c MoTransportation re Transit Strike resolution.pdf | 2025-09-05 15:25 | 120K | |
![[ ]](/icons/pdf.gif) | 10d Reconciliation.pdf | 2025-09-05 15:52 | 207K | |
![[ ]](/icons/pdf.gif) | 10e Truth and Reconciliation Poster 2025.pdf | 2025-09-05 15:24 | 197K | |
![[ ]](/icons/pdf.gif) | 10h 2026 Parking program final.pdf | 2026-03-20 11:31 | 1.1M | |
![[ ]](/icons/pdf.gif) | 10xx-2021 Sign Amendment.pdf | 2021-05-25 15:11 | 106K | |
![[ ]](/icons/pdf.gif) | 10xx-2021 Subdivision Amendment.pdf | 2021-05-25 14:59 | 86K | |
![[ ]](/icons/pdf.gif) | 11a DP2025-08 staff report.pdf | 2025-12-12 16:19 | 1.7M | |
![[ ]](/icons/pdf.gif) | 11a DP2026-06 Robertson 90 South Shore Rd 2026-05-26 Council Rpt.pdf | 2026-05-22 15:16 | 542K | |
![[ ]](/icons/pdf.gif) | 11a DVP2025-07 7987 Greendale Rd.pdf | 2025-10-24 16:06 | 337K | |
![[ ]](/icons/pdf.gif) | 11a DVP2026-01 Slopes Ph 6.pdf | 2026-02-20 15:40 | 4.1M | |
![[ ]](/icons/pdf.gif) | 11a RG Memo Finance Report March 31 2026.pdf | 2026-04-23 16:21 | 717K | |
![[ ]](/icons/pdf.gif) | 11a RG Memo October 2025 Finance Report.pdf | 2025-11-21 09:11 | 1.3M | |
![[ ]](/icons/pdf.gif) | 11a TUP2026-01 87 South Shore Rd.pdf | 2026-01-23 14:56 | 291K | |
![[ ]](/icons/pdf.gif) | 11a TUP2026-02 Cannabis retail 2026-03-24 Council rpt DRAFT.pdf | 2026-03-20 11:30 | 1.9M | |
![[ ]](/icons/pdf.gif) | 11b 2026-04-28 Bylaw 1125_1129_1130 Council rprt 1st_2nd_3rd Reading.pdf | 2026-04-23 16:33 | 369K | |
![[ ]](/icons/pdf.gif) | 11b 2026-05-26 Bylaw 1125_1129_1130 Council rprt final.pdf | 2026-05-22 15:16 | 359K | |
![[ ]](/icons/pdf.gif) | 11b DP2025-07 291 Castley Heights.pdf | 2025-10-24 16:06 | 323K | |
![[ ]](/icons/pdf.gif) | 11b DP2025-12 staff report.pdf | 2025-12-12 16:17 | 2.9M | |
![[ ]](/icons/pdf.gif) | 11b DP2025-13 537 Mountain View.pdf | 2026-01-23 14:55 | 8.5M | |
![[ ]](/icons/pdf.gif) | 11b DPwV 2026-05 Winter 460 Winter Dr Staff rpt 03-24-2026.pdf | 2026-03-20 11:30 | 6.3M | |
![[ ]](/icons/pdf.gif) | 11b RG Memo 2025 Grant-in-Aid.pdf | 2025-11-21 09:11 | 374K | |
![[ ]](/icons/pdf.gif) | 11c 2026-05-26 Food Trucks_Mobile Vending Council rpt.pdf | 2026-05-22 15:15 | 1.8M | |
![[ ]](/icons/pdf.gif) | 11c DP 2025-01-01 Amendment 228 Johel Rd 2026-04-28 Council rpt DRAFT.pdf | 2026-04-23 16:23 | 515K | |
![[ ]](/icons/pdf.gif) | 11c DP2025-04 Amendment.pdf | 2026-02-20 15:13 | 622K | |
![[ ]](/icons/pdf.gif) | 11c DP2025-11 456 Winter Drive.pdf | 2025-10-24 16:06 | 5.1M | |
![[ ]](/icons/pdf.gif) | 11c DPwV2026-02 464 Winter.pdf | 2026-01-23 16:18 | 9.8M | |
![[ ]](/icons/pdf.gif) | 11c DVP2025-09 staff report.pdf | 2025-12-12 16:19 | 760K | |
![[ ]](/icons/pdf.gif) | 11c RG Memo 2026 Scholorships.pdf | 2025-11-21 09:11 | 209K | |
![[ ]](/icons/pdf.gif) | 11d 2026-05-26 Storage Containers Council report.pdf | 2026-05-22 15:13 | 351K | |
![[ ]](/icons/pdf.gif) | 11d DP 2025-10-01 Amendment 279 Tal Rd 2026-04-28 Council rpt DRAFT.pdf | 2026-04-23 16:23 | 646K | |
![[ ]](/icons/pdf.gif) | 11d DP2026-03 118 Beech.pdf | 2026-01-23 14:54 | 5.4M | |
![[ ]](/icons/pdf.gif) | 11d DS Memo Lakeview and Clec Budget.pdf | 2025-11-21 09:11 | 459K | |
![[ ]](/icons/pdf.gif) | 11d DVP2025-08 476 Winter Drive.pdf | 2025-10-24 16:05 | 4.2M | |
![[ ]](/icons/pdf.gif) | 11d Riverside Inn Prelim Hours Change.pdf | 2026-02-20 15:13 | 490K | |
![[ ]](/icons/pdf.gif) | 11d staff report 340 Grants Lake Road 25-12-16.pdf | 2025-12-12 16:18 | 199K | |
![[ ]](/icons/pdf.gif) | 11e 2026-05-26 Firefighters Assoc Liquor Lic Council rpt.pdf | 2026-05-22 15:16 | 2.6M | |
![[ ]](/icons/pdf.gif) | 11e DP2026-01-01 Slopes Ph 6 2026-04-28 Council rpt DRAFT.pdf | 2026-04-23 16:23 | 16M | |
![[ ]](/icons/pdf.gif) | 11e DP2026-04 464 Mountain View.pdf | 2026-01-23 14:53 | 4.3M | |
![[ ]](/icons/pdf.gif) | 11e RG Memo Budget Process Revised.pdf | 2025-10-24 16:05 | 227K | |
![[ ]](/icons/pdf.gif) | 11e fdoct25.pdf | 2025-11-21 09:11 | 1.0M | |
![[ ]](/icons/pdf.gif) | 11f DVP 2025-09 38 Prospect Ave Staff rpt 04-28-2026 Council DRAFT.pdf | 2026-04-23 16:21 | 1.0M | |
![[ ]](/icons/pdf.gif) | 11f Insurance Renewal.pdf | 2025-10-24 16:05 | 253K | |
![[ ]](/icons/pdf.gif) | 11f LCRB Cannabis.pdf | 2026-01-23 14:53 | 1.0M | |
![[ ]](/icons/pdf.gif) | 11f Staff Report - Council Compensation Review.pdf | 2025-11-21 09:11 | 341K | |
![[ ]](/icons/pdf.gif) | 11f staff report re ICBL Agree and Bylaw.pdf | 2026-05-22 15:13 | 702K | |
![[ ]](/icons/pdf.gif) | 11g 2026-01-27 DRAFT HNR GIS analysis Council rpt.pdf | 2026-02-04 15:19 | 7.0M | |
![[ ]](/icons/pdf.gif) | 11g Kaatza Museum.pdf | 2025-10-24 16:05 | 285K | |
![[ ]](/icons/pdf.gif) | 11g Privacy Policy.pdf | 2026-05-22 15:13 | 409K | |
![[ ]](/icons/pdf.gif) | 11g staff memo Privacy Policy.pdf | 2026-05-22 15:13 | 669K | |
![[ ]](/icons/pdf.gif) | 11h Cowichan Local Authority Emergency Management Agreement.pdf | 2026-05-22 15:31 | 492K | |
![[ ]](/icons/pdf.gif) | 11h Fire Dept Increase 2026 budget REG26-01-27.pdf | 2026-01-23 14:53 | 211K | |
![[ ]](/icons/pdf.gif) | 11h RG Memo Ambulance building heat pump.pdf | 2025-10-24 16:05 | 211K | |
![[ ]](/icons/pdf.gif) | 11i FD 2026 Budget.pdf | 2025-10-24 16:05 | 329K | |
![[ ]](/icons/pdf.gif) | 11i Memo - Cash Balances and Reserves.pdf | 2026-01-23 14:56 | 257K | |
![[ ]](/icons/pdf.gif) | 11i staff report re Beer Garden Request.pdf | 2026-05-22 15:16 | 561K | |
![[ ]](/icons/pdf.gif) | 11j EMC 2026 Emergency Management Grants - UBCM.pdf | 2026-05-22 15:25 | 1.0M | |
![[ ]](/icons/pdf.gif) | 11j Lakeview Park - Wave Grant Application.pdf | 2026-01-23 14:53 | 214K | |
![[ ]](/icons/pdf.gif) | 12a 1123a.pdf | 2025-10-24 16:07 | 104K | |
![[ ]](/icons/pdf.gif) | 12a 1124 Zoning R3.pdf | 2026-02-20 15:14 | 427K | |
![[ ]](/icons/pdf.gif) | 12a 1126-3 council renum.pdf | 2025-12-12 16:18 | 253K | |
![[ ]](/icons/pdf.gif) | 12a 1126a council renum.pdf | 2025-12-19 13:10 | 237K | |
![[ ]](/icons/pdf.gif) | 12a 1127a fees.pdf | 2026-01-23 14:56 | 305K | |
![[ ]](/icons/pdf.gif) | 12a 1131-2026 5Year Plan 2026-2030.pdf | 2026-05-08 17:14 | 317K | |
![[ ]](/icons/pdf.gif) | 12a Bylaw 1125 Development Application Procedures April 17 2026 FINAL.pdf | 2026-04-23 16:23 | 292K | |
![[ ]](/icons/pdf.gif) | 12a Bylaw 1125 Development Approval Procedures.pdf | 2026-05-22 15:16 | 295K | |
![[ ]](/icons/pdf.gif) | 12a Council Remun Bylaw.pdf | 2025-11-21 09:52 | 243K | |
![[ ]](/icons/pdf.gif) | 12a Council Remuneration 1126 – 2025.pdf | 2025-11-21 09:51 | 243K | |
![[ ]](/icons/pdf.gif) | 12b 1124-1 zone amend r3.pdf | 2025-12-12 16:18 | 346K | |
![[ ]](/icons/pdf.gif) | 12b 1124-1 zoning R3.pdf | 2026-01-23 14:56 | 346K | |
![[ ]](/icons/pdf.gif) | 12b 1127-3 fees.pdf | 2025-12-19 14:24 | 305K | |
![[ ]](/icons/pdf.gif) | 12b 1132-2026 Annual Rates 2026.pdf | 2026-05-08 17:13 | 248K | |
![[ ]](/icons/pdf.gif) | 12b Bylaw 1129 Public Notice Bylaw - April 17 2026 FINAL.pdf | 2026-04-23 16:23 | 151K | |
![[ ]](/icons/pdf.gif) | 12b Bylaw 1129 Public Notice Bylaw.pdf | 2026-05-22 15:16 | 152K | |
![[ ]](/icons/pdf.gif) | 12c 1127-1 fees.pdf | 2025-12-12 16:17 | 304K | |
![[ ]](/icons/pdf.gif) | 12c 1128-1 intercommunity.pdf | 2026-01-23 14:55 | 256K | |
![[ ]](/icons/pdf.gif) | 12c Bylaw 1130 Fee Bylaw Amendment Bylaw FINAL.pdf | 2026-05-22 15:15 | 320K | |
![[ ]](/icons/pdf.gif) | 12d 1128-2026 Vancouver Island ICBL Bylaw.pdf | 2026-05-22 15:15 | 251K | |
![[ ]](/icons/pdf.gif) | 12d 1131-2026 5Year Plan 2026-2030.pdf | 2026-04-23 16:21 | 448K | |
![[ ]](/icons/pdf.gif) | 12e 1132-2026 Annual Rates 2026.pdf | 2026-04-23 16:21 | 222K | |
![[ ]](/icons/pdf.gif) | 12e 1133-2026 elections bylaw - Clean Version.pdf | 2026-05-22 15:13 | 397K | |
![[ ]](/icons/pdf.gif) | 13a APPOINTMENT OF FREEMAN OF THE LAND.pdf | 2025-10-24 16:05 | 113K | |
![[ ]](/icons/pdf.gif) | 13b Adjustment of Thresholds in purchasing Authorization Policy.pdf | 2026-01-23 16:35 | 319K | |
![[ ]](/icons/pdf.gif) | 19-11-26.pdf | 2020-01-15 16:31 | 143K | |
![[ ]](/icons/pdf.gif) | 19-12-17.pdf | 2020-01-29 12:05 | 123K | |
![[ ]](/icons/pdf.gif) | 20-01-28.pdf | 2020-05-22 11:12 | 120K | |
![[ ]](/icons/pdf.gif) | 20-02-04 Special.pdf | 2020-04-02 15:00 | 89K | |
![[ ]](/icons/pdf.gif) | 20-02-25.pdf | 2020-04-02 15:00 | 127K | |
![[ ]](/icons/pdf.gif) | 20-02-25 PHearing.pdf | 2020-04-01 15:38 | 155K | |
![[ ]](/icons/pdf.gif) | 20-03-10.pdf | 2020-04-01 15:44 | 99K | |
![[ ]](/icons/pdf.gif) | 20-03-17.pdf | 2020-04-01 16:18 | 94K | |
![[ ]](/icons/pdf.gif) | 20-03-17P.pdf | 2020-04-01 16:21 | 104K | |
![[ ]](/icons/pdf.gif) | 20-04-01 Special.pdf | 2020-04-29 14:04 | 152K | |
![[ ]](/icons/pdf.gif) | 20-04-15 Special.pdf | 2020-04-29 14:04 | 166K | |
![[ ]](/icons/pdf.gif) | 20-04-27 Special.pdf | 2020-07-21 11:56 | 88K | |
![[ ]](/icons/pdf.gif) | 20-05-08 Special.pdf | 2020-07-21 15:52 | 109K | |
![[ ]](/icons/pdf.gif) | 20-05-22 Special.pdf | 2020-07-21 16:32 | 124K | |
![[ ]](/icons/pdf.gif) | 20-06-16.pdf | 2020-07-24 16:32 | 113K | |
![[ ]](/icons/pdf.gif) | 20-06-30.pdf | 2020-08-06 14:01 | 120K | |
![[ ]](/icons/pdf.gif) | 20-07-14 .pdf | 2020-07-24 15:16 | 118K | |
![[ ]](/icons/pdf.gif) | 20-07-21 .pdf | 2020-07-24 15:16 | 97K | |
![[ ]](/icons/pdf.gif) | 20-07-21.pdf | 2020-07-24 15:16 | 100K | |
![[ ]](/icons/pdf.gif) | 20-07-28-REG.pdf | 2020-08-21 15:34 | 141K | |
![[ ]](/icons/pdf.gif) | 20-07-28.pdf | 2020-09-01 12:36 | 130K | |
![[ ]](/icons/pdf.gif) | 20-08-11-FIN.pdf | 2020-08-21 15:35 | 121K | |
![[ ]](/icons/pdf.gif) | 20-08-11Special.pdf | 2020-09-01 12:36 | 86K | |
![[ ]](/icons/pdf.gif) | 20-08-18-PARKS.pdf | 2020-08-21 15:34 | 97K | |
![[ ]](/icons/pdf.gif) | 20-08-18-PW.pdf | 2020-08-21 15:34 | 98K | |
![[ ]](/icons/pdf.gif) | 20-08-25.pdf | 2020-09-25 14:48 | 123K | |
![[ ]](/icons/pdf.gif) | 20-08-25 PHearing.pdf | 2020-10-23 17:15 | 84K | |
![[ ]](/icons/pdf.gif) | 20-09-08.pdf | 2020-09-25 14:48 | 108K | |
![[ ]](/icons/pdf.gif) | 20-09-15.pdf | 2020-09-25 14:48 | 82K | |
![[ ]](/icons/pdf.gif) | 20-09-15P.pdf | 2020-09-25 14:48 | 80K | |
![[ ]](/icons/pdf.gif) | 20-09-24.pdf | 2020-10-20 19:47 | 83K | |
![[ ]](/icons/pdf.gif) | 20-09-29.pdf | 2020-11-16 12:22 | 116K | |
![[ ]](/icons/pdf.gif) | 20-10-13.pdf | 2020-10-23 17:15 | 93K | |
![[ ]](/icons/pdf.gif) | 20-10-13 Special.pdf | 2020-11-16 12:22 | 83K | |
![[ ]](/icons/pdf.gif) | 20-10-20.pdf | 2020-10-23 17:33 | 81K | |
![[ ]](/icons/pdf.gif) | 20-10-22.pdf | 2020-11-23 11:47 | 75K | |
![[ ]](/icons/pdf.gif) | 20-10-27.pdf | 2020-12-24 13:12 | 148K | |
![[ ]](/icons/pdf.gif) | 20-10-27reg.pdf | 2020-11-20 15:38 | 149K | |
![[ ]](/icons/pdf.gif) | 20-11-10FA.pdf | 2020-11-23 10:04 | 99K | |
![[ ]](/icons/pdf.gif) | 20-11-10SIC.pdf | 2020-11-20 15:38 | 77K | |
![[ ]](/icons/pdf.gif) | 20-11-17pr.pdf | 2020-11-20 15:38 | 78K | |
![[ ]](/icons/pdf.gif) | 20-11-17pw.pdf | 2020-11-20 15:38 | 78K | |
![[ ]](/icons/pdf.gif) | 20-11-24reg.pdf | 2020-12-31 12:33 | 156K | |
![[ ]](/icons/pdf.gif) | 20-12-08FA.pdf | 2020-12-18 14:50 | 107K | |
![[ ]](/icons/pdf.gif) | 20-12-15PR.pdf | 2020-12-18 14:50 | 111K | |
![[ ]](/icons/pdf.gif) | 20-12-15PW.pdf | 2020-12-18 14:55 | 95K | |
![[ ]](/icons/pdf.gif) | 20-12-15SPEC.pdf | 2020-12-18 14:50 | 106K | |
![[ ]](/icons/pdf.gif) | 20-12-22REG.pdf | 2021-01-22 15:03 | 146K | |
![[ ]](/icons/pdf.gif) | 21-01-12FA.pdf | 2021-01-22 15:03 | 111K | |
![[ ]](/icons/pdf.gif) | 21-01-12SP.pdf | 2021-01-22 15:03 | 99K | |
![[ ]](/icons/pdf.gif) | 21-01-19PR.pdf | 2021-01-22 15:03 | 91K | |
![[ ]](/icons/pdf.gif) | 21-01-19PW.pdf | 2021-01-22 15:03 | 100K | |
![[ ]](/icons/pdf.gif) | 21-01-26REG.pdf | 2021-04-13 14:59 | 138K | |
![[ ]](/icons/pdf.gif) | 21-01-28.pdf | 2021-02-25 11:14 | 84K | |
![[ ]](/icons/pdf.gif) | 21-01-28CLR.pdf | 2021-02-19 15:16 | 123K | |
![[ ]](/icons/pdf.gif) | 21-02-02SPEC.pdf | 2021-04-13 15:06 | 88K | |
![[ ]](/icons/pdf.gif) | 21-02-09FA.pdf | 2021-02-19 15:15 | 90K | |
![[ ]](/icons/pdf.gif) | 21-02-09SP.pdf | 2021-02-19 15:15 | 82K | |
![[ ]](/icons/pdf.gif) | 21-02-16PR.pdf | 2021-02-19 15:15 | 110K | |
![[ ]](/icons/pdf.gif) | 21-02-16PW.pdf | 2021-02-19 15:15 | 81K | |
![[ ]](/icons/pdf.gif) | 21-02-23REG.pdf | 2021-04-13 15:06 | 130K | |
![[ ]](/icons/pdf.gif) | 21-02-25.pdf | 2021-03-23 14:48 | 77K | |
![[ ]](/icons/pdf.gif) | 21-03-09FA.pdf | 2021-03-19 15:25 | 97K | |
![[ ]](/icons/pdf.gif) | 21-03-09SP.pdf | 2021-03-19 15:25 | 87K | |
![[ ]](/icons/pdf.gif) | 21-03-16PR.pdf | 2021-03-19 15:25 | 92K | |
![[ ]](/icons/pdf.gif) | 21-03-16PW.pdf | 2021-03-19 15:25 | 86K | |
![[ ]](/icons/pdf.gif) | 21-03-23PH.pdf | 2021-04-23 15:12 | 87K | |
![[ ]](/icons/pdf.gif) | 21-03-23REG.pdf | 2021-06-03 15:18 | 146K | |
![[ ]](/icons/pdf.gif) | 21-04-13FA.pdf | 2021-04-23 15:12 | 92K | |
![[ ]](/icons/pdf.gif) | 21-04-13PTRRP.pdf | 2022-04-08 14:56 | 67K | |
![[ ]](/icons/pdf.gif) | 21-04-13SP.pdf | 2021-04-23 15:12 | 87K | |
![[ ]](/icons/pdf.gif) | 21-04-20PR.pdf | 2021-04-23 15:12 | 86K | |
![[ ]](/icons/pdf.gif) | 21-04-20PW.pdf | 2021-04-23 15:13 | 91K | |
![[ ]](/icons/pdf.gif) | 21-04-22.pdf | 2021-05-25 15:20 | 85K | |
![[ ]](/icons/pdf.gif) | 21-04-27REG.pdf | 2021-06-24 10:23 | 152K | |
![[ ]](/icons/pdf.gif) | 21-05-11FA.pdf | 2021-05-21 14:35 | 91K | |
![[ ]](/icons/pdf.gif) | 21-05-11SP - Copy.pdf | 2021-05-21 14:35 | 83K | |
![[ ]](/icons/pdf.gif) | 21-05-11SP.pdf | 2021-05-21 14:35 | 83K | |
![[ ]](/icons/pdf.gif) | 21-05-11SPEC.pdf | 2021-05-21 14:35 | 94K | |
![[ ]](/icons/pdf.gif) | 21-05-18PR.pdf | 2021-05-21 14:35 | 88K | |
![[ ]](/icons/pdf.gif) | 21-05-18PW.pdf | 2021-05-21 14:35 | 94K | |
![[ ]](/icons/pdf.gif) | 21-05-25REG.pdf | 2021-07-29 12:19 | 135K | |
![[ ]](/icons/pdf.gif) | 21-05-27.pdf | 2021-06-22 10:06 | 87K | |
![[ ]](/icons/pdf.gif) | 21-06-08FA.pdf | 2021-06-18 14:45 | 100K | |
![[ ]](/icons/pdf.gif) | 21-06-08SP.pdf | 2021-06-18 14:45 | 83K | |
![[ ]](/icons/pdf.gif) | 21-06-15PR.pdf | 2021-06-18 14:45 | 87K | |
![[ ]](/icons/pdf.gif) | 21-06-15PW.pdf | 2021-06-18 14:45 | 93K | |
![[ ]](/icons/pdf.gif) | 21-06-22AGM.pdf | 2021-07-23 15:23 | 72K | |
![[ ]](/icons/pdf.gif) | 21-06-22PH.pdf | 2021-07-23 15:15 | 106K | |
![[ ]](/icons/pdf.gif) | 21-06-22REG.pdf | 2021-07-27 12:50 | 123K | |
![[ ]](/icons/pdf.gif) | 21-06-24.pdf | 2021-09-20 16:12 | 74K | |
![[ ]](/icons/pdf.gif) | 21-07-13FA.pdf | 2021-07-23 15:15 | 88K | |
![[ ]](/icons/pdf.gif) | 21-07-13SP.pdf | 2021-07-23 15:15 | 83K | |
![[ ]](/icons/pdf.gif) | 21-07-20PR.pdf | 2021-07-25 16:59 | 89K | |
![[ ]](/icons/pdf.gif) | 21-07-20PW.pdf | 2021-07-23 15:15 | 89K | |
![[ ]](/icons/pdf.gif) | 21-07-27REG.pdf | 2021-09-24 17:20 | 143K | |
![[ ]](/icons/pdf.gif) | 21-08-10FA.pdf | 2021-08-20 12:57 | 87K | |
![[ ]](/icons/pdf.gif) | 21-08-10SP.pdf | 2021-08-20 12:57 | 91K | |
![[ ]](/icons/pdf.gif) | 21-08-17PR.pdf | 2021-08-20 12:57 | 80K | |
![[ ]](/icons/pdf.gif) | 21-08-17PW.pdf | 2021-08-20 12:57 | 96K | |
![[ ]](/icons/pdf.gif) | 21-08-24PH.pdf | 2021-09-24 15:52 | 125K | |
![[ ]](/icons/pdf.gif) | 21-08-24REG.pdf | 2021-10-22 16:12 | 128K | |
![[ ]](/icons/pdf.gif) | 21-09-07FA.pdf | 2021-09-24 15:53 | 97K | |
![[ ]](/icons/pdf.gif) | 21-09-07SP.pdf | 2021-09-24 15:53 | 89K | |
![[ ]](/icons/pdf.gif) | 21-09-21PR.pdf | 2021-09-24 15:53 | 81K | |
![[ ]](/icons/pdf.gif) | 21-09-21PW.pdf | 2021-09-24 15:53 | 90K | |
![[ ]](/icons/pdf.gif) | 21-09-23.pdf | 2021-10-26 14:01 | 87K | |
![[ ]](/icons/pdf.gif) | 21-09-28PH.pdf | 2021-10-22 15:46 | 89K | |
![[ ]](/icons/pdf.gif) | 21-09-28REG.pdf | 2021-12-08 11:50 | 131K | |
![[ ]](/icons/pdf.gif) | 21-10-12FA.pdf | 2021-10-22 15:55 | 93K | |
![[ ]](/icons/pdf.gif) | 21-10-12SP.pdf | 2021-10-22 15:55 | 76K | |
![[ ]](/icons/pdf.gif) | 21-10-12SPEC.pdf | 2021-12-08 11:54 | 94K | |
![[ ]](/icons/pdf.gif) | 21-10-19PR.pdf | 2021-10-22 15:55 | 78K | |
![[ ]](/icons/pdf.gif) | 21-10-19PW.pdf | 2021-10-22 15:56 | 87K | |
![[ ]](/icons/pdf.gif) | 21-10-26REG.pdf | 2021-12-08 12:10 | 162K | |
![[ ]](/icons/pdf.gif) | 21-10-28.pdf | 2021-11-22 13:59 | 88K | |
![[ ]](/icons/pdf.gif) | 21-11-09FA.pdf | 2021-11-19 15:46 | 95K | |
![[ ]](/icons/pdf.gif) | 21-11-09SP.pdf | 2021-11-19 15:46 | 77K | |
![[ ]](/icons/pdf.gif) | 21-11-16PR.pdf | 2021-11-19 15:46 | 84K | |
![[ ]](/icons/pdf.gif) | 21-11-16PW.pdf | 2021-11-19 15:46 | 93K | |
![[ ]](/icons/pdf.gif) | 21-11-23REG.pdf | 2022-02-18 16:05 | 159K | |
![[ ]](/icons/pdf.gif) | 21-11-24.pdf | 2021-12-12 19:06 | 92K | |
![[ ]](/icons/pdf.gif) | 21-11-30SPEC.pdf | 2022-02-18 16:05 | 85K | |
![[ ]](/icons/pdf.gif) | 21-12-07FA.pdf | 2021-12-17 15:25 | 89K | |
![[ ]](/icons/pdf.gif) | 21-12-07SP.pdf | 2021-12-17 15:25 | 79K | |
![[ ]](/icons/pdf.gif) | 21-12-14PR.pdf | 2021-12-17 16:05 | 82K | |
![[ ]](/icons/pdf.gif) | 21-12-14PW.pdf | 2021-12-22 14:25 | 86K | |
![[ ]](/icons/pdf.gif) | 21-12-16.pdf | 2022-01-24 11:33 | 79K | |
![[ ]](/icons/pdf.gif) | 21-12-21REG.pdf | 2022-02-18 16:05 | 169K | |
![[ ]](/icons/pdf.gif) | 21stage3.pdf | 2021-07-16 15:33 | 892K | |
![[ ]](/icons/pdf.gif) | 22-01-11CW.pdf | 2022-01-21 15:57 | 114K | |
![[ ]](/icons/pdf.gif) | 22-01-18CW.pdf | 2022-01-21 15:57 | 111K | |
![[ ]](/icons/pdf.gif) | 22-01-19CW.pdf | 2022-01-21 15:57 | 105K | |
![[ ]](/icons/pdf.gif) | 22-01-24CW.pdf | 2022-02-18 15:09 | 91K | |
![[ ]](/icons/pdf.gif) | 22-01-25REG.pdf | 2022-03-18 16:11 | 172K | |
![[ ]](/icons/pdf.gif) | 22-01-27.pdf | 2022-02-21 17:58 | 76K | |
![[ ]](/icons/pdf.gif) | 22-02-01CW.pdf | 2022-02-18 15:09 | 101K | |
![[ ]](/icons/pdf.gif) | 22-02-08CW.pdf | 2022-02-18 15:09 | 119K | |
![[ ]](/icons/pdf.gif) | 22-02-22REG.pdf | 2022-03-18 15:53 | 144K | |
![[ ]](/icons/pdf.gif) | 22-02-24.pdf | 2022-03-21 16:29 | 86K | |
![[ ]](/icons/pdf.gif) | 22-03-08CW.pdf | 2022-04-08 14:56 | 106K | |
![[ ]](/icons/pdf.gif) | 22-03-22PH.pdf | 2022-04-26 14:41 | 87K | |
![[ ]](/icons/pdf.gif) | 22-03-22REG.pdf | 2022-04-29 16:31 | 149K | |
![[ ]](/icons/pdf.gif) | 22-04-12CW.pdf | 2022-05-06 14:47 | 107K | |
![[ ]](/icons/pdf.gif) | 22-04-12PTRRP.pdf | 2023-04-05 16:29 | 67K | |
![[ ]](/icons/pdf.gif) | 22-04-26REG.pdf | 2022-06-24 16:38 | 140K | |
![[ ]](/icons/pdf.gif) | 22-05-10CW.pdf | 2022-05-20 14:27 | 106K | |
![[ ]](/icons/pdf.gif) | 22-05-10SPEC.pdf | 2022-06-25 12:51 | 97K | |
![[ ]](/icons/pdf.gif) | 22-05-24REG.pdf | 2022-06-29 09:47 | 123K | |
![[ ]](/icons/pdf.gif) | 22-06-14CW.pdf | 2022-06-24 14:59 | 116K | |
![[ ]](/icons/pdf.gif) | 22-06-21AGM.pdf | 2022-06-24 14:59 | 86K | |
![[ ]](/icons/pdf.gif) | 22-06-28REG.pdf | 2022-08-05 15:39 | 134K | |
![[ ]](/icons/pdf.gif) | 22-07-12CW.pdf | 2022-07-22 14:45 | 108K | |
![[ ]](/icons/pdf.gif) | 22-07-26REG.pdf | 2022-09-23 14:57 | 117K | |
![[ ]](/icons/pdf.gif) | 22-07-28.pdf | 2022-09-21 15:49 | 74K | |
![[ ]](/icons/pdf.gif) | 22-09-06CW.pdf | 2022-09-23 14:57 | 115K | |
![[ ]](/icons/pdf.gif) | 22-09-06SPEC.pdf | 2023-01-25 09:06 | 97K | |
![[ ]](/icons/pdf.gif) | 22-09-27REG.pdf | 2022-10-21 15:27 | 132K | |
![[ ]](/icons/pdf.gif) | 22-09-28.pdf | 2022-11-18 15:33 | 113K | |
![[ ]](/icons/pdf.gif) | 22-10-11CW.pdf | 2022-12-16 09:20 | 118K | |
![[ ]](/icons/pdf.gif) | 22-10-25REG.pdf | 2022-11-18 15:33 | 132K | |
![[ ]](/icons/pdf.gif) | 22-11-01INAUG.pdf | 2022-11-18 15:33 | 95K | |
![[ ]](/icons/pdf.gif) | 22-11-01SI.pdf | 2022-11-18 15:33 | 70K | |
![[ ]](/icons/pdf.gif) | 22-11-08CW.pdf | 2022-12-16 09:20 | 108K | |
![[ ]](/icons/pdf.gif) | 22-11-10.pdf | 2023-01-23 12:56 | 96K | |
![[ ]](/icons/pdf.gif) | 22-11-22PH.pdf | 2022-12-16 14:14 | 120K | |
![[ ]](/icons/pdf.gif) | 22-11-22REG.pdf | 2022-12-23 15:02 | 145K | |
![[ ]](/icons/pdf.gif) | 22-12-13CW.pdf | 2022-12-16 14:15 | 134K | |
![[ ]](/icons/pdf.gif) | 22-12-20REG.pdf | 2023-01-20 14:33 | 138K | |
![[ ]](/icons/pdf.gif) | 23-01-10CW.pdf | 2023-01-20 14:33 | 112K | |
![[ ]](/icons/pdf.gif) | 23-01-24REG.pdf | 2023-03-10 20:34 | 132K | |
![[ ]](/icons/pdf.gif) | 23-01-26.pdf | 2023-02-15 11:19 | 88K | |
![[ ]](/icons/pdf.gif) | 23-02-14CW.pdf | 2023-03-13 16:11 | 125K | |
![[ ]](/icons/pdf.gif) | 23-02-23.pdf | 2023-03-17 15:45 | 80K | |
![[ ]](/icons/pdf.gif) | 23-02-28REG.pdf | 2023-03-24 15:47 | 249K | |
![[ ]](/icons/pdf.gif) | 23-03-14CW.pdf | 2023-03-24 15:47 | 172K | |
![[ ]](/icons/pdf.gif) | 23-03-23.pdf | 2023-04-24 15:29 | 79K | |
![[ ]](/icons/pdf.gif) | 23-03-28PH.pdf | 2023-04-21 15:13 | 209K | |
![[ ]](/icons/pdf.gif) | 23-03-28REG.pdf | 2023-05-04 15:15 | 249K | |
![[ ]](/icons/pdf.gif) | 23-04-11CW.pdf | 2023-04-21 15:13 | 245K | |
![[ ]](/icons/pdf.gif) | 23-04-11PTRRP.pdf | 2024-04-05 15:34 | 165K | |
![[ ]](/icons/pdf.gif) | 23-04-25REG.pdf | 2023-07-19 16:12 | 265K | |
![[ ]](/icons/pdf.gif) | 23-05-09CW.pdf | 2023-05-19 14:36 | 222K | |
![[ ]](/icons/pdf.gif) | 23-05-09SPEC.pdf | 2023-05-19 14:36 | 190K | |
![[ ]](/icons/pdf.gif) | 23-05-23PH.pdf | 2023-06-23 15:02 | 180K | |
![[ ]](/icons/pdf.gif) | 23-05-23REG.pdf | 2023-07-19 16:24 | 251K | |
![[ ]](/icons/pdf.gif) | 23-06-13CW.pdf | 2023-06-23 15:02 | 228K | |
![[ ]](/icons/pdf.gif) | 23-06-27 AGM.pdf | 2023-07-21 15:26 | 139K | |
![[ ]](/icons/pdf.gif) | 23-06-27ANNUAL.pdf | 2023-07-21 16:06 | 139K | |
![[ ]](/icons/pdf.gif) | 23-06-27REG.pdf | 2023-07-21 15:26 | 234K | |
![[ ]](/icons/pdf.gif) | 23-06-29.pdf | 2023-07-23 17:18 | 89K | |
![[ ]](/icons/pdf.gif) | 23-07-11CW.pdf | 2023-07-21 15:52 | 197K | |
![[ ]](/icons/pdf.gif) | 23-07-25REG.pdf | 2023-10-05 10:03 | 266K | |
![[ ]](/icons/pdf.gif) | 23-07-27.pdf | 2023-09-18 15:01 | 91K | |
![[ ]](/icons/pdf.gif) | 23-09-12CW.pdf | 2023-10-06 14:14 | 227K | |
![[ ]](/icons/pdf.gif) | 23-09-12SPEC.pdf | 2023-10-05 10:03 | 199K | |
![[ ]](/icons/pdf.gif) | 23-09-21.pdf | 2023-10-20 15:55 | 78K | |
![[ ]](/icons/pdf.gif) | 23-09-26REG.pdf | 2023-11-15 10:00 | 261K | |
![[ ]](/icons/pdf.gif) | 23-10-10CW.pdf | 2023-11-10 15:10 | 205K | |
![[ ]](/icons/pdf.gif) | 23-10-24REG.pdf | 2023-11-24 15:04 | 251K | |
![[ ]](/icons/pdf.gif) | 23-10-26.pdf | 2024-01-22 09:13 | 200K | |
![[ ]](/icons/pdf.gif) | 23-11-14CW.pdf | 2023-11-24 15:04 | 204K | |
![[ ]](/icons/pdf.gif) | 23-11-28REG.pdf | 2023-12-15 14:30 | 255K | |
![[ ]](/icons/pdf.gif) | 23-12-12CW.pdf | 2023-12-15 14:37 | 226K | |
![[ ]](/icons/pdf.gif) | 23-12-19REG.pdf | 2024-01-30 16:26 | 250K | |
![[ ]](/icons/pdf.gif) | 24-01-09CW.pdf | 2024-01-19 15:43 | 206K | |
![[ ]](/icons/pdf.gif) | 24-01-23REG.pdf | 2024-03-20 16:02 | 251K | |
![[ ]](/icons/pdf.gif) | 24-01-25.pdf | 2024-02-26 15:15 | 74K | |
![[ ]](/icons/pdf.gif) | 24-02-13CW.pdf | 2024-02-23 15:00 | 217K | |
![[ ]](/icons/pdf.gif) | 24-02-27REG.pdf | 2024-04-19 16:19 | 258K | |
![[ ]](/icons/pdf.gif) | 24-02-29.pdf | 2024-03-26 08:22 | 82K | |
![[ ]](/icons/pdf.gif) | 24-03-12CW.pdf | 2024-03-22 12:09 | 205K | |
![[ ]](/icons/pdf.gif) | 24-03-26PH1.pdf | 2024-04-19 14:20 | 192K | |
![[ ]](/icons/pdf.gif) | 24-03-26PH2.pdf | 2024-04-19 14:20 | 202K | |
![[ ]](/icons/pdf.gif) | 24-03-26REG.pdf | 2024-05-08 10:32 | 248K | |
![[ ]](/icons/pdf.gif) | 24-03-28.pdf | 2024-04-23 13:00 | 77K | |
![[ ]](/icons/pdf.gif) | 24-04-09CW.pdf | 2024-04-19 14:20 | 207K | |
![[ ]](/icons/pdf.gif) | 24-04-09PTRRP.pdf | 2025-04-04 15:34 | 156K | |
![[ ]](/icons/pdf.gif) | 24-04-23REG.pdf | 2024-05-24 15:52 | 217K | |
![[ ]](/icons/pdf.gif) | 24-05-14CW.pdf | 2024-05-24 15:53 | 223K | |
![[ ]](/icons/pdf.gif) | 24-05-14SPEC.pdf | 2024-05-24 15:53 | 199K | |
![[ ]](/icons/pdf.gif) | 24-05-28REG.pdf | 2024-06-21 16:16 | 256K | |
![[ ]](/icons/pdf.gif) | 24-06-11CW.pdf | 2024-06-21 16:16 | 230K | |
![[ ]](/icons/pdf.gif) | 24-06-25AGM.pdf | 2024-07-19 14:19 | 142K | |
![[ ]](/icons/pdf.gif) | 24-06-25PH.pdf | 2024-07-19 14:19 | 184K | |
![[ ]](/icons/pdf.gif) | 24-06-25REG.pdf | 2024-07-26 15:21 | 236K | |
![[ ]](/icons/pdf.gif) | 24-07-09CW.pdf | 2024-07-19 14:19 | 211K | |
![[ ]](/icons/pdf.gif) | 24-07-23REG.pdf | 2024-09-20 17:59 | 244K | |
![[ ]](/icons/pdf.gif) | 24-07-25.pdf | 2024-09-23 15:32 | 78K | |
![[ ]](/icons/pdf.gif) | 24-09-10CW.pdf | 2024-10-04 15:50 | 231K | |
![[ ]](/icons/pdf.gif) | 24-09-24PH.pdf | 2024-10-18 14:56 | 198K | |
![[ ]](/icons/pdf.gif) | 24-09-24REG.pdf | 2024-10-30 08:35 | 234K | |
![[ ]](/icons/pdf.gif) | 24-09-26.pdf | 2024-10-21 16:08 | 78K | |
![[ ]](/icons/pdf.gif) | 24-10-08CW.pdf | 2024-10-18 14:56 | 215K | |
![[ ]](/icons/pdf.gif) | 24-10-22REG.pdf | 2024-11-27 15:30 | 265K | |
![[ ]](/icons/pdf.gif) | 24-10-24.pdf | 2024-11-18 15:16 | 81K | |
![[ ]](/icons/pdf.gif) | 24-11-12CW.pdf | 2024-11-22 14:24 | 216K | |
![[ ]](/icons/pdf.gif) | 24-11-21.pdf | 2025-01-27 16:12 | 86K | |
![[ ]](/icons/pdf.gif) | 24-11-26PH.pdf | 2024-12-13 15:05 | 195K | |
![[ ]](/icons/pdf.gif) | 24-11-26REG.pdf | 2024-12-13 15:05 | 249K | |
![[ ]](/icons/pdf.gif) | 24-12-10CW.pdf | 2024-12-13 15:59 | 193K | |
![[ ]](/icons/pdf.gif) | 24-12-17REG.pdf | 2025-02-10 14:27 | 232K | |
![[ ]](/icons/pdf.gif) | 24SOFI.pdf | 2025-06-20 14:06 | 3.6M | |
![[ ]](/icons/pdf.gif) | 25-01-14CW.pdf | 2025-01-24 15:38 | 225K | |
![[ ]](/icons/pdf.gif) | 25-01-28REG.pdf | 2025-02-21 16:08 | 225K | |
![[ ]](/icons/pdf.gif) | 25-01-30APC.pdf | 2025-02-21 16:05 | 172K | |
![[ ]](/icons/pdf.gif) | 25-02-11CW.pdf | 2025-03-07 16:11 | 217K | |
![[ ]](/icons/pdf.gif) | 25-02-25REG.pdf | 2025-03-21 15:41 | 213K | |
![[ ]](/icons/pdf.gif) | 25-02-27APC.pdf | 2025-03-20 14:24 | 175K | |
![[ ]](/icons/pdf.gif) | 25-03-11CW.pdf | 2025-03-21 15:41 | 210K | |
![[ ]](/icons/pdf.gif) | 25-03-25REG.pdf | 2025-05-09 16:02 | 227K | |
![[ ]](/icons/pdf.gif) | 25-03-27APC.pdf | 2025-04-17 16:36 | 175K | |
![[ ]](/icons/pdf.gif) | 25-04-08CW.pdf | 2025-04-17 15:36 | 221K | |
![[ ]](/icons/pdf.gif) | 25-04-08PTRRP.pdf | 2026-04-10 16:25 | 275K | |
![[ ]](/icons/pdf.gif) | 25-04-22REG.pdf | 2025-05-23 13:36 | 215K | |
![[ ]](/icons/pdf.gif) | 25-04-24APC.pdf | 2025-06-20 14:01 | 232K | |
![[ ]](/icons/pdf.gif) | 25-04-25.pdf | 2024-05-17 15:27 | 83K | |
![[ ]](/icons/pdf.gif) | 25-05-05PM.pdf | 2025-05-09 16:27 | 149K | |
![[ ]](/icons/pdf.gif) | 25-05-06SPEC.pdf | 2025-05-23 13:37 | 170K | |
![[ ]](/icons/pdf.gif) | 25-05-13CW.pdf | 2025-12-17 16:30 | 208K | |
![[ ]](/icons/pdf.gif) | 25-05-27REG.pdf | 2025-06-20 14:08 | 310K | |
![[ ]](/icons/pdf.gif) | 25-05-30.pdf | 2024-06-25 10:38 | 85K | |
![[ ]](/icons/pdf.gif) | 25-06-10CW.pdf | 2025-06-20 14:33 | 243K | |
![[ ]](/icons/pdf.gif) | 25-06-24AGM.pdf | 2025-07-18 14:09 | 197K | |
![[ ]](/icons/pdf.gif) | 25-06-24REG.pdf | 2025-07-18 14:45 | 280K | |
![[ ]](/icons/pdf.gif) | 25-06-26APC.pdf | 2025-09-15 11:38 | 235K | |
![[ ]](/icons/pdf.gif) | 25-06-27.pdf | 2024-07-22 12:02 | 77K | |
![[ ]](/icons/pdf.gif) | 25-07-08CW.pdf | 2025-07-18 14:05 | 249K | |
![[ ]](/icons/pdf.gif) | 25-07-08SPEC.pdf | 2025-07-18 14:05 | 263K | |
![[ ]](/icons/pdf.gif) | 25-07-22REG.pdf | 2025-08-28 11:26 | 283K | |
![[ ]](/icons/pdf.gif) | 25-08-19SPEC.pdf | 2025-09-12 15:48 | 265K | |
![[ ]](/icons/pdf.gif) | 25-09-09CW.pdf | 2025-09-12 15:48 | 274K | |
![[ ]](/icons/pdf.gif) | 25-09-09SPEC.pdf | 2025-11-20 16:01 | 270K | |
![[ ]](/icons/pdf.gif) | 25-09-16REG.pdf | 2026-05-05 16:11 | 276K | |
![[ ]](/icons/pdf.gif) | 25-09-18APC.pdf | 2025-10-21 14:31 | 240K | |
![[ ]](/icons/pdf.gif) | 25-10-14CW.pdf | 2025-11-20 16:00 | 256K | |
![[ ]](/icons/pdf.gif) | 25-10-23APC.pdf | 2025-12-12 13:48 | 241K | |
![[ ]](/icons/pdf.gif) | 25-10-23 APC staff report STR framework.pdf | 2025-10-21 14:30 | 204K | |
![[ ]](/icons/unknown.gif) | 25-10-28REG.docx | 2026-05-05 16:11 | 124K | |
![[ ]](/icons/pdf.gif) | 25-10-28REG.pdf | 2026-05-05 16:22 | 267K | |
![[ ]](/icons/unknown.gif) | 25-11-25REG.docx | 2026-05-05 16:11 | 119K | |
![[ ]](/icons/pdf.gif) | 25-11-25REG.pdf | 2026-05-05 16:22 | 273K | |
![[ ]](/icons/unknown.gif) | 25-12-16REG.docx | 2026-05-05 16:11 | 119K | |
![[ ]](/icons/pdf.gif) | 25-12-16REG.pdf | 2026-05-05 16:22 | 249K | |
![[ ]](/icons/pdf.gif) | 25-12-18APC.pdf | 2026-01-21 08:51 | 228K | |
![[ ]](/icons/unknown.gif) | 25-12-23SPEC.docx | 2026-05-05 16:11 | 106K | |
![[ ]](/icons/pdf.gif) | 25-12-23SPEC.pdf | 2026-05-05 16:28 | 200K | |
![[ ]](/icons/pdf.gif) | 25 Cow Extend Hours.pdf | 2025-06-20 14:33 | 3.1M | |
![[ ]](/icons/pdf.gif) | 25general.pdf | 2025-04-04 15:37 | 2.7M | |
![[ ]](/icons/pdf.gif) | 25ubfund.pdf | 2025-04-04 15:38 | 2.0M | |
![[ ]](/icons/pdf.gif) | 26-01-22APC.pdf | 2026-03-25 11:38 | 227K | |
![[ ]](/icons/unknown.gif) | 26-01-27REG.docx | 2026-05-05 16:11 | 124K | |
![[ ]](/icons/pdf.gif) | 26-01-27REG.pdf | 2026-05-05 16:22 | 261K | |
![[ ]](/icons/unknown.gif) | 26-02-24REG.docx | 2026-05-05 16:11 | 121K | |
![[ ]](/icons/pdf.gif) | 26-02-24REG.pdf | 2026-05-05 16:22 | 252K | |
![[ ]](/icons/unknown.gif) | 26-03-24REG.docx | 2026-05-05 16:11 | 122K | |
![[ ]](/icons/pdf.gif) | 26-03-24REG.pdf | 2026-05-05 16:22 | 246K | |
![[ ]](/icons/pdf.gif) | 26-03-26APC.pdf | 2026-04-22 14:14 | 302K | |
![[ ]](/icons/pdf.gif) | 26-04-23APC.pdf | 2026-05-15 15:46 | 213K | |
![[ ]](/icons/pdf.gif) | 26Ohtaki.pdf | 2025-09-12 15:48 | 43K | |
![[ ]](/icons/pdf.gif) | 27-04-23.pdf | 2023-05-23 11:46 | 75K | |
![[ ]](/icons/pdf.gif) | 27-05-24.pdf | 2023-06-26 11:45 | 85K | |
![[ ]](/icons/pdf.gif) | 28-10-25REG.pdf | 2025-12-18 08:43 | 305K | |
![[ ]](/icons/pdf.gif) | 63 CLR Required Remedial.pdf | 2023-04-21 15:13 | 513K | |
![[ ]](/icons/pdf.gif) | 63CLRupdate.pdf | 2023-10-20 14:20 | 265K | |
![[ ]](/icons/pdf.gif) | 63 Cowichan Lk Rd Update may23r.pdf | 2023-06-09 15:45 | 1.7M | |
![[ ]](/icons/pdf.gif) | 63clr unsightly.pdf | 2023-03-10 13:05 | 467K | |
![[ ]](/icons/pdf.gif) | 65cowichanlake.pdf | 2023-11-10 15:20 | 59K | |
![[ ]](/icons/pdf.gif) | 80+Seniors-COVID-poster.pdf | 2021-03-09 15:00 | 563K | |
![[IMG]](/icons/image2.gif) | 80+dates-IG-v3.jpg | 2021-03-17 10:31 | 260K | |
![[ ]](/icons/pdf.gif) | 80plus poster-v5.pdf | 2021-03-17 10:27 | 407K | |
![[IMG]](/icons/image2.gif) | 90-unvaccinated-ig.png | 2021-08-12 17:50 | 101K | |
![[ ]](/icons/pdf.gif) | 96yparliament.pdf | 2024-10-18 14:56 | 3.9M | |
![[ ]](/icons/pdf.gif) | 200 year floodplain.pdf | 2022-02-21 17:58 | 319K | |
![[ ]](/icons/pdf.gif) | 715-2000 Sewer Works Reserve Fund Establishment.pdf | 2016-12-13 10:09 | 73K | |
![[ ]](/icons/pdf.gif) | 716-2000 Water Works Reserve Fund Establishment.pdf | 2016-12-13 10:11 | 73K | |
![[ ]](/icons/pdf.gif) | 717-2000 Municipal Building Reserve Fund Establishment.pdf | 2016-12-13 10:11 | 76K | |
![[ ]](/icons/pdf.gif) | 728-2001 Bylaw.pdf | 2017-09-01 16:36 | 38K | |
![[ ]](/icons/pdf.gif) | 747-2002-Regulatory Fees for Development.pdf | 2016-12-13 09:31 | 833K | |
![[ ]](/icons/pdf.gif) | 759-2003-Traffic.pdf | 2019-09-19 09:43 | 85K | |
![[ ]](/icons/pdf.gif) | 773-2003-Intermunicipal Business License Agreement.pdf | 2016-10-19 11:49 | 54K | |
![[ ]](/icons/pdf.gif) | 777-2003-Business Licensing.pdf | 2016-12-13 10:04 | 94K | |
![[ ]](/icons/pdf.gif) | 802-2005.pdf | 2016-10-19 11:49 | 93K | |
![[ ]](/icons/pdf.gif) | 807-2005.pdf | 2016-10-19 11:49 | 3.4M | |
![[ ]](/icons/pdf.gif) | 825-2006.pdf | 2016-10-19 11:49 | 16K | |
![[ ]](/icons/pdf.gif) | 875-2009-Sidewalk and Boulevard Bylaw.pdf | 2016-10-19 11:49 | 20K | |
![[ ]](/icons/pdf.gif) | 876-2009-Noise.pdf | 2016-10-19 11:49 | 47K | |
![[ ]](/icons/pdf.gif) | 878-2009 Outdoor Burning Regulation.pdf | 2016-10-19 11:49 | 89K | |
![[ ]](/icons/pdf.gif) | 888-2010 - OCP Amend.pdf | 2022-07-14 09:39 | 93K | |
![[ ]](/icons/pdf.gif) | 912-2011 Reserve Fund Parks Capital Improvements.pdf | 2016-10-19 11:50 | 11K | |
![[ ]](/icons/pdf.gif) | 915-2012 Board of Variance.pdf | 2017-10-12 16:09 | 32K | |
![[ ]](/icons/pdf.gif) | 919-2012 Parks Regulations.pdf | 2019-09-12 11:32 | 34K | |
![[ ]](/icons/pdf.gif) | 935-2013 Zoning.pdf | 2019-09-05 16:33 | 5.7M | |
![[ ]](/icons/pdf.gif) | 946-2014-False Alarms.pdf | 2016-10-19 11:51 | 42K | |
![[ ]](/icons/pdf.gif) | 974-2016 Subdivision, Works & ServicesCons.pdf | 2021-10-26 14:01 | 600K | |
![[ ]](/icons/pdf.gif) | 981-2016 Revitalization Tax Exemption Programme.pdf | 2017-05-08 09:06 | 1.0M | |
![[ ]](/icons/pdf.gif) | 987-2017 Building Regulations.pdf | 2017-10-05 08:22 | 375K | |
![[ ]](/icons/pdf.gif) | 989-2017 5Year Plan 2017-2021.pdf | 2017-05-11 13:29 | 577K | |
![[ ]](/icons/pdf.gif) | 990-2017 Annual Rates 2017.pdf | 2017-05-11 13:29 | 254K | |
![[ ]](/icons/pdf.gif) | 992-2017 Fees and Charges for Services.pdf | 2017-11-24 10:16 | 195K | |
![[ ]](/icons/pdf.gif) | 993-2017 Development Procedures Bylaw.pdf | 2017-11-24 10:41 | 353K | |
![[ ]](/icons/pdf.gif) | 996-2017 Permisive-KG Seniors Affordable Housing.pdf | 2017-11-24 10:16 | 68K | |
![[ ]](/icons/pdf.gif) | 997-2017-APC Commission.pdf | 2018-04-19 12:04 | 109K | |
![[ ]](/icons/pdf.gif) | 997-2017-APC Commission Bylaw TLC.pdf | 2025-01-27 16:12 | 109K | |
![[ ]](/icons/pdf.gif) | 998-2017 Building Regulations.pdf | 2018-04-05 14:16 | 230K | |
![[ ]](/icons/pdf.gif) | 999-2017 Fees and Charges for Services.pdf | 2018-04-05 09:09 | 286K | |
![[ ]](/icons/pdf.gif) | 1003-2018 5Year Plan 2018-2022.pdf | 2018-07-09 14:43 | 292K | |
![[ ]](/icons/pdf.gif) | 1004-2018 Annual Rates 2018.pdf | 2018-07-09 14:44 | 96K | |
![[ ]](/icons/pdf.gif) | 1006-2018 Council Procedures.pdf | 2018-10-24 16:27 | 267K | |
![[ ]](/icons/pdf.gif) | 1008-2018 Columbarium Bylaw.pdf | 2019-01-17 16:14 | 136K | |
![[ ]](/icons/pdf.gif) | 1010-2018 Council Remuneration and Expenses.pdf | 2018-12-10 10:57 | 111K | |
![[ ]](/icons/pdf.gif) | 1012-2018 Inter Community Business Licence.pdf | 2019-10-15 14:51 | 141K | |
![[ ]](/icons/pdf.gif) | 1013-2018 Water Rates and Regulations.pdf | 2019-01-14 15:38 | 274K | |
![[ ]](/icons/pdf.gif) | 1014-2018 Sewer Rates and Regulations.pdf | 2019-01-14 15:38 | 294K | |
![[ ]](/icons/pdf.gif) | 1015-2018 Waste Rates and Regulations.pdf | 2019-01-14 15:38 | 182K | |
![[ ]](/icons/pdf.gif) | 1017-2018 Fees and Charges for Services.pdf | 2019-01-24 15:11 | 293K | |
![[ ]](/icons/pdf.gif) | 1019-2019 Animal Control.pdf | 2019-08-28 12:33 | 172K | |
![[ ]](/icons/pdf.gif) | 1020-2019 5Year Plan 2019-2023.pdf | 2019-10-02 09:30 | 286K | |
![[ ]](/icons/pdf.gif) | 1021-2019 Annual Rates 2019.pdf | 2019-10-02 09:30 | 96K | |
![[ ]](/icons/pdf.gif) | 1025-2019-PTE-Churches and NotforProfit.pdf | 2019-10-24 16:18 | 192K | |
![[ ]](/icons/pdf.gif) | 1029-2019-Permissive-Boat Launch-North Shore.pdf | 2019-10-24 16:18 | 64K | |
![[ ]](/icons/pdf.gif) | 1031-2020 Fees and Charges for Services.pdf | 2020-07-06 11:05 | 196K | |
![[ ]](/icons/pdf.gif) | 1032-2020 Waste Rates and Regulations.pdf | 2020-07-06 10:33 | 152K | |
![[ ]](/icons/pdf.gif) | 1034-2020-Parcel Tax Sewer.pdf | 2020-07-06 10:56 | 80K | |
![[ ]](/icons/pdf.gif) | 1035-2020-Parcel Tax Water.pdf | 2020-07-06 10:56 | 81K | |
![[ ]](/icons/pdf.gif) | 1036-2020 Snow Removal Reserve Fund.pdf | 2020-03-31 14:30 | 45K | |
![[ ]](/icons/pdf.gif) | 1037-2020 5Year Plan 2020-2024.pdf | 2021-03-17 11:20 | 286K | |
![[ ]](/icons/pdf.gif) | 1038-2020 Annual Rates 2020.pdf | 2020-05-22 12:59 | 255K | |
![[ ]](/icons/pdf.gif) | 1039-2020 Emergency Plan.pdf | 2020-07-24 14:41 | 64K | |
![[ ]](/icons/pdf.gif) | 1040-2020 -Annual Tax Sale Deferral Bylaw for 2020.pdf | 2020-08-21 17:25 | 129K | |
![[ ]](/icons/pdf.gif) | 1040-2020 .pdf | 2020-07-24 14:41 | 78K | |
![[ ]](/icons/pdf.gif) | 1041-2020 Zoning Bylaw Amendment Point Ideal (Recovered).pdf | 2020-08-21 17:23 | 189K | |
![[ ]](/icons/pdf.gif) | 1041-2020 Zoning Bylaw Amendment Point Ideal.pdf | 2020-07-28 14:12 | 93K | |
![[ ]](/icons/pdf.gif) | 1043-2020 Council Remuneration and Expenses.pdf | 2020-09-16 14:07 | 105K | |
![[ ]](/icons/pdf.gif) | 1044-2020 Fees and Charges for Services.pdf | 2021-01-13 09:18 | 290K | |
![[ ]](/icons/pdf.gif) | 1044.pdf | 2020-12-18 15:02 | 290K | |
![[ ]](/icons/pdf.gif) | 1045-2020 Water Rates and Regulations.pdf | 2021-01-13 09:16 | 280K | |
![[ ]](/icons/pdf.gif) | 1045.pdf | 2020-12-18 15:02 | 280K | |
![[ ]](/icons/pdf.gif) | 1046-2020 Sewer Rates and Regulations.pdf | 2021-01-13 09:16 | 284K | |
![[ ]](/icons/pdf.gif) | 1046.pdf | 2020-12-18 15:02 | 284K | |
![[ ]](/icons/pdf.gif) | 1047-1.pdf | 2021-01-22 15:02 | 1.2M | |
![[ ]](/icons/pdf.gif) | 1047-2021 Fees and Charges for Services.pdf | 2021-03-25 17:06 | 197K | |
![[ ]](/icons/pdf.gif) | 1047.pdf | 2021-02-19 15:51 | 292K | |
![[ ]](/icons/pdf.gif) | 1048-1.pdf | 2021-01-22 15:02 | 3.2M | |
![[ ]](/icons/pdf.gif) | 1048-2021 Sewer Rates and Regulations.pdf | 2021-02-19 15:51 | 292K | |
![[ ]](/icons/pdf.gif) | 1048.pdf | 2021-02-19 15:51 | 285K | |
![[ ]](/icons/pdf.gif) | 1049-2021 Fees and Charges for Services.pdf | 2021-02-10 12:47 | 269K | |
![[ ]](/icons/pdf.gif) | 1049.pdf | 2021-03-19 15:25 | 160K | |
![[ ]](/icons/pdf.gif) | 1050-2021 Property Maintenance and Prohibition of Unsightly Premises.pdf | 2021-03-25 17:03 | 135K | |
![[ ]](/icons/pdf.gif) | 1050-2021 Unsightly AMEND.pdf | 2025-09-26 11:37 | 176K | |
![[ ]](/icons/pdf.gif) | 1050.pdf | 2021-03-19 15:25 | 135K | |
![[ ]](/icons/pdf.gif) | 1051.pdf | 2021-03-19 15:25 | 83K | |
![[ ]](/icons/pdf.gif) | 1052-2021 Amendment to Animal Control.pdf | 2021-10-12 15:53 | 85K | |
![[ ]](/icons/pdf.gif) | 1052.pdf | 2021-08-20 14:53 | 85K | |
![[ ]](/icons/pdf.gif) | 1053.pdf | 2021-08-20 12:57 | 156K | |
![[ ]](/icons/pdf.gif) | 1054.pdf | 2021-08-20 12:57 | 143K | |
![[ ]](/icons/pdf.gif) | 1055-2021 Zoning Bylaw.pdf | 2026-05-14 16:10 | 2.0M | |
![[ ]](/icons/pdf.gif) | 1055-2021 Zoning Bylaw Consolidated 26-02-24.pdf | 2026-05-14 16:02 | 2.0M | |
![[ ]](/icons/pdf.gif) | 1055-2021 Zoning Cons.pdf | 2025-01-08 15:49 | 1.9M | |
![[ ]](/icons/pdf.gif) | 1056-2021 5Year Plan 2021-2025.pdf | 2021-05-14 12:44 | 278K | |
![[ ]](/icons/pdf.gif) | 1056.pdf | 2021-05-07 15:47 | 279K | |
![[ ]](/icons/pdf.gif) | 1057-2021 Annual Rates 2021.pdf | 2021-09-01 12:49 | 91K | |
![[ ]](/icons/pdf.gif) | 1057.pdf | 2021-05-07 15:47 | 83K | |
![[ ]](/icons/pdf.gif) | 1058.pdf | 2021-06-18 14:45 | 391K | |
![[ ]](/icons/pdf.gif) | 1059-2021 Council Procedure.pdf | 2021-09-01 14:00 | 220K | |
![[ ]](/icons/pdf.gif) | 1059-2021 Council Procedures.pdf | 2021-07-23 15:15 | 219K | |
![[ ]](/icons/pdf.gif) | 1059.pdf | 2021-08-20 14:53 | 220K | |
![[ ]](/icons/pdf.gif) | 1060-2021-Sign Regulation.pdf | 2021-09-01 13:59 | 382K | |
![[ ]](/icons/pdf.gif) | 1060-2021-Sign Regulation CONSOLIDATED.pdf | 2022-07-07 15:49 | 537K | |
![[ ]](/icons/pdf.gif) | 1060.pdf | 2021-08-20 14:53 | 382K | |
![[ ]](/icons/pdf.gif) | 1067-2021 Inter Community Business Licence.pdf | 2022-04-28 16:23 | 142K | |
![[ ]](/icons/pdf.gif) | 1068-2022-Amend Sign Regulation Bylaw.pdf | 2022-01-21 15:57 | 243K | |
![[ ]](/icons/pdf.gif) | 1069-2022 Election Bylaw.pdf | 2022-08-12 13:51 | 93K | |
![[ ]](/icons/pdf.gif) | 1070-2022 OCP Amendment.pdf | 2022-03-18 15:26 | 439K | |
![[ ]](/icons/pdf.gif) | 1070ocp.pdf | 2022-02-18 15:09 | 439K | |
![[ ]](/icons/pdf.gif) | 1071-2022-Parcel Tax Sewer.pdf | 2022-04-28 16:23 | 81K | |
![[ ]](/icons/pdf.gif) | 1071a.pdf | 2022-03-18 15:26 | 81K | |
![[ ]](/icons/pdf.gif) | 1071pts.pdf | 2022-02-18 15:09 | 80K | |
![[ ]](/icons/pdf.gif) | 1072-2022-Parcel Tax Water.pdf | 2022-04-28 16:23 | 80K | |
![[ ]](/icons/pdf.gif) | 1072a.pdf | 2022-03-18 15:26 | 82K | |
![[ ]](/icons/pdf.gif) | 1072ptw.pdf | 2022-02-18 15:09 | 81K | |
![[ ]](/icons/pdf.gif) | 1073-2022 5Year Plan 2022-2026.pdf | 2022-05-16 15:48 | 283K | |
![[ ]](/icons/pdf.gif) | 1073finplan.pdf | 2022-05-03 11:32 | 283K | |
![[ ]](/icons/pdf.gif) | 1075-2022 Building Regulations.pdf | 2022-06-08 12:28 | 431K | |
![[ ]](/icons/pdf.gif) | 1075.pdf | 2022-05-20 14:27 | 432K | |
![[ ]](/icons/pdf.gif) | 1075build.pdf | 2022-04-22 15:00 | 430K | |
![[ ]](/icons/pdf.gif) | 1076.pdf | 2022-06-24 14:58 | 347K | |
![[ ]](/icons/pdf.gif) | 1076a.pdf | 2022-07-27 08:52 | 347K | |
![[ ]](/icons/pdf.gif) | 1077-2022 Council Remuneration and Expenses.pdf | 2024-04-29 16:15 | 147K | |
![[ ]](/icons/pdf.gif) | 1077.pdf | 2022-09-25 14:55 | 144K | |
![[ ]](/icons/pdf.gif) | 1078-2022 Development Cost Charges.pdf | 2025-09-16 11:26 | 255K | |
![[ ]](/icons/pdf.gif) | 1078.pdf | 2022-10-21 15:27 | 228K | |
![[ ]](/icons/pdf.gif) | 1078DCC.pdf | 2022-12-16 14:14 | 222K | |
![[ ]](/icons/pdf.gif) | 1079PH.pdf | 2022-11-18 15:33 | 501K | |
![[ ]](/icons/pdf.gif) | 1079lakewood.pdf | 2022-10-21 15:27 | 501K | |
![[ ]](/icons/pdf.gif) | 1080PH.pdf | 2022-11-18 15:33 | 157K | |
![[ ]](/icons/pdf.gif) | 1080neva.pdf | 2022-10-21 15:27 | 157K | |
![[ ]](/icons/pdf.gif) | 1081tables.pdf | 2022-10-21 15:27 | 379K | |
![[ ]](/icons/pdf.gif) | 1082-2022 Subdivision Works and Services .pdf | 2025-01-30 15:03 | 1.3M | |
![[ ]](/icons/pdf.gif) | 1082-2022 Subdivision Works and Services.pdf | 2023-08-16 11:22 | 1.3M | |
![[ ]](/icons/pdf.gif) | 1082.pdf | 2022-12-16 14:14 | 1.3M | |
![[ ]](/icons/pdf.gif) | 1082REVISED.pdf | 2023-02-24 15:54 | 1.3M | |
![[ ]](/icons/pdf.gif) | 1082a.pdf | 2023-03-24 15:47 | 1.3M | |
![[ ]](/icons/pdf.gif) | 1082rev.pdf | 2023-01-20 14:32 | 1.1M | |
![[ ]](/icons/pdf.gif) | 1083.pdf | 2022-12-23 12:05 | 280K | |
![[ ]](/icons/pdf.gif) | 1083R.pdf | 2023-01-20 14:32 | 281K | |
![[ ]](/icons/pdf.gif) | 1083fees.pdf | 2022-12-09 12:38 | 660K | |
![[ ]](/icons/pdf.gif) | 1084-2022 Council Remuneration and Expenses.pdf | 2022-12-20 11:19 | 145K | |
![[ ]](/icons/pdf.gif) | 1084.pdf | 2022-12-20 11:24 | 145K | |
![[ ]](/icons/pdf.gif) | 1084R.pdf | 2023-01-20 14:32 | 145K | |
![[ ]](/icons/pdf.gif) | 1084R06-23.pdf | 2023-02-25 15:15 | 145K | |
![[ ]](/icons/pdf.gif) | 1084a.pdf | 2023-04-21 15:13 | 145K | |
![[ ]](/icons/pdf.gif) | 1085.pdf | 2022-12-16 14:14 | 179K | |
![[ ]](/icons/pdf.gif) | 1085R.pdf | 2023-01-24 13:10 | 179K | |
![[ ]](/icons/pdf.gif) | 1086.pdf | 2022-12-16 14:14 | 165K | |
![[ ]](/icons/pdf.gif) | 1086R.pdf | 2023-01-20 14:32 | 165K | |
![[ ]](/icons/pdf.gif) | 1087.pdf | 2023-02-24 15:54 | 104K | |
![[ ]](/icons/pdf.gif) | 1087ph.pdf | 2023-03-24 15:47 | 104K | |
![[ ]](/icons/pdf.gif) | 1088.pdf | 2023-02-24 15:54 | 133K | |
![[ ]](/icons/pdf.gif) | 1088caomemo.pdf | 2023-03-24 15:47 | 391K | |
![[ ]](/icons/pdf.gif) | 1088ph.pdf | 2023-03-24 15:47 | 133K | |
![[ ]](/icons/pdf.gif) | 1089-2023 5Year Plan 2023-2027.pdf | 2023-05-23 12:37 | 286K | |
![[ ]](/icons/pdf.gif) | 1089r.pdf | 2023-05-05 15:55 | 285K | |
![[ ]](/icons/pdf.gif) | 1090-1.pdf | 2023-05-03 10:50 | 89K | |
![[ ]](/icons/pdf.gif) | 1090-2023 Annual Rates 2023.pdf | 2023-05-23 12:36 | 89K | |
![[ ]](/icons/pdf.gif) | 1090r.pdf | 2023-05-08 09:58 | 89K | |
![[ ]](/icons/pdf.gif) | 1091-1.pdf | 2023-04-21 15:13 | 142K | |
![[ ]](/icons/pdf.gif) | 1091ph.pdf | 2023-05-19 14:36 | 142K | |
![[ ]](/icons/pdf.gif) | 1092-1.pdf | 2023-06-23 15:02 | 49K | |
![[ ]](/icons/pdf.gif) | 1092-2023-Permissive-Legion-.pdf | 2024-11-06 10:08 | 49K | |
![[ ]](/icons/pdf.gif) | 1092-2023-Permissive-Legion.pdf | 2025-06-03 16:46 | 49K | |
![[ ]](/icons/pdf.gif) | 1092r.pdf | 2023-07-21 15:26 | 49K | |
![[ ]](/icons/pdf.gif) | 1093-1.pdf | 2023-07-21 16:53 | 476K | |
![[ ]](/icons/pdf.gif) | 1093-2023 Council Procedures-Amended.pdf | 2024-12-10 12:32 | 531K | |
![[ ]](/icons/pdf.gif) | 1093-2023 Council Procedures.pdf | 2024-10-29 09:54 | 531K | |
![[ ]](/icons/pdf.gif) | 1093r.pdf | 2023-09-23 17:23 | 490K | |
![[ ]](/icons/pdf.gif) | 1094a.pdf | 2024-10-18 14:55 | 386K | |
![[ ]](/icons/pdf.gif) | 1095-1.pdf | 2023-09-23 17:23 | 407K | |
![[ ]](/icons/pdf.gif) | 1095a.pdf | 2023-11-24 15:03 | 405K | |
![[ ]](/icons/pdf.gif) | 1096-1.pdf | 2023-11-24 15:03 | 259K | |
![[ ]](/icons/pdf.gif) | 1096-2023 Fees and Charges for Services.pdf | 2023-12-22 08:55 | 258K | |
![[ ]](/icons/pdf.gif) | 1096a.pdf | 2023-12-15 14:30 | 261K | |
![[ ]](/icons/pdf.gif) | 1097-1.pdf | 2023-12-19 09:18 | 5.6M | |
![[ ]](/icons/pdf.gif) | 1097-2023 OCP.pdf | 2024-04-03 10:09 | 5.5M | |
![[ ]](/icons/pdf.gif) | 1097-2023 Official Community Plan.pdf | 2024-11-20 12:05 | 5.5M | |
![[ ]](/icons/pdf.gif) | 1097PH.pdf | 2024-03-22 12:14 | 5.5M | |
![[ ]](/icons/pdf.gif) | 1098-1.pdf | 2024-01-19 15:01 | 143K | |
![[ ]](/icons/pdf.gif) | 1098-r.pdf | 2024-02-23 14:59 | 143K | |
![[ ]](/icons/pdf.gif) | 1099-1.pdf | 2024-02-23 14:59 | 204K | |
![[ ]](/icons/pdf.gif) | 1099PH.pdf | 2024-03-22 12:08 | 205K | |
![[ ]](/icons/pdf.gif) | 1100-1.pdf | 2024-03-22 12:08 | 131K | |
![[ ]](/icons/pdf.gif) | 1100a.pdf | 2024-04-19 14:20 | 133K | |
![[ ]](/icons/pdf.gif) | 1101-1.pdf | 2024-03-22 12:09 | 274K | |
![[ ]](/icons/pdf.gif) | 1102-1.pdf | 2024-04-19 14:20 | 281K | |
![[ ]](/icons/pdf.gif) | 1102-2024 5Year Plan 2024-2028.pdf | 2024-05-15 10:16 | 281K | |
![[ ]](/icons/pdf.gif) | 1102a.pdf | 2024-05-10 15:05 | 281K | |
![[ ]](/icons/pdf.gif) | 1103-1.pdf | 2024-04-19 14:20 | 90K | |
![[ ]](/icons/pdf.gif) | 1103-2024 Annual Rates 2024.pdf | 2024-10-25 11:15 | 90K | |
![[ ]](/icons/pdf.gif) | 1103a.pdf | 2024-05-10 15:05 | 90K | |
![[ ]](/icons/pdf.gif) | 1104-1.pdf | 2024-05-24 15:52 | 193K | |
![[ ]](/icons/pdf.gif) | 1104a.pdf | 2024-06-21 16:16 | 194K | |
![[ ]](/icons/pdf.gif) | 1105-1.pdf | 2024-05-24 15:52 | 181K | |
![[ ]](/icons/pdf.gif) | 1105PH.pdf | 2024-06-21 16:16 | 182K | |
![[ ]](/icons/pdf.gif) | 1106-1.pdf | 2024-07-19 14:19 | 1.6M | |
![[ ]](/icons/pdf.gif) | 1106-3.pdf | 2024-10-04 15:49 | 1.6M | |
![[ ]](/icons/pdf.gif) | 1106a.pdf | 2024-10-18 14:55 | 610K | |
![[ ]](/icons/pdf.gif) | 1106ph.pdf | 2024-09-20 17:59 | 1.6M | |
![[ ]](/icons/pdf.gif) | 1106tracked changes.pdf | 2024-10-18 14:55 | 615K | |
![[ ]](/icons/pdf.gif) | 1107-1.pdf | 2024-09-20 17:59 | 204K | |
![[ ]](/icons/pdf.gif) | 1107-2024-PTE-Churches and NotforProfit.pdf | 2024-11-12 14:00 | 202K | |
![[ ]](/icons/pdf.gif) | 1107a.pdf | 2024-10-18 14:55 | 204K | |
![[ ]](/icons/pdf.gif) | 1108-1.pdf | 2024-09-20 17:59 | 123K | |
![[ ]](/icons/pdf.gif) | 1108-2024-Permissive-Boat Launch-North Shore.doc.pdf | 2024-11-12 14:00 | 121K | |
![[ ]](/icons/pdf.gif) | 1108a.pdf | 2024-10-18 14:55 | 123K | |
![[ ]](/icons/pdf.gif) | 1109-1.pdf | 2024-12-17 18:18 | 200K | |
![[ ]](/icons/pdf.gif) | 1109-2024 Development Procedures.pdf | 2025-02-07 15:46 | 200K | |
![[ ]](/icons/pdf.gif) | 1109a.pdf | 2025-01-24 15:38 | 199K | |
![[ ]](/icons/pdf.gif) | 1110-1.pdf | 2024-10-18 14:55 | 266K | |
![[ ]](/icons/pdf.gif) | 1110-2024 Zoning Amendment - Density.pdf | 2025-04-17 16:36 | 265K | |
![[ ]](/icons/pdf.gif) | 1110PH.pdf | 2024-11-26 16:45 | 265K | |
![[ ]](/icons/pdf.gif) | 1111-1.pdf | 2024-10-18 14:55 | 255K | |
![[ ]](/icons/pdf.gif) | 1111-2024 Fees and Charges for Services.pdf | 2024-12-10 12:54 | 255K | |
![[ ]](/icons/pdf.gif) | 1111a.pdf | 2024-11-22 14:23 | 255K | |
![[ ]](/icons/pdf.gif) | 1112-1.pdf | 2024-10-18 14:55 | 329K | |
![[ ]](/icons/pdf.gif) | 1112-2024 Water Rates and Regulations.pdf | 2024-12-06 15:24 | 329K | |
![[ ]](/icons/pdf.gif) | 1112a.pdf | 2024-11-22 14:23 | 329K | |
![[ ]](/icons/pdf.gif) | 1113-1.pdf | 2024-10-18 14:55 | 324K | |
![[ ]](/icons/pdf.gif) | 1113-2024 Sewer Rates and Regulations.pdf | 2024-12-06 15:24 | 324K | |
![[ ]](/icons/pdf.gif) | 1113a.pdf | 2024-11-22 14:23 | 324K | |
![[ ]](/icons/pdf.gif) | 1114-1.pdf | 2024-10-18 14:55 | 298K | |
![[ ]](/icons/pdf.gif) | 1114-2024 Waste Rates and Regulations.pdf | 2024-12-06 15:24 | 298K | |
![[ ]](/icons/pdf.gif) | 1114a.pdf | 2024-11-22 14:23 | 298K | |
![[ ]](/icons/pdf.gif) | 1115-1.pdf | 2024-10-18 14:55 | 175K | |
![[ ]](/icons/pdf.gif) | 1115-3.pdf | 2024-11-22 14:23 | 175K | |
![[ ]](/icons/pdf.gif) | 1115a.pdf | 2024-12-13 15:05 | 175K | |
![[ ]](/icons/pdf.gif) | 1116-1.pdf | 2025-02-21 16:05 | 214K | |
![[ ]](/icons/pdf.gif) | 1116-2025-Parcel Tax Sewer.pdf | 2025-06-03 16:53 | 214K | |
![[ ]](/icons/pdf.gif) | 1116a.pdf | 2025-03-21 15:41 | 214K | |
![[ ]](/icons/pdf.gif) | 1117-1.pdf | 2025-02-21 16:05 | 211K | |
![[ ]](/icons/pdf.gif) | 1117-2025-Parcel Tax Water.pdf | 2025-06-03 16:53 | 211K | |
![[ ]](/icons/pdf.gif) | 1117a.pdf | 2025-03-21 15:41 | 211K | |
![[ ]](/icons/pdf.gif) | 1118-1.pdf | 2025-04-17 17:22 | 284K | |
![[ ]](/icons/pdf.gif) | 1118-2025 5Year Plan 2025-2029.pdf | 2025-06-03 16:58 | 288K | |
![[ ]](/icons/pdf.gif) | 1118a.pdf | 2025-05-01 15:35 | 284K | |
![[ ]](/icons/pdf.gif) | 1119-1.pdf | 2025-04-17 15:34 | 90K | |
![[ ]](/icons/pdf.gif) | 1119-2025 Annual Rates 2025.pdf | 2025-06-03 16:58 | 94K | |
![[ ]](/icons/pdf.gif) | 1119a.pdf | 2025-05-01 15:35 | 90K | |
![[ ]](/icons/pdf.gif) | 1120-1.pdf | 2025-05-23 13:24 | 222K | |
![[ ]](/icons/pdf.gif) | 1120a.pdf | 2025-06-20 14:08 | 292K | |
![[ ]](/icons/pdf.gif) | 1120amend.pdf | 2025-05-09 16:20 | 776K | |
![[ ]](/icons/pdf.gif) | 1121-1.pdf | 2025-08-15 14:19 | 164K | |
![[ ]](/icons/pdf.gif) | 1121a.pdf | 2025-08-15 14:19 | 164K | |
![[ ]](/icons/pdf.gif) | 1122-1.pdf | 2025-09-05 16:02 | 165K | |
![[ ]](/icons/pdf.gif) | 1122a.pdf | 2025-09-12 15:48 | 166K | |
![[ ]](/icons/pdf.gif) | 1125-2026 Development Approval Procedures.pdf | 2026-06-05 12:06 | 312K | |
![[ ]](/icons/pdf.gif) | 1126-2025 Council Remuneration Expenses and Professional Development Bylaw.pdf | 2026-01-08 11:45 | 224K | |
![[ ]](/icons/pdf.gif) | 1127-2025 Fees and Charges for Services.pdf | 2026-02-18 09:39 | 393K | |
![[ ]](/icons/pdf.gif) | 1128-2026 Vancouver Island ICBL Bylaw.pdf | 2026-06-05 12:05 | 337K | |
![[ ]](/icons/pdf.gif) | 1129-2026 Public Notice.pdf | 2026-06-05 12:06 | 163K | |
![[ ]](/icons/pdf.gif) | 1131-2026 5Year Plan 2026-2030.pdf | 2026-05-13 09:42 | 457K | |
![[ ]](/icons/pdf.gif) | 1132-2026 Annual Rates 2026.pdf | 2026-05-13 09:42 | 343K | |
![[ ]](/icons/unknown.gif) | 1525-091 Sewer Capacity Assessment May 2022.pptx | 2022-05-24 15:50 | 3.8M | |
![[ ]](/icons/pdf.gif) | 2016_CARIP_Survey_Template.pdf | 2017-06-07 10:34 | 428K | |
![[ ]](/icons/pdf.gif) | 2018 Nomination and Endorsement Package.pdf | 2018-08-05 16:29 | 730K | |
![[ ]](/icons/pdf.gif) | 2018 Tax Rates Revised.pdf | 2018-05-07 14:22 | 97K | |
![[ ]](/icons/pdf.gif) | 2018 carip survey TLC.pdf | 2019-05-31 16:25 | 320K | |
![[ ]](/icons/pdf.gif) | 2019 Financial Statements.pdf | 2020-07-09 12:08 | 2.7M | |
![[ ]](/icons/pdf.gif) | 2019 Tax Rates.pdf | 2019-05-29 16:23 | 97K | |
![[ ]](/icons/pdf.gif) | 2019 Update revisions 1.12.21.pdf | 2021-01-25 21:27 | 1.4M | |
![[ ]](/icons/pdf.gif) | 2019 Update revisions 11.16.20.pdf | 2020-11-24 13:59 | 1.4M | |
![[ ]](/icons/pdf.gif) | 2019 annual report.pdf | 2022-06-16 13:37 | 4.5M | |
![[ ]](/icons/pdf.gif) | 2020-04-08 IB COVID-19 Relief application.pdf | 2020-04-08 15:15 | 244K | |
![[ ]](/icons/pdf.gif) | 2020-09-29 Town of Lake Cowichan-EDC Update.pdf | 2020-09-25 14:48 | 913K | |
![[ ]](/icons/pdf.gif) | 2020 10 30 Mayor Rod Peters.pdf | 2020-12-11 14:08 | 246K | |
![[ ]](/icons/pdf.gif) | 2020ANNUAL.pdf | 2021-06-21 17:07 | 6.6M | |
![[ ]](/icons/pdf.gif) | 2020 Actual 2021 Budget.pdf | 2021-02-26 16:05 | 460K | |
![[ ]](/icons/pdf.gif) | 2020 Audited Financial Statements.pdf | 2023-06-23 12:35 | 2.1M | |
![[ ]](/icons/pdf.gif) | 2020 CHANGE TO WASTE ORGANICS SERVICES.pdf | 2020-06-03 16:20 | 264K | |
![[ ]](/icons/pdf.gif) | 2020 CRI Funding.pdf | 2020-04-27 16:12 | 699K | |
![[ ]](/icons/pdf.gif) | 2020 Elections Notice .pdf | 2020-10-05 11:24 | 148K | |
![[ ]](/icons/pdf.gif) | 2020 Garbage Calendar.pdf | 2020-01-22 12:02 | 220K | |
![[ ]](/icons/pdf.gif) | 2020PSSG0020-000568.pdf | 2020-03-27 09:52 | 1.0M | |
![[ ]](/icons/pdf.gif) | 2020 SOFI.pdf | 2021-06-25 15:41 | 2.3M | |
![[ ]](/icons/pdf.gif) | 2020 Tax Rates.pdf | 2020-05-22 14:37 | 95K | |
![[ ]](/icons/pdf.gif) | 2020auditserviceplan.pdf | 2021-04-09 15:56 | 8.4M | |
![[ ]](/icons/pdf.gif) | 2021-02-04 BRD Regional Housing Needs Assessment RPT – Town of Lake Cowichan Sub-regional Report Attachment BO.pdf | 2021-02-23 14:31 | 4.1M | |
![[ ]](/icons/pdf.gif) | 2021-02-04 BRD Regional Housing Needs Assessment RPT Town of Lake Cowichan Sub-regional Report Appendix I Attachment BP.pdf | 2021-02-23 15:06 | 2.7M | |
![[ ]](/icons/pdf.gif) | 2021-02-04 BRD Regional Housing Needs Assessment RPT Town of Lake Cowichan Sub-regional Report Summary Attachment BQ.pdf | 2021-02-23 14:39 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2021-02-04 Council Info Session.pptx | 2021-05-25 15:02 | 32M | |
![[ ]](/icons/pdf.gif) | 2021-02-04 Town of Lake Cowichan Sub-regional Report Attachment BO.pdf | 2021-02-23 15:00 | 4.1M | |
![[ ]](/icons/unknown.gif) | 2021-02-23 Lake Cowichan HNA.pptx | 2021-02-23 12:27 | 8.9M | |
![[ ]](/icons/unknown.gif) | 2021-05-12 Virtual Open House.pptx | 2021-05-25 15:11 | 18M | |
![[ ]](/icons/unknown.gif) | 2021-09-28 Implementation Framework CVRD Actions - Town of LC.xlsx | 2021-10-08 15:23 | 37K | |
![[ ]](/icons/pdf.gif) | 2021-11-08 Request for Support -CVRD MRDT Renewal-Lake Cowichan.pdf | 2021-11-19 15:46 | 1.3M | |
![[ ]](/icons/pdf.gif) | 2021 Annual Report.pdf | 2022-06-17 16:34 | 6.1M | |
![[ ]](/icons/pdf.gif) | 2021 Financial Statements signed.pdf | 2023-06-23 12:35 | 917K | |
![[ ]](/icons/pdf.gif) | 2021 SOFI.pdf | 2022-06-29 15:09 | 1.2M | |
![[ ]](/icons/pdf.gif) | 2021SP.pdf | 2021-05-07 15:19 | 561K | |
![[ ]](/icons/pdf.gif) | 2021 Tax Rates.pdf | 2021-05-17 10:42 | 105K | |
![[ ]](/icons/pdf.gif) | 2021 audit findings.pdf | 2022-05-06 14:47 | 5.8M | |
![[ ]](/icons/pdf.gif) | 2022-04-20 CHA Grant App.pdf | 2022-05-06 15:17 | 1.1M | |
![[ ]](/icons/pdf.gif) | 2022-04-22 LTR-Town of Lake Cowichan Mtg Invite-Cow Connectivity Strategy.pdf | 2022-04-22 15:00 | 210K | |
![[ ]](/icons/pdf.gif) | 2022-2026 Sewer and Water.pdf | 2022-01-15 12:20 | 256K | |
![[ ]](/icons/pdf.gif) | 2022-Water-Restrictions-4-Stages.pdf | 2022-06-23 10:34 | 109K | |
![[ ]](/icons/pdf.gif) | 2022-Water-Restrictions-Stage-1.pdf | 2023-05-02 15:32 | 119K | |
![[ ]](/icons/pdf.gif) | 2022-Water-Restrictions-Stage 1.pdf | 2023-05-02 15:30 | 119K | |
![[ ]](/icons/pdf.gif) | 2022-Water-Restrictions-Stage 2.pdf | 2022-08-25 16:16 | 118K | |
![[ ]](/icons/pdf.gif) | 2022-Water-Restrictions-Stage 3.pdf | 2022-09-26 10:49 | 117K | |
![[ ]](/icons/pdf.gif) | 2022 06 21 Support for Island Rail Corridor.pdf | 2022-06-24 14:58 | 250K | |
![[ ]](/icons/pdf.gif) | 2022 06 22 Extreme Heat Letter.pdf | 2022-06-24 14:58 | 688K | |
![[ ]](/icons/pdf.gif) | 2022 06 22 Wild Fire Smoke Information for Community Health Partners and Local Governments.pdf | 2022-06-24 14:58 | 517K | |
![[ ]](/icons/pdf.gif) | 2022 10 22 Appointment Letter LC.pdf | 2021-11-19 15:46 | 265K | |
![[ ]](/icons/pdf.gif) | 2022 Annual Report.pdf | 2023-06-29 11:09 | 9.1M | |
![[ ]](/icons/pdf.gif) | 2022 Elections Notice.pdf | 2022-09-16 13:39 | 143K | |
![[ ]](/icons/pdf.gif) | 2022 Financial Statements.pdf | 2023-06-23 12:36 | 1.9M | |
![[ ]](/icons/pdf.gif) | 2022 Ohtaki Itinerary.pdf | 2022-09-02 13:41 | 25K | |
![[ ]](/icons/pdf.gif) | 2022 Operations Budget.pdf | 2022-01-14 17:04 | 2.0M | |
![[ ]](/icons/pdf.gif) | 2022 Panago Grande Parade entry form.pdf | 2022-06-24 14:58 | 255K | |
![[ ]](/icons/pdf.gif) | 2022 REG REC - Council Presentation TLC FINAL 2022-06-28.pdf | 2022-06-24 14:59 | 2.0M | |
![[ ]](/icons/pdf.gif) | 2022 REG REC - Usage Based Funding MASTER.pdf | 2022-06-24 14:59 | 43K | |
![[ ]](/icons/pdf.gif) | 2022 SOFI.pdf | 2023-06-29 11:08 | 2.1M | |
![[ ]](/icons/pdf.gif) | 2022 Sewer and Water.pdf | 2022-01-15 12:08 | 392K | |
![[ ]](/icons/pdf.gif) | 2022 Subdivision Works and Services Dec 7.pdf | 2021-12-12 19:06 | 473K | |
![[ ]](/icons/pdf.gif) | 2022 Tax Rates.pdf | 2022-06-17 14:28 | 75K | |
![[ ]](/icons/pdf.gif) | 2022msa.pdf | 2022-06-10 15:31 | 269K | |
![[ ]](/icons/pdf.gif) | 2023-11-14 TOLC Request for Support Letter_3 Attachments.pdf | 2023-11-24 15:03 | 1.2M | |
![[ ]](/icons/pdf.gif) | 2023 Annual Report.pdf | 2024-06-24 16:30 | 13M | |
![[ ]](/icons/pdf.gif) | 2023 CEP Fund EOC.pdf | 2023-02-24 15:54 | 68K | |
![[ ]](/icons/pdf.gif) | 2023 ExternalHeatLetter.pdf | 2023-06-07 15:13 | 177K | |
![[ ]](/icons/pdf.gif) | 2023ExternalHeatLetter.pdf | 2023-06-07 15:38 | 177K | |
![[ ]](/icons/pdf.gif) | 2023 FS Funding Approval.pdf | 2023-05-19 14:36 | 1.5M | |
![[ ]](/icons/pdf.gif) | 2023 Financial Statements.pdf | 2024-04-24 10:54 | 2.0M | |
![[ ]](/icons/pdf.gif) | 2023 Garbage Calendar.pdf | 2023-05-05 14:58 | 146K | |
![[ ]](/icons/pdf.gif) | 2023 OrgRecGarCalendar.pdf | 2023-01-09 13:38 | 140K | |
![[ ]](/icons/pdf.gif) | 2023 RecyWasteOrgCalendar.pdf | 2023-02-02 09:50 | 152K | |
![[ ]](/icons/pdf.gif) | 2023 SOFI.pdf | 2024-06-26 09:27 | 1.5M | |
![[ ]](/icons/pdf.gif) | 2023 Tax Rates.pdf | 2023-05-23 13:19 | 20K | |
![[ ]](/icons/pdf.gif) | 2023firesmartfunding.pdf | 2022-10-21 15:27 | 271K | |
![[ ]](/icons/pdf.gif) | 2024-10-09 LTR-LCOW re Cow Tech and Innovation Ecosystem SIGNED.pdf | 2024-10-18 14:55 | 430K | |
![[ ]](/icons/pdf.gif) | 2024-11-06 Zoning 1055-2021_Mapsheet1.pdf | 2024-12-13 12:44 | 2.0M | |
![[ ]](/icons/pdf.gif) | 2024-11-06 Zoning 1055-2021_Mapsheet2.pdf | 2024-12-13 12:44 | 2.1M | |
![[ ]](/icons/pdf.gif) | 2024-11-13 CVRD LCOW LTR-Request Support for MRDT OAP Allocation to Affordable Housing 2025-2027.pdf | 2024-11-22 14:24 | 440K | |
![[ ]](/icons/pdf.gif) | 2024 Annual Report.pdf | 2025-06-26 11:53 | 6.2M | |
![[ ]](/icons/pdf.gif) | 2024 Financial Statements.pdf | 2025-05-09 15:24 | 814K | |
![[ ]](/icons/pdf.gif) | 2024 SOFI.pdf | 2025-06-26 11:53 | 1.2M | |
![[ ]](/icons/pdf.gif) | 2024 Tax Rates.pdf | 2024-05-15 10:16 | 20K | |
![[ ]](/icons/pdf.gif) | 2024secondary-suites.pdf | 2024-04-05 15:34 | 1.8M | |
![[ ]](/icons/pdf.gif) | 2025-01-22 Board Resolution Minutes.pdf | 2025-04-17 15:39 | 80K | |
![[ ]](/icons/pdf.gif) | 2025-01-22 COTW SR Reg Emerg Mgmt Agreement.pdf | 2025-04-17 15:39 | 194K | |
![[ ]](/icons/pdf.gif) | 2025-02-11 Cowichan Emergency Management Local Authority Agreement 2025.pdf | 2025-04-17 15:39 | 5.3M | |
![[ ]](/icons/pdf.gif) | 2025-02-26 COTW RPT-Workforce Housing Strategy.pdf | 2025-01-24 15:38 | 2.6M | |
![[ ]](/icons/pdf.gif) | 2025-03-20 Request for Participation- Roadmap Survey.pdf | 2025-03-21 15:41 | 217K | |
![[ ]](/icons/pdf.gif) | 2025-04-09 COTW RPT RGS SC TOR.pdf | 2025-12-12 13:49 | 128K | |
![[ ]](/icons/pdf.gif) | 2025-04-09 COTW RPT RGS TOR.pdf | 2025-12-12 16:18 | 201K | |
![[ ]](/icons/pdf.gif) | 2025-04-22 Council Staff Memo short term rentals.pdf | 2025-04-17 15:35 | 327K | |
![[ ]](/icons/pdf.gif) | 2025-04-24_2024 Building Stats.pdf | 2025-04-17 16:35 | 144K | |
![[ ]](/icons/pdf.gif) | 2025-06-24 Council memo DP2020-06-63 Cowichan Lake Rd.pdf | 2025-06-20 14:08 | 267K | |
![[ ]](/icons/pdf.gif) | 2025-10-23 staff rpt to APC Dev App Procedures.pdf | 2025-10-21 14:31 | 202K | |
![[ ]](/icons/pdf.gif) | 2025-12-16 APC report RGS.pdf | 2025-12-12 16:18 | 3.9M | |
![[ ]](/icons/pdf.gif) | 2025 - Director of Bylaws and Development Services.pdf | 2025-09-11 13:53 | 3.8M | |
![[ ]](/icons/pdf.gif) | 2025-Water-Restrictions-Stage 1.pdf | 2025-10-14 16:16 | 174K | |
![[ ]](/icons/pdf.gif) | 2025-Water-Restrictions-Stage 2.pdf | 2025-06-18 09:26 | 173K | |
![[ ]](/icons/pdf.gif) | 2025-Water-Restrictions-Stage 3.pdf | 2025-08-07 09:56 | 172K | |
![[ ]](/icons/pdf.gif) | 2025 10 17 VIRL Board Appointment Letter_Lake Cowichan.pdf | 2024-10-18 14:56 | 394K | |
![[ ]](/icons/pdf.gif) | 2025 Canada Summer Jobs Letter From Jeff Kibble.pdf | 2025-07-18 14:09 | 230K | |
![[ ]](/icons/pdf.gif) | 2025 Financial Statements.pdf | 2026-05-27 08:39 | 1.1M | |
![[ ]](/icons/pdf.gif) | 2025 Tax Rates.pdf | 2025-05-14 08:19 | 75K | |
![[ ]](/icons/pdf.gif) | 2025 Utilities Newsletter.pdf | 2025-01-17 10:44 | 290K | |
![[ ]](/icons/pdf.gif) | 2025 Workplan.pdf | 2025-02-21 14:44 | 54K | |
![[ ]](/icons/pdf.gif) | 2025mtglist.pdf | 2024-11-22 14:24 | 260K | |
![[ ]](/icons/pdf.gif) | 2025regad.pdf | 2024-12-19 14:41 | 143K | |
![[ ]](/icons/pdf.gif) | 2026-04-10 LTR - Support Request - AVICC Resolutions.pdf | 2026-04-14 13:23 | 871K | |
![[ ]](/icons/pdf.gif) | 2026-05-21 DRAFT Storage Containers APC report.pdf | 2026-05-15 15:47 | 160K | |
![[ ]](/icons/pdf.gif) | 2026-05-21 Floodplain review APC MEMO.pdf | 2026-05-15 15:47 | 119K | |
![[ ]](/icons/pdf.gif) | 2026-05-21 Food Trucks_Mobile Vending APC rpt DRAFT.pdf | 2026-05-15 15:47 | 3.6M | |
![[ ]](/icons/pdf.gif) | 2026 - CLEC - Assistant Cook.pdf | 2026-04-30 10:26 | 237K | |
![[ ]](/icons/pdf.gif) | 2026 - Director of Bylaws and Development Services.pdf | 2026-02-26 11:55 | 3.8M | |
![[ ]](/icons/pdf.gif) | 2026 - Manager of Tourism and Business Development.pdf | 2026-03-02 12:51 | 3.8M | |
![[ ]](/icons/pdf.gif) | 2026-Mtg-Schedule-Council.pdf | 2025-12-22 12:37 | 319K | |
![[ ]](/icons/pdf.gif) | 2026 - Payroll and Accounts Payable Clerk - Casual.pdf | 2026-01-16 10:00 | 78K | |
![[ ]](/icons/pdf.gif) | 2026 - Receptionist and Accounts Receivable Clerk - Casual.pdf | 2026-01-16 10:00 | 79K | |
![[ ]](/icons/pdf.gif) | 2026 - Seasonal Gardener.pdf | 2026-01-26 14:28 | 81K | |
![[ ]](/icons/pdf.gif) | 2026 - Summer Student - Fire Smart Program.pdf | 2026-01-28 13:36 | 78K | |
![[ ]](/icons/pdf.gif) | 2026 - Summer Student - Lakeview Campground.pdf | 2026-02-25 16:10 | 73K | |
![[ ]](/icons/pdf.gif) | 2026 - Summer Student - Public Works.pdf | 2026-01-26 14:28 | 80K | |
![[ ]](/icons/pdf.gif) | 2026-UBCM-Convention-Provincial-Appointment-Book-002.pdf | 2026-06-09 15:51 | 1.3M | |
![[ ]](/icons/pdf.gif) | 2026-Water-Restrictions-Stage 1.pdf | 2026-05-01 13:49 | 174K | |
![[ ]](/icons/pdf.gif) | 2026-Water-Restrictions phase 2.pdf | 2026-06-08 10:21 | 256K | |
![[ ]](/icons/pdf.gif) | 2026 Budget.pdf | 2026-02-06 14:52 | 2.6M | |
![[ ]](/icons/pdf.gif) | 2026 Refuse Calendar.pdf | 2026-01-16 14:58 | 305K | |
![[ ]](/icons/pdf.gif) | 2026 Residential Waste Upgrade Form.pdf | 2026-02-26 14:23 | 188K | |
![[ ]](/icons/pdf.gif) | 2026 Tax Rates.pdf | 2026-05-21 15:47 | 112K | |
![[ ]](/icons/pdf.gif) | 2026 Utilities Newsletter.pdf | 2026-04-30 12:42 | 270K | |
![[ ]](/icons/pdf.gif) | 63760 LGHI Funding Letter_Town of Lake Cowichan.pdf | 2024-01-19 15:01 | 176K | |
![[ ]](/icons/pdf.gif) | 64234 Capacity Funding Town of Lake Cowichan.pdf | 2024-01-19 16:19 | 147K | |
![[ ]](/icons/pdf.gif) | 107422Rates.pdf | 2022-04-25 13:49 | 89K | |
![[ ]](/icons/pdf.gif) | 107422rates.pdf | 2022-05-03 10:29 | 89K | |
![[ ]](/icons/pdf.gif) | 129004 - Re Future Ready Action Plan.pdf | 2023-05-19 14:36 | 142K | |
![[ ]](/icons/pdf.gif) | 195547 Day Letter.pdf | 2021-09-03 15:29 | 62K | |
![[ ]](/icons/pdf.gif) | 196065 Lake Cowichan Letter.pdf | 2021-10-22 15:43 | 61K | |
![[ ]](/icons/pdf.gif) | 200403 - Wellness Recovery Centre - CLG Press Release.pdf | 2020-04-03 13:32 | 50K | |
![[ ]](/icons/pdf.gif) | 200630.pdf | 2020-07-24 14:42 | 132K | |
![[ ]](/icons/pdf.gif) | 203109 MIN SIG Mayor Douglas.pdf | 2024-09-20 17:59 | 73K | |
![[ ]](/icons/pdf.gif) | 240409ltrlcs.pdf | 2024-05-10 15:05 | 425K | |
![[ ]](/icons/pdf.gif) | 240422ltrnorthshorespeed.pdf | 2024-05-10 15:05 | 700K | |
![[ ]](/icons/pdf.gif) | 240701plans.pdf | 2024-05-10 15:05 | 96K | |
![[ ]](/icons/pdf.gif) | 249624 Day Outgoing.pdf | 2021-10-22 15:43 | 186K | |
![[ ]](/icons/pdf.gif) | 268550 Mayors and RD Chairs Signed Final.pdf | 2021-11-05 15:58 | 231K | |
![[ ]](/icons/pdf.gif) | 268752 Mayors and RD Chairs Signed Final.pdf | 2021-12-17 15:25 | 186K | |
![[ ]](/icons/pdf.gif) | 269202 Mayors and Chairs Signed Final.pdf | 2022-01-21 15:57 | 228K | |
![[ ]](/icons/pdf.gif) | 273834 Lake Cowichan Signed Final.pdf | 2024-01-19 15:01 | 98K | |
![[ ]](/icons/pdf.gif) | 20230906_CowichanLakePumping.pdf | 2023-09-08 15:08 | 110K | |
![[ ]](/icons/pdf.gif) | 20230906_CowichanLakePumping_FNL.pdf | 2023-09-08 14:33 | 110K | |
![[ ]](/icons/pdf.gif) | ADDENDUM-Addendum-4(Closing-Date-Extn)-15Sep2016.pdf | 2016-10-19 11:51 | 22K | |
![[ ]](/icons/pdf.gif) | ADDENDUM-Addendum _1(Q&A_1)-09Sep2016.pdf | 2016-10-19 11:51 | 762K | |
![[ ]](/icons/pdf.gif) | ADDENDUM-Addendum _2(Correct Closing Date)-12Sep2016.pdf | 2016-10-19 11:51 | 22K | |
![[ ]](/icons/pdf.gif) | ADDENDUM-Addendum _3(Q&A_2)-14Sep2016.pdf | 2016-10-19 11:51 | 620K | |
![[ ]](/icons/pdf.gif) | ADDENDUM-Addendum _5(Water-Main-Relocate-Alt)-15Sep2016.pdf | 2016-10-19 11:51 | 23K | |
![[ ]](/icons/pdf.gif) | ADDENDUM-Addendum _6(Q&A _3)-21Sep2016.pdf | 2016-10-19 11:51 | 645K | |
![[ ]](/icons/pdf.gif) | ADDENDUM-Addendum _7(Additional Manhole)-21Sep2016.pdf | 2016-10-19 11:51 | 23K | |
![[ ]](/icons/pdf.gif) | ADDENDUM NO 1 Recycbles RFP.pdf | 2023-08-18 16:02 | 100K | |
![[ ]](/icons/pdf.gif) | ADU analysis TLC APC Review.pdf | 2024-05-24 15:53 | 482K | |
![[ ]](/icons/pdf.gif) | AET2022.pdf | 2022-04-22 15:00 | 37K | |
![[ ]](/icons/pdf.gif) | AET Ad 2017 Ohtaki June 2017 deadline.pdf | 2017-06-09 08:40 | 184K | |
![[ ]](/icons/pdf.gif) | AET Ad 2019 Ohtaki June 2019 deadline.pdf | 2019-02-08 09:55 | 121K | |
![[ ]](/icons/pdf.gif) | AET Ad 2022.pdf | 2022-01-20 17:08 | 121K | |
![[ ]](/icons/unknown.gif) | AGENDA.docx | 2023-03-22 14:35 | 44K | |
![[ ]](/icons/pdf.gif) | AGM 2017.pdf | 2017-06-19 08:40 | 156K | |
![[ ]](/icons/pdf.gif) | AGM 2018.pdf | 2018-06-14 08:41 | 62K | |
![[ ]](/icons/pdf.gif) | ALC Decision.pdf | 2022-10-07 14:44 | 292K | |
![[ ]](/icons/pdf.gif) | AMENDED-ECO&SUST-09-02-16.pdf | 2016-10-19 11:53 | 476K | |
![[ ]](/icons/pdf.gif) | ANNUAL21-06-22.pdf | 2021-06-18 14:45 | 77K | |
![[ ]](/icons/pdf.gif) | ANNUAL22-06-21.pdf | 2022-06-17 08:36 | 76K | |
![[ ]](/icons/pdf.gif) | ANNUAL23-06-27.pdf | 2023-06-23 15:02 | 168K | |
![[ ]](/icons/pdf.gif) | ANNUAL24-06-25.pdf | 2024-06-21 16:09 | 167K | |
![[ ]](/icons/pdf.gif) | ANNUAL25-06-24.pdf | 2025-06-20 16:20 | 205K | |
![[ ]](/icons/pdf.gif) | APC-2022.pdf | 2021-05-07 11:57 | 38K | |
![[ ]](/icons/pdf.gif) | APC16-10-27.pdf | 2016-10-28 09:56 | 794K | |
![[ ]](/icons/pdf.gif) | APC16-11-24.pdf | 2016-11-24 11:10 | 2.0M | |
![[ ]](/icons/pdf.gif) | APC17-01-26.pdf | 2017-02-20 15:24 | 2.6M | |
![[ ]](/icons/pdf.gif) | APC17-02-23.pdf | 2017-02-23 14:53 | 283K | |
![[ ]](/icons/pdf.gif) | APC17-03-23.pdf | 2017-03-24 16:19 | 6.0M | |
![[ ]](/icons/pdf.gif) | APC17-04-27.pdf | 2017-04-27 09:04 | 1.1M | |
![[ ]](/icons/pdf.gif) | APC17-06-22.pdf | 2017-06-26 11:10 | 1.8M | |
![[ ]](/icons/pdf.gif) | APC17-08-31.pdf | 2017-09-04 18:01 | 4.5M | |
![[ ]](/icons/pdf.gif) | APC17-11-23.pdf | 2017-11-22 14:13 | 280K | |
![[ ]](/icons/pdf.gif) | APC18-06-28.pdf | 2018-07-03 15:46 | 2.7M | |
![[ ]](/icons/pdf.gif) | APC18-09-27.pdf | 2018-09-25 12:55 | 122K | |
![[ ]](/icons/pdf.gif) | APC18-3-22.pdf | 2018-03-28 08:47 | 2.2M | |
![[ ]](/icons/pdf.gif) | APC18-4-26.pdf | 2018-04-23 16:28 | 4.0M | |
![[ ]](/icons/pdf.gif) | APC18-5-24.pdf | 2018-06-08 15:16 | 3.6M | |
![[ ]](/icons/pdf.gif) | APC18-11-22.pdf | 2018-11-19 15:47 | 255K | |
![[ ]](/icons/pdf.gif) | APC19-1-24.pdf | 2019-02-01 18:47 | 498K | |
![[ ]](/icons/pdf.gif) | APC19-3-21.pdf | 2019-03-22 17:16 | 178K | |
![[ ]](/icons/pdf.gif) | APC19-5-23.pdf | 2019-06-07 16:20 | 139K | |
![[ ]](/icons/pdf.gif) | APC20-10-22.pdf | 2020-10-23 17:50 | 82K | |
![[ ]](/icons/pdf.gif) | APC20-11-26.pdf | 2020-11-23 11:47 | 83K | |
![[ ]](/icons/pdf.gif) | APC 20.01.23.pdf | 2020-01-21 09:33 | 882K | |
![[ ]](/icons/pdf.gif) | APC21-01-28.pdf | 2021-01-25 21:34 | 82K | |
![[ ]](/icons/pdf.gif) | APC21-02-25.pdf | 2021-02-23 21:24 | 89K | |
![[ ]](/icons/pdf.gif) | APC21-03-25.pdf | 2021-03-23 17:28 | 63K | |
![[ ]](/icons/pdf.gif) | APC21-04-22.pdf | 2021-04-20 15:37 | 64K | |
![[ ]](/icons/pdf.gif) | APC21-05-27.pdf | 2021-05-26 12:47 | 66K | |
![[ ]](/icons/pdf.gif) | APC21-06-24.pdf | 2021-06-22 10:06 | 62K | |
![[ ]](/icons/pdf.gif) | APC21-09-23.pdf | 2021-09-20 16:00 | 65K | |
![[ ]](/icons/pdf.gif) | APC22-02-24.pdf | 2022-02-21 18:01 | 64K | |
![[ ]](/icons/pdf.gif) | APC22-03-24.pdf | 2022-03-21 16:29 | 66K | |
![[ ]](/icons/pdf.gif) | APC22-09-21.pdf | 2022-09-21 16:07 | 96K | |
![[ ]](/icons/pdf.gif) | APC22-11-10.pdf | 2022-11-18 15:33 | 95K | |
![[ ]](/icons/unknown.gif) | APC23-01-26.doc | 2023-01-23 12:56 | 139K | |
![[ ]](/icons/pdf.gif) | APC23-01-26.pdf | 2023-01-23 12:58 | 64K | |
![[ ]](/icons/pdf.gif) | APC23-02-23.pdf | 2023-02-15 11:19 | 69K | |
![[ ]](/icons/pdf.gif) | APC23-03-23.pdf | 2023-03-22 10:29 | 67K | |
![[ ]](/icons/pdf.gif) | APC23-07-27.pdf | 2023-07-25 10:58 | 63K | |
![[ ]](/icons/pdf.gif) | APC23-09-21.pdf | 2023-09-18 15:09 | 62K | |
![[ ]](/icons/pdf.gif) | APC23-10-26.pdf | 2023-10-20 12:33 | 63K | |
![[ ]](/icons/pdf.gif) | APC23-11-16.pdf | 2023-11-13 15:55 | 61K | |
![[ ]](/icons/pdf.gif) | APC23TERM.pdf | 2022-12-16 14:15 | 307K | |
![[ ]](/icons/pdf.gif) | APC24-03-28.pdf | 2024-03-26 08:27 | 63K | |
![[ ]](/icons/pdf.gif) | APC24-04-25.pdf | 2024-04-23 13:00 | 61K | |
![[ ]](/icons/pdf.gif) | APC24-05-23.pdf | 2024-05-17 14:40 | 60K | |
![[ ]](/icons/pdf.gif) | APC24-06-27.pdf | 2024-06-25 10:38 | 60K | |
![[ ]](/icons/pdf.gif) | APC24-07-25.pdf | 2024-07-22 14:55 | 62K | |
![[ ]](/icons/pdf.gif) | APC24-09-26.pdf | 2024-09-25 11:39 | 61K | |
![[ ]](/icons/pdf.gif) | APC24-10-24.pdf | 2024-10-21 16:07 | 62K | |
![[ ]](/icons/pdf.gif) | APC24-11-21.pdf | 2024-11-18 15:42 | 61K | |
![[ ]](/icons/pdf.gif) | APC25-01-30.pdf | 2025-01-30 08:40 | 66K | |
![[ ]](/icons/pdf.gif) | APC25-02-27.pdf | 2025-02-21 15:24 | 61K | |
![[ ]](/icons/pdf.gif) | APC25-03-27.pdf | 2025-03-20 14:24 | 65K | |
![[ ]](/icons/pdf.gif) | APC25-04-24.pdf | 2025-04-17 16:39 | 64K | |
![[ ]](/icons/pdf.gif) | APC25-06-26.pdf | 2025-06-20 11:40 | 96K | |
![[ ]](/icons/pdf.gif) | APC25-09-18.pdf | 2025-09-15 11:37 | 143K | |
![[ ]](/icons/pdf.gif) | APC25-10-23.pdf | 2025-10-21 14:30 | 99K | |
![[ ]](/icons/pdf.gif) | APC25-12-18.pdf | 2025-12-18 08:34 | 209K | |
![[ ]](/icons/pdf.gif) | APC26-01-22.pdf | 2026-01-21 08:51 | 171K | |
![[ ]](/icons/pdf.gif) | APC26-03-26.pdf | 2026-03-25 11:37 | 248K | |
![[ ]](/icons/pdf.gif) | APC26-04-23.pdf | 2026-04-22 14:14 | 256K | |
![[ ]](/icons/pdf.gif) | APC26-05-21.pdf | 2026-05-15 15:46 | 254K | |
![[ ]](/icons/pdf.gif) | APC2021.pdf | 2020-12-21 15:43 | 291K | |
![[ ]](/icons/pdf.gif) | APC2025.pdf | 2024-12-13 15:05 | 409K | |
![[ ]](/icons/pdf.gif) | APC Agenda.pdf | 2019-10-04 16:17 | 178K | |
![[ ]](/icons/pdf.gif) | APC Agenda Oct 24.pdf | 2019-11-08 16:24 | 3.3M | |
![[ ]](/icons/pdf.gif) | APCEMAILS.pdf | 2025-05-09 16:19 | 169K | |
![[ ]](/icons/pdf.gif) | APC Housing Policy for OCP.pdf | 2023-06-26 11:39 | 311K | |
![[ ]](/icons/pdf.gif) | APCMembership.pdf | 2021-07-08 09:51 | 38K | |
![[ ]](/icons/pdf.gif) | APC Membership 2yr Term.pdf | 2024-12-17 15:01 | 127K | |
![[ ]](/icons/pdf.gif) | APC Membership 2023-24.pdf | 2022-11-18 15:33 | 38K | |
![[ ]](/icons/pdf.gif) | APCR3ZONE.pdf | 2025-04-17 16:34 | 157K | |
![[ ]](/icons/pdf.gif) | APC RE-AD.pdf | 2021-06-03 16:27 | 38K | |
![[ ]](/icons/pdf.gif) | APC Sept 24.pdf | 2020-09-25 15:52 | 1.9M | |
![[ ]](/icons/pdf.gif) | APCexcerpts.pdf | 2025-06-20 11:40 | 151K | |
![[ ]](/icons/pdf.gif) | APPLICATION FOR UPGRADE OF COLLECTION TOTERS.pdf | 2017-02-24 14:52 | 325K | |
![[ ]](/icons/pdf.gif) | ARM23-04-25.pdf | 2023-04-26 15:49 | 164K | |
![[ ]](/icons/pdf.gif) | ASP22.pdf | 2022-01-07 15:17 | 1.9M | |
![[ ]](/icons/pdf.gif) | ATNP.pdf | 2020-10-23 17:28 | 387K | |
![[ ]](/icons/pdf.gif) | ATNP2021.pdf | 2021-06-11 15:01 | 13M | |
![[ ]](/icons/pdf.gif) | Aaron Frisby.pdf | 2020-04-14 14:49 | 35K | |
![[ ]](/icons/pdf.gif) | Accessibility.pdf | 2023-10-20 12:19 | 54K | |
![[ ]](/icons/pdf.gif) | Accessiblity Committee Formation.pdf | 2026-01-08 11:52 | 176K | |
![[ ]](/icons/pdf.gif) | Acting Mayors Report 20-10-27.pdf | 2020-11-18 14:19 | 170K | |
![[ ]](/icons/pdf.gif) | Active Transportation.pdf | 2021-01-11 15:19 | 125K | |
![[ ]](/icons/pdf.gif) | Addendum1.pdf | 2021-08-05 16:04 | 114K | |
![[ ]](/icons/pdf.gif) | Addendum No2.pdf | 2021-08-09 16:22 | 183K | |
![[ ]](/icons/pdf.gif) | Addendum Two.pdf | 2017-04-18 10:54 | 269K | |
![[ ]](/icons/pdf.gif) | Address Change Form fillable.pdf | 2024-09-05 15:34 | 40K | |
![[ ]](/icons/pdf.gif) | Address Change Form fillable 2022.pdf | 2022-02-18 12:49 | 40K | |
![[ ]](/icons/pdf.gif) | Advance Electoral Registration.pdf | 2022-08-05 10:14 | 43K | |
![[ ]](/icons/pdf.gif) | Affordable Housing initiatives.pdf | 2024-03-26 08:22 | 137K | |
![[ ]](/icons/pdf.gif) | AgeFriendlyPlanLakeCowichan_FINAL_Nov9.pdf | 2016-10-19 11:53 | 18M | |
![[ ]](/icons/pdf.gif) | Agent Authorization Form.pdf | 2026-03-26 16:26 | 204K | |
![[ ]](/icons/pdf.gif) | Air Quality Update.pdf | 2023-02-14 10:49 | 4.0M | |
![[ ]](/icons/pdf.gif) | Airshed Meeting notes January 2023.pdf | 2023-02-14 10:49 | 173K | |
![[ ]](/icons/pdf.gif) | Analysis of Increased Density.pdf | 2024-10-18 14:56 | 1.6M | |
![[ ]](/icons/pdf.gif) | Analysis of Increased Density on a lot for APC Review.pdf | 2025-04-17 16:34 | 1.6M | |
![[ ]](/icons/pdf.gif) | Annual 19-06-18.pdf | 2019-06-15 00:00 | 71K | |
![[ ]](/icons/pdf.gif) | Annual Report 2017.pdf | 2018-06-20 09:34 | 5.9M | |
![[ ]](/icons/pdf.gif) | Annual Report 2018.pdf | 2019-06-18 17:54 | 5.9M | |
![[ ]](/icons/pdf.gif) | Annual Report 2020.pdf | 2021-06-25 16:22 | 6.6M | |
![[ ]](/icons/pdf.gif) | Application-Business License.pdf | 2016-11-07 14:03 | 250K | |
![[ ]](/icons/pdf.gif) | Application-Final Subdivision-2022.pdf | 2023-01-12 10:17 | 140K | |
![[ ]](/icons/pdf.gif) | Application-Final Subdivision-2026.pdf | 2026-04-30 09:30 | 234K | |
![[ ]](/icons/pdf.gif) | Application-Final Subdivision-fill.pdf | 2019-08-30 08:29 | 259K | |
![[ ]](/icons/pdf.gif) | Application-Final Subdivision.pdf | 2020-12-14 15:27 | 132K | |
![[ ]](/icons/pdf.gif) | Application-Final SubdivisionFILLABLE.pdf | 2020-12-30 14:01 | 164K | |
![[ ]](/icons/pdf.gif) | Application-Prelim Subdivision.pdf | 2019-08-29 16:08 | 193K | |
![[ ]](/icons/pdf.gif) | Application-Prelim Subdivision 2021 FILLABLE.pdf | 2020-12-30 14:02 | 226K | |
![[ ]](/icons/pdf.gif) | Application-Prelim Subdivision 2022.pdf | 2022-07-08 14:33 | 194K | |
![[ ]](/icons/pdf.gif) | Application-Prelim Subdivision 2026.pdf | 2026-04-29 09:45 | 257K | |
![[ ]](/icons/pdf.gif) | Application-Prelim Subdivision fill.pdf | 2017-03-27 12:36 | 151K | |
![[ ]](/icons/pdf.gif) | Application Development Permit and Development Variance Permit 2026.pdf | 2026-04-29 09:45 | 200K | |
![[ ]](/icons/pdf.gif) | Application For DevelopmentVariance-Permit-fillable.pdf | 2016-12-08 10:58 | 155K | |
![[ ]](/icons/pdf.gif) | Application For OCP Amendment Rezoning 2017 fillable.pdf | 2017-11-17 14:51 | 301K | |
![[ ]](/icons/pdf.gif) | Application For OCP Amendment Rezoning 2026 .pdf | 2026-04-30 09:34 | 181K | |
![[ ]](/icons/pdf.gif) | Application For OCP Rezone Amend 2026.pdf | 2026-04-30 09:44 | 182K | |
![[ ]](/icons/pdf.gif) | Application Form BoVariance Fillable.pdf | 2016-10-19 11:53 | 30K | |
![[ ]](/icons/pdf.gif) | Application Form Zoning Fillable.pdf | 2016-10-19 11:53 | 46K | |
![[ ]](/icons/pdf.gif) | Application MAIL IN BALLOT 2022 fill.pdf | 2022-09-14 16:16 | 107K | |
![[ ]](/icons/pdf.gif) | Application Park Use and Public Space Permit 2024.pdf | 2024-12-19 14:03 | 287K | |
![[ ]](/icons/pdf.gif) | Application ROW construction fillable.pdf | 2016-10-19 11:53 | 38K | |
![[ ]](/icons/pdf.gif) | ApplicationforSignInstallation fillable.pdf | 2016-10-19 11:53 | 48K | |
![[ ]](/icons/pdf.gif) | Application to Work Election Official FILLABLE.pdf | 2022-09-07 10:56 | 224K | |
![[ ]](/icons/pdf.gif) | AppointmentElectionOfficers.pdf | 2020-08-07 15:20 | 501K | |
![[ ]](/icons/pdf.gif) | Appointment of Directors.pdf | 2021-09-24 15:53 | 461K | |
![[ ]](/icons/pdf.gif) | Appraisal Services RFP 2021.pdf | 2021-07-21 16:34 | 112K | |
![[ ]](/icons/pdf.gif) | Appraisal Services RFP 2024.pdf | 2024-08-09 11:49 | 112K | |
![[ ]](/icons/pdf.gif) | Arbutus.pdf | 2021-07-23 15:15 | 380K | |
![[ ]](/icons/pdf.gif) | Attach A 2023-01 State of the Economy Report-FINAL.pdf | 2023-02-24 15:54 | 541K | |
![[ ]](/icons/pdf.gif) | Attach B 2023-02-08 Cowichan Workforce Housing Strategy Public Engagement Plan FINAL.pdf | 2023-02-24 15:55 | 7.3M | |
![[ ]](/icons/pdf.gif) | AudioVisual Recording.pdf | 2024-11-08 15:39 | 1.3M | |
![[ ]](/icons/pdf.gif) | August 2020 Incident Report.pdf | 2020-09-04 14:37 | 95K | |
![[ ]](/icons/pdf.gif) | August building.pdf | 2020-10-09 15:21 | 40K | |
![[ ]](/icons/pdf.gif) | BC Donation InquiryR.pdf | 2025-04-17 15:35 | 54K | |
![[ ]](/icons/pdf.gif) | BCH-Secondary-Suite.pdf | 2024-02-28 10:52 | 506K | |
![[ ]](/icons/pdf.gif) | BC HDRO News Release.pdf | 2020-04-03 10:00 | 141K | |
![[ ]](/icons/pdf.gif) | BC Hydro News release.pdf | 2024-09-20 14:06 | 190K | |
![[ ]](/icons/pdf.gif) | BC Hydro Re-greening grant.pdf | 2023-04-06 14:47 | 2.0M | |
![[ ]](/icons/pdf.gif) | BCInfo.pdf | 2020-12-04 16:02 | 510K | |
![[ ]](/icons/pdf.gif) | BCLH-SANGHA.pdf | 2023-02-24 15:55 | 1.7M | |
![[ ]](/icons/pdf.gif) | BEAPR21.pdf | 2021-06-04 15:18 | 280K | |
![[ ]](/icons/pdf.gif) | BEMAR21.pdf | 2021-05-07 15:19 | 288K | |
![[ ]](/icons/pdf.gif) | BIAPR21.pdf | 2021-05-07 15:19 | 43K | |
![[ ]](/icons/pdf.gif) | BIFEB22.pdf | 2022-03-04 15:01 | 39K | |
![[ ]](/icons/pdf.gif) | BIJAN22.pdf | 2022-02-04 15:28 | 40K | |
![[ ]](/icons/pdf.gif) | BIMAR22.pdf | 2022-04-08 14:56 | 41K | |
![[ ]](/icons/pdf.gif) | BIMAY21.pdf | 2021-06-04 15:18 | 42K | |
![[ ]](/icons/pdf.gif) | BINov20.pdf | 2020-12-04 16:02 | 42K | |
![[ ]](/icons/pdf.gif) | BIOct20.pdf | 2020-11-06 16:01 | 39K | |
![[ ]](/icons/pdf.gif) | BIRSept2021.pdf | 2021-10-12 14:02 | 76K | |
![[ ]](/icons/pdf.gif) | BI Report April-20.pdf | 2020-05-07 16:36 | 384K | |
![[ ]](/icons/pdf.gif) | BL1061.pdf | 2021-07-23 15:15 | 368K | |
![[ ]](/icons/pdf.gif) | BL May, 2020.pdf | 2020-06-12 15:56 | 67K | |
![[ ]](/icons/pdf.gif) | BVD VP.pdf | 2021-03-09 15:43 | 2.2M | |
![[ ]](/icons/pdf.gif) | BWN 2016 NOV 7 LIFTED.pdf | 2016-11-09 12:00 | 310K | |
![[ ]](/icons/pdf.gif) | Background Analysis Part II.pdf | 2023-03-17 15:45 | 611K | |
![[ ]](/icons/pdf.gif) | Background Analysis Part II Housing Infrastructure Climate.pdf | 2023-10-26 15:50 | 611K | |
![[ ]](/icons/pdf.gif) | Backyard chickens.pdf | 2020-10-09 15:33 | 472K | |
![[ ]](/icons/pdf.gif) | Beaver Creek Restoration.pdf | 2023-02-13 18:04 | 264K | |
![[ ]](/icons/pdf.gif) | Bill 44.pdf | 2024-11-18 15:16 | 190K | |
![[ ]](/icons/pdf.gif) | Board of Variance App Form.pdf | 2017-11-02 11:33 | 145K | |
![[ ]](/icons/pdf.gif) | Board of Variance App FormFILLABLE.pdf | 2020-12-30 11:38 | 85K | |
![[ ]](/icons/pdf.gif) | Board of Variance App Form Fillable.pdf | 2017-11-02 14:32 | 139K | |
![[ ]](/icons/pdf.gif) | Bplan.pdf | 2024-02-13 11:35 | 98K | |
![[ ]](/icons/pdf.gif) | British Columbia Humanist Association.pdf | 2020-07-30 09:53 | 109K | |
![[ ]](/icons/pdf.gif) | Budget23-04-04.pdf | 2023-03-31 16:13 | 165K | |
![[ ]](/icons/pdf.gif) | Budget 2024.pdf | 2024-03-20 15:17 | 4.2M | |
![[ ]](/icons/pdf.gif) | Budget2024 Agenda.pdf | 2024-04-08 18:06 | 63K | |
![[ ]](/icons/pdf.gif) | Budget Agenda.pdf | 2024-04-03 08:41 | 60K | |
![[ ]](/icons/pdf.gif) | Budget Estimates 2021-1.pdf | 2021-02-26 17:12 | 81K | |
![[ ]](/icons/pdf.gif) | Budget Estimates 2021-2.pdf | 2021-03-04 14:36 | 81K | |
![[ ]](/icons/pdf.gif) | Budget Estimates 2021-3.pdf | 2021-03-10 15:59 | 80K | |
![[ ]](/icons/pdf.gif) | Budget Mtg 25-04-16.pdf | 2025-04-14 16:46 | 60K | |
![[ ]](/icons/pdf.gif) | Budget meeting Schedule 2026.pdf | 2026-02-04 15:17 | 131K | |
![[ ]](/icons/pdf.gif) | Building Application FULL package 2025.pdf | 2025-05-29 14:19 | 10M | |
![[ ]](/icons/pdf.gif) | Building Application FULL package 2026.pdf | 2026-05-13 16:13 | 10M | |
![[ ]](/icons/pdf.gif) | Building Inspector.pdf | 2024-05-31 09:18 | 78K | |
![[ ]](/icons/pdf.gif) | Building Inspectors Report.pdf | 2020-07-10 15:41 | 87K | |
![[ ]](/icons/pdf.gif) | Building Report.pdf | 2020-04-14 14:49 | 64K | |
![[ ]](/icons/pdf.gif) | BuildingReport.pdf | 2020-08-07 15:20 | 74K | |
![[ ]](/icons/pdf.gif) | Building checklist and application 2025.pdf | 2025-05-29 14:49 | 395K | |
![[ ]](/icons/pdf.gif) | Buildingoct.pdf | 2023-11-14 14:14 | 46K | |
![[ ]](/icons/pdf.gif) | Building permit application and checklist 2025.pdf | 2025-05-29 14:47 | 395K | |
![[ ]](/icons/pdf.gif) | Building permit application and checklist 2026.pdf | 2026-02-23 10:15 | 518K | |
![[ ]](/icons/pdf.gif) | Business Directory.pdf | 2023-07-13 15:50 | 166K | |
![[ ]](/icons/pdf.gif) | Business License 24 Fill.pdf | 2024-09-05 16:17 | 110K | |
![[ ]](/icons/pdf.gif) | Bylaw1043-2020.pdf | 2020-08-07 15:20 | 256K | |
![[ ]](/icons/pdf.gif) | Bylaw 1125 Development Approval Procedures DRAFT 26-02-20.pdf | 2026-03-06 08:16 | 307K | |
![[ ]](/icons/pdf.gif) | Bylaw 1125 Development Approval Procedures w CoverPage.pdf | 2025-12-12 13:48 | 314K | |
![[ ]](/icons/pdf.gif) | Bylaw 1125 Questionnaire 2026-03-05.pdf | 2026-03-12 15:22 | 166K | |
![[ ]](/icons/pdf.gif) | Bylaw Complaint Form FILLABLE.pdf | 2025-08-13 17:48 | 213K | |
![[ ]](/icons/pdf.gif) | Bylaw Updates.pdf | 2020-10-20 19:47 | 1.7M | |
![[ ]](/icons/pdf.gif) | Bylaw Updates Following Adoption of the Updated OCP October 2020.pdf | 2020-10-20 19:42 | 1.7M | |
![[ ]](/icons/pdf.gif) | Bypass study.pdf | 2022-09-21 14:41 | 1.1M | |
![[ ]](/icons/pdf.gif) | C3 Zoning Release 26-01-16.pdf | 2026-01-16 15:01 | 355K | |
![[ ]](/icons/pdf.gif) | CAO1082.pdf | 2023-02-24 15:55 | 1.7M | |
![[ ]](/icons/pdf.gif) | CAO1084.pdf | 2023-02-24 15:55 | 107K | |
![[ ]](/icons/pdf.gif) | CAO Ann.pdf | 2025-02-18 16:55 | 642K | |
![[ ]](/icons/pdf.gif) | CAO Announcement.pdf | 2025-06-16 15:33 | 42K | |
![[ ]](/icons/pdf.gif) | CAOBILL44AH.pdf | 2024-04-05 15:34 | 2.0M | |
![[ ]](/icons/pdf.gif) | CAO CAPITAL24.pdf | 2024-01-19 15:01 | 26K | |
![[ ]](/icons/pdf.gif) | CAOELECTIONPROCEDURE.pdf | 2022-01-11 15:36 | 99K | |
![[ ]](/icons/pdf.gif) | CAO HAFAPPROVAL.pdf | 2024-01-19 15:02 | 81K | |
![[ ]](/icons/pdf.gif) | CAO STR.pdf | 2024-03-22 15:30 | 69K | |
![[ ]](/icons/pdf.gif) | CAO Waive BP Fees.pdf | 2023-06-09 15:46 | 705K | |
![[ ]](/icons/pdf.gif) | CAOmemoBL1058.pdf | 2021-07-23 15:16 | 1.0M | |
![[ ]](/icons/pdf.gif) | CCA Summary.pdf | 2023-04-24 15:30 | 10M | |
![[ ]](/icons/pdf.gif) | CCForum.pdf | 2020-12-04 16:15 | 541K | |
![[ ]](/icons/pdf.gif) | CEO Forum LGLA.pdf | 2021-04-23 17:12 | 905K | |
![[ ]](/icons/pdf.gif) | CEPF 2023 ENHANCE EMS.pdf | 2022-11-18 15:34 | 333K | |
![[ ]](/icons/pdf.gif) | CEPFESSG.pdf | 2021-01-22 15:25 | 2.0M | |
![[ ]](/icons/pdf.gif) | CEPFESSGrant.pdf | 2021-01-22 15:24 | 2.0M | |
![[ ]](/icons/pdf.gif) | CG2022AGREE.pdf | 2022-02-04 15:28 | 272K | |
![[ ]](/icons/pdf.gif) | CHA21.pdf | 2021-03-19 15:24 | 879K | |
![[ ]](/icons/unknown.gif) | CHA Annual Report.pptx | 2021-09-24 15:53 | 1.3M | |
![[ ]](/icons/pdf.gif) | CHCI.pdf | 2021-05-14 15:54 | 665K | |
![[ ]](/icons/pdf.gif) | CLACART.pdf | 2022-02-04 15:28 | 618K | |
![[ ]](/icons/pdf.gif) | CLAC Egg Event 2023.pdf | 2023-04-06 14:47 | 303K | |
![[ ]](/icons/pdf.gif) | CLCS.pdf | 2021-09-24 15:53 | 48K | |
![[ ]](/icons/pdf.gif) | CLEC.pdf | 2021-11-12 14:52 | 370K | |
![[ ]](/icons/pdf.gif) | CLECDec20.pdf | 2021-01-15 15:14 | 45K | |
![[ ]](/icons/pdf.gif) | CLEC part-time.pdf | 2019-05-14 15:43 | 127K | |
![[ ]](/icons/pdf.gif) | CLI Info.pdf | 2022-05-20 14:27 | 179K | |
![[ ]](/icons/pdf.gif) | CLR-Park's-Trails-2011.pdf | 2016-10-19 11:57 | 193K | |
![[ ]](/icons/pdf.gif) | CLRS GIA 2025.pdf | 2025-06-06 16:01 | 134K | |
![[ ]](/icons/pdf.gif) | CMHC HAF DCC support Staff memo 2025-07-22 Council - F.pdf | 2025-07-18 14:09 | 196K | |
![[ ]](/icons/pdf.gif) | COVID-19.pdf | 2021-12-02 09:35 | 77K | |
![[ ]](/icons/pdf.gif) | COVID-19 Volunteer Protocol Guidelines 03-24-2020.pdf | 2020-03-25 15:26 | 163K | |
![[ ]](/icons/pdf.gif) | CP1053.pdf | 2021-08-20 12:57 | 343K | |
![[ ]](/icons/pdf.gif) | CP1054.pdf | 2021-08-20 12:57 | 254K | |
![[ ]](/icons/pdf.gif) | CR.pdf | 2021-11-12 14:53 | 62K | |
![[ ]](/icons/pdf.gif) | CRI-421 Lake Cowichan Payment Letter FSERF.pdf | 2022-11-18 15:34 | 120K | |
![[ ]](/icons/pdf.gif) | CRI-523-Lake_Cowichan-Payment_Letter.pdf | 2024-06-21 16:14 | 94K | |
![[ ]](/icons/pdf.gif) | CRI-613 Lake Cowichan 2023 Final Report & Payment Letter.pdf | 2024-06-21 16:14 | 94K | |
![[ ]](/icons/pdf.gif) | CRI2022.pdf | 2022-03-18 15:26 | 1.6M | |
![[ ]](/icons/pdf.gif) | CRIP21FS.pdf | 2021-03-19 15:24 | 306K | |
![[ ]](/icons/pdf.gif) | CRP.pdf | 2020-10-23 17:15 | 310K | |
![[ ]](/icons/pdf.gif) | CRS Notification - 1st Ave Vapes Ltd. job 4441.pdf | 2020-09-25 14:48 | 98K | |
![[ ]](/icons/pdf.gif) | CVRD - Lake Cowichan Tax brochure.pdf | 2021-03-17 09:03 | 432K | |
![[ ]](/icons/pdf.gif) | CVRD 2020 Lake Cowichan Tax Brochure.pdf | 2020-05-25 12:46 | 505K | |
![[ ]](/icons/pdf.gif) | CVRD 2021 Lake Cowichan Tax Brochure.pdf | 2021-04-28 11:21 | 432K | |
![[ ]](/icons/pdf.gif) | CVRD 2022 Tax Brochure.pdf | 2022-06-03 10:28 | 344K | |
![[ ]](/icons/pdf.gif) | CVRD 2023 Lake Cowichan Tax Brochure.pdf | 2023-03-29 10:23 | 396K | |
![[ ]](/icons/pdf.gif) | CVRD 2024 Lake Cowichan Tax Brochure.pdf | 2024-04-05 09:16 | 374K | |
![[ ]](/icons/pdf.gif) | CVRD 2025 Tax Insert.pdf | 2025-04-03 08:42 | 8.5M | |
![[ ]](/icons/pdf.gif) | CVRDFIREREG22.pdf | 2022-11-18 15:34 | 574K | |
![[ ]](/icons/pdf.gif) | CVRD Fireworks-23.pdf | 2023-07-21 15:26 | 91K | |
![[ ]](/icons/unknown.gif) | CVRD RNA Summary Presentation FINAL.pptx | 2026-05-08 17:33 | 1.5M | |
![[ ]](/icons/pdf.gif) | CVRD Regional Funding.pdf | 2023-05-19 14:36 | 4.8M | |
![[ ]](/icons/pdf.gif) | CVRD Waive BP Fees.pdf | 2023-06-09 15:46 | 316K | |
![[ ]](/icons/pdf.gif) | CW22-01-11.pdf | 2022-01-07 15:17 | 85K | |
![[ ]](/icons/pdf.gif) | CW22-01-18.pdf | 2022-01-19 10:03 | 115K | |
![[ ]](/icons/pdf.gif) | CW22-01-19.pdf | 2022-01-19 14:14 | 111K | |
![[ ]](/icons/pdf.gif) | CW22-01-24.pdf | 2022-01-21 12:04 | 78K | |
![[ ]](/icons/pdf.gif) | CW22-02-01.pdf | 2022-01-27 18:04 | 81K | |
![[ ]](/icons/pdf.gif) | CW22-02-08.pdf | 2022-02-04 15:28 | 91K | |
![[ ]](/icons/pdf.gif) | CW22-03-08.pdf | 2022-03-04 15:13 | 81K | |
![[ ]](/icons/pdf.gif) | CW22-04-12.pdf | 2022-04-08 14:57 | 90K | |
![[ ]](/icons/pdf.gif) | CW22-05-10.pdf | 2022-05-06 16:33 | 83K | |
![[ ]](/icons/pdf.gif) | CW22-06-14.pdf | 2022-06-10 16:47 | 85K | |
![[ ]](/icons/pdf.gif) | CW22-07-12.pdf | 2022-07-11 08:51 | 85K | |
![[ ]](/icons/pdf.gif) | CW22-09-06.pdf | 2022-09-02 13:41 | 89K | |
![[ ]](/icons/pdf.gif) | CW22-10-11.pdf | 2022-10-07 14:45 | 87K | |
![[ ]](/icons/pdf.gif) | CW22-11-08.pdf | 2022-11-18 15:34 | 85K | |
![[ ]](/icons/pdf.gif) | CW22-12-13.pdf | 2022-12-13 14:40 | 91K | |
![[ ]](/icons/pdf.gif) | CW23-01-10.pdf | 2023-01-10 15:14 | 85K | |
![[ ]](/icons/pdf.gif) | CW23-02-14.pdf | 2023-02-13 18:08 | 91K | |
![[ ]](/icons/pdf.gif) | CW23-03-14.pdf | 2023-03-13 16:11 | 219K | |
![[ ]](/icons/pdf.gif) | CW23-04-11.pdf | 2023-04-06 14:48 | 207K | |
![[ ]](/icons/pdf.gif) | CW23-05-09.pdf | 2023-05-05 15:58 | 214K | |
![[ ]](/icons/pdf.gif) | CW23-06-13.pdf | 2023-06-09 15:46 | 211K | |
![[ ]](/icons/pdf.gif) | CW23-07-11.pdf | 2023-07-07 15:30 | 233K | |
![[ ]](/icons/pdf.gif) | CW23-09-12.pdf | 2023-09-08 15:23 | 216K | |
![[ ]](/icons/pdf.gif) | CW23-10-10.pdf | 2023-10-06 14:14 | 207K | |
![[ ]](/icons/pdf.gif) | CW23-11-14.pdf | 2023-11-10 15:20 | 209K | |
![[ ]](/icons/pdf.gif) | CW23-12-12.pdf | 2023-12-08 15:26 | 243K | |
![[ ]](/icons/pdf.gif) | CW24-01-09.pdf | 2024-01-05 15:42 | 210K | |
![[ ]](/icons/pdf.gif) | CW24-02-13.pdf | 2024-02-13 11:36 | 237K | |
![[ ]](/icons/pdf.gif) | CW24-03-12.pdf | 2024-03-08 16:46 | 208K | |
![[ ]](/icons/pdf.gif) | CW24-04-09.pdf | 2024-04-05 15:55 | 211K | |
![[ ]](/icons/pdf.gif) | CW24-05-14.pdf | 2024-05-10 15:25 | 209K | |
![[ ]](/icons/pdf.gif) | CW24-06-11.pdf | 2024-06-07 11:34 | 209K | |
![[ ]](/icons/pdf.gif) | CW24-07-09.pdf | 2024-07-05 15:19 | 209K | |
![[ ]](/icons/pdf.gif) | CW24-09-10.pdf | 2024-09-06 15:09 | 216K | |
![[ ]](/icons/pdf.gif) | CW24-10-08.pdf | 2024-10-04 15:50 | 243K | |
![[ ]](/icons/pdf.gif) | CW24-11-12.pdf | 2024-11-08 15:14 | 215K | |
![[ ]](/icons/pdf.gif) | CW24-12-10.pdf | 2024-12-06 15:25 | 207K | |
![[ ]](/icons/pdf.gif) | CW25-01-14.pdf | 2025-01-10 15:06 | 206K | |
![[ ]](/icons/pdf.gif) | CW25-02-11.pdf | 2025-02-07 15:35 | 207K | |
![[ ]](/icons/pdf.gif) | CW25-03-11.pdf | 2025-03-07 16:10 | 240K | |
![[ ]](/icons/pdf.gif) | CW25-04-08.pdf | 2025-04-04 15:37 | 208K | |
![[ ]](/icons/pdf.gif) | CW25-05-13.pdf | 2025-05-09 16:22 | 221K | |
![[ ]](/icons/pdf.gif) | CW25-06-10.pdf | 2025-06-20 14:08 | 262K | |
![[ ]](/icons/pdf.gif) | CW25-07-08.pdf | 2025-07-04 16:29 | 292K | |
![[ ]](/icons/pdf.gif) | CW25-09-09.pdf | 2025-09-08 14:58 | 300K | |
![[ ]](/icons/pdf.gif) | CW25-10-14.pdf | 2025-10-14 11:21 | 292K | |
![[ ]](/icons/pdf.gif) | CW25-11-04.pdf | 2025-10-31 14:20 | 262K | |
![[ ]](/icons/pdf.gif) | CW25-12-09.pdf | 2025-12-05 15:20 | 282K | |
![[ ]](/icons/pdf.gif) | CW26-01-13.pdf | 2026-01-09 15:06 | 278K | |
![[ ]](/icons/pdf.gif) | CW26-02-10.pdf | 2026-02-06 14:53 | 263K | |
![[ ]](/icons/pdf.gif) | CW26-03-10.pdf | 2026-03-06 16:56 | 343K | |
![[ ]](/icons/pdf.gif) | CW26-04-14.pdf | 2026-04-10 16:20 | 371K | |
![[ ]](/icons/pdf.gif) | CW26-05-12.pdf | 2026-05-08 17:32 | 372K | |
![[ ]](/icons/pdf.gif) | CW26-06-09-Agenda-final.pdf | 2026-06-05 14:31 | 297K | |
![[ ]](/icons/pdf.gif) | CW26-06-09-Agenda-new.pdf | 2026-06-05 14:34 | 304K | |
![[ ]](/icons/pdf.gif) | CW26-06-09-Agenda-updated.pdf | 2026-06-05 15:26 | 304K | |
![[ ]](/icons/pdf.gif) | CW26-06-09.pdf | 2026-06-05 12:35 | 395K | |
![[VID]](/icons/movie.gif) | CWB Huy ch q'u Health Professionals Shorter.mp4 | 2020-03-30 14:48 | 3.1M | |
![[ ]](/icons/pdf.gif) | CWPP2 Town of Lk Cow 2017 2018 Maps.pdf | 2020-12-07 13:24 | 4.4M | |
![[ ]](/icons/pdf.gif) | CWPP 2017 Lk Cowichan FINAL 09 2018.pdf | 2020-12-07 13:24 | 3.9M | |
![[ ]](/icons/pdf.gif) | Canada Community Building Fund Payment for 22-23.pdf | 2022-12-16 14:15 | 351K | |
![[ ]](/icons/pdf.gif) | Candidate' Information Letter.pdf | 2020-08-28 10:56 | 329K | |
![[ ]](/icons/pdf.gif) | Cannabis Survey.pdf | 2019-08-15 10:13 | 116K | |
![[ ]](/icons/pdf.gif) | Cannabis Survey fillable (2).pdf | 2019-08-15 13:51 | 145K | |
![[ ]](/icons/pdf.gif) | Cannabis Survey fillable.pdf | 2019-08-15 10:37 | 123K | |
![[ ]](/icons/pdf.gif) | Capital Budget.pdf | 2023-03-22 14:35 | 539K | |
![[ ]](/icons/pdf.gif) | Capitalapproval.pdf | 2023-02-26 16:55 | 307K | |
![[ ]](/icons/pdf.gif) | Capital budget 2025.pdf | 2025-02-24 16:00 | 305K | |
![[ ]](/icons/pdf.gif) | Chargingstations.pdf | 2023-05-05 15:40 | 185K | |
![[ ]](/icons/pdf.gif) | Closure of Municipal Premises to Public.pdf | 2020-03-20 12:23 | 150K | |
![[ ]](/icons/pdf.gif) | Code of Ethics Council R035-1-23.pdf | 2025-06-20 11:41 | 229K | |
![[ ]](/icons/pdf.gif) | Code of Ethics for Council.pdf | 2022-05-06 14:47 | 144K | |
![[ ]](/icons/pdf.gif) | Columbarium Niche Sales Form.pdf | 2018-09-24 13:39 | 88K | |
![[ ]](/icons/pdf.gif) | Columbarium Niche Sales Form FILLABLE.pdf | 2024-09-06 10:06 | 118K | |
![[ ]](/icons/pdf.gif) | Commercial rent nom cs24-01-14.pdf | 2025-01-24 15:39 | 417K | |
![[ ]](/icons/pdf.gif) | Communities To Resilient Places.pdf | 2021-07-09 09:52 | 1.3M | |
![[ ]](/icons/pdf.gif) | Community-Profile-Lake-Cowichan.pdf | 2016-10-19 11:57 | 5.0M | |
![[ ]](/icons/pdf.gif) | Community COVID KMs_13May2021.pdf | 2021-05-14 14:51 | 525K | |
![[ ]](/icons/pdf.gif) | Community Engagement Town of Lake Cowichan.pdf | 2021-11-05 15:58 | 163K | |
![[ ]](/icons/pdf.gif) | Communityfiresmart.pdf | 2021-09-24 15:53 | 293K | |
![[ ]](/icons/pdf.gif) | Complaint.pdf | 2024-02-23 15:00 | 126K | |
![[ ]](/icons/pdf.gif) | Compliance and Enforcement Guidance 2020.03.31 final.pdf | 2020-04-02 09:29 | 548K | |
![[ ]](/icons/pdf.gif) | Conflict of interest.pdf | 2025-01-27 16:12 | 96K | |
![[ ]](/icons/pdf.gif) | Connectivity Plan.pdf | 2023-02-14 10:49 | 343K | |
![[ ]](/icons/pdf.gif) | Contract for Demolition of Annex.pdf | 2023-10-20 14:20 | 153K | |
![[ ]](/icons/pdf.gif) | CouncilRemunerationBenefitReportJuly2022.pdf | 2022-09-02 13:41 | 207K | |
![[ ]](/icons/pdf.gif) | Covid-19.pdf | 2020-03-23 17:04 | 127K | |
![[ ]](/icons/unknown.gif) | Covid-19.php | 2020-04-08 14:48 | 5.5K | |
![[ ]](/icons/pdf.gif) | Cow.pdf | 2020-09-25 14:54 | 504K | |
![[ ]](/icons/pdf.gif) | Cowichan - Assessment Report 2021.pdf | 2021-07-09 09:52 | 663K | |
![[ ]](/icons/pdf.gif) | Cowichan Connectivity Strategy.pdf | 2023-03-17 15:45 | 91K | |
![[ ]](/icons/pdf.gif) | Cowichan Lake Connectivity Roadshow.pdf | 2022-09-21 16:06 | 713K | |
![[ ]](/icons/pdf.gif) | Cowichan Region Workforce Housing Strategy.pdf | 2024-11-08 15:14 | 3.7M | |
![[ ]](/icons/pdf.gif) | Cowichan Regional Airshed Roundtable January 2023.pdf | 2023-02-14 10:49 | 300K | |
![[ ]](/icons/pdf.gif) | Cowichan Regional Airshed Roundtable Synopsis February 29 2024.pdf | 2024-03-26 08:22 | 491K | |
![[ ]](/icons/pdf.gif) | Cowichan Workforce Housing Strategy.pdf | 2024-02-26 15:09 | 223K | |
![[ ]](/icons/pdf.gif) | DCC-Affordable-Housing-Support-Terms-of-Reference-R85-2025.pdf | 2025-11-18 12:04 | 208K | |
![[ ]](/icons/pdf.gif) | DCCDRAFT22.pdf | 2022-09-02 13:42 | 7.8M | |
![[ ]](/icons/pdf.gif) | DCOMAY10.pdf | 2021-05-14 15:58 | 169K | |
![[ ]](/icons/pdf.gif) | DCSUPPORT.pdf | 2021-08-20 12:57 | 111K | |
![[ ]](/icons/pdf.gif) | DMR04-25.pdf | 2023-05-15 14:52 | 166K | |
![[ ]](/icons/pdf.gif) | DOF Community Preparedness Grant Funding.pdf | 2023-02-24 15:56 | 233K | |
![[ ]](/icons/pdf.gif) | DOF GIA2020.pdf | 2020-05-21 14:57 | 237K | |
![[ ]](/icons/pdf.gif) | DP01-23.pdf | 2023-02-24 16:06 | 194K | |
![[ ]](/icons/pdf.gif) | DP02-23.pdf | 2023-05-19 14:37 | 1.8M | |
![[ ]](/icons/pdf.gif) | DP021-03.pdf | 2021-06-22 20:47 | 258K | |
![[ ]](/icons/pdf.gif) | DP03-23.pdf | 2023-09-08 15:24 | 1.4M | |
![[ ]](/icons/pdf.gif) | DP04-23.pdf | 2023-09-23 17:23 | 309K | |
![[ ]](/icons/pdf.gif) | DP 3 North Shore Road.pdf | 2020-10-09 14:12 | 328K | |
![[ ]](/icons/pdf.gif) | DP22-02.pdf | 2022-10-21 15:27 | 93K | |
![[ ]](/icons/pdf.gif) | DP24-02.pdf | 2024-05-24 15:53 | 511K | |
![[ ]](/icons/pdf.gif) | DP24-03.pdf | 2024-03-22 12:09 | 2.9M | |
![[ ]](/icons/pdf.gif) | DP2020-001& 002 Staff Report.pdf | 2020-06-26 16:24 | 216K | |
![[ ]](/icons/pdf.gif) | DP2020-08.pdf | 2021-01-22 15:02 | 689K | |
![[ ]](/icons/pdf.gif) | DP2020-09.pdf | 2021-01-22 15:03 | 1.0M | |
![[ ]](/icons/pdf.gif) | DP2021-02.pdf | 2021-04-23 15:13 | 377K | |
![[ ]](/icons/pdf.gif) | DP2025-02.pdf | 2025-05-23 13:16 | 371K | |
![[ ]](/icons/pdf.gif) | DP2025-03.pdf | 2025-07-04 12:06 | 491K | |
![[ ]](/icons/pdf.gif) | DP2025-04.pdf | 2025-07-04 12:06 | 443K | |
![[ ]](/icons/pdf.gif) | DP2025-05-3.pdf | 2025-07-18 14:08 | 271K | |
![[ ]](/icons/pdf.gif) | DP2025-05-4.pdf | 2025-07-18 14:08 | 6.5M | |
![[ ]](/icons/pdf.gif) | DP2025-05.pdf | 2025-07-18 14:08 | 765K | |
![[ ]](/icons/pdf.gif) | DP2025-06-2.pdf | 2025-07-18 14:07 | 16M | |
![[ ]](/icons/pdf.gif) | DP2025-06-3.pdf | 2025-07-18 14:06 | 275K | |
![[ ]](/icons/pdf.gif) | DP2025-06-4.pdf | 2025-07-18 14:45 | 1.2M | |
![[ ]](/icons/pdf.gif) | DP2025-06-5.pdf | 2025-07-18 14:10 | 919K | |
![[ ]](/icons/pdf.gif) | DP2025-06.pdf | 2025-07-18 14:07 | 493K | |
![[ ]](/icons/pdf.gif) | DP2025-10-2.pdf | 2025-09-12 15:51 | 5.1M | |
![[ ]](/icons/pdf.gif) | DP2025-10-3.pdf | 2025-09-12 15:49 | 8.3M | |
![[ ]](/icons/pdf.gif) | DP2025-10-4.pdf | 2025-09-12 15:50 | 8.1M | |
![[ ]](/icons/pdf.gif) | DP2025-10.pdf | 2025-09-12 15:48 | 312K | |
![[ ]](/icons/pdf.gif) | DPA for Walls.pdf | 2021-08-13 14:53 | 43M | |
![[ ]](/icons/pdf.gif) | DRAFT25-04-24APC.pdf | 2025-05-09 16:03 | 182K | |
![[ ]](/icons/pdf.gif) | DVP01-23.pdf | 2023-04-21 15:13 | 88K | |
![[ ]](/icons/pdf.gif) | DVP 3 North Shore Road.pdf | 2020-10-09 14:12 | 440K | |
![[ ]](/icons/pdf.gif) | DVP63CowichanLakeRd.pdf | 2020-08-21 15:34 | 1.4M | |
![[ ]](/icons/pdf.gif) | DVP2021-01.pdf | 2021-02-19 15:57 | 1.3M | |
![[ ]](/icons/pdf.gif) | DVP2024-02.pdf | 2025-06-20 14:09 | 493K | |
![[ ]](/icons/pdf.gif) | DVP2025-01.pdf | 2025-05-23 13:16 | 272K | |
![[ ]](/icons/pdf.gif) | DVP2025-02.pdf | 2025-05-23 13:16 | 335K | |
![[ ]](/icons/pdf.gif) | DVP2025-03.pdf | 2025-05-23 13:16 | 324K | |
![[ ]](/icons/pdf.gif) | DVP2025-04.pdf | 2025-05-23 13:16 | 316K | |
![[ ]](/icons/pdf.gif) | DVP2025-05.pdf | 2025-05-23 13:16 | 325K | |
![[ ]](/icons/pdf.gif) | DVP2025-06.pdf | 2025-09-12 15:48 | 504K | |
![[ ]](/icons/pdf.gif) | Date.pdf | 2020-05-21 14:43 | 236K | |
![[ ]](/icons/pdf.gif) | Date 2022 itinerary.pdf | 2022-06-10 15:31 | 165K | |
![[ ]](/icons/pdf.gif) | Dear Mayors and members of Council of all 162 municipalities in BC.pdf | 2021-11-19 15:46 | 37K | |
![[ ]](/icons/pdf.gif) | Declaration of Candidates.pdf | 2020-09-18 17:53 | 53K | |
![[ ]](/icons/pdf.gif) | Declaration of Candidates 2022.pdf | 2022-09-20 09:50 | 64K | |
![[ ]](/icons/pdf.gif) | Declaration of Official Results.pdf | 2022-10-17 14:18 | 644K | |
![[ ]](/icons/pdf.gif) | Delegate Authority DV matters.pdf | 2025-06-20 11:40 | 264K | |
![[ ]](/icons/pdf.gif) | Delegation Request 2024 Fillable.pdf | 2024-09-05 16:47 | 61K | |
![[ ]](/icons/pdf.gif) | Deputy Minister.pdf | 2020-03-31 14:54 | 3.1M | |
![[ ]](/icons/pdf.gif) | Development Approvals.pdf | 2022-02-21 17:58 | 230K | |
![[ ]](/icons/pdf.gif) | Development Variance Permit 2017 fillable.pdf | 2018-02-19 15:37 | 153K | |
![[ ]](/icons/pdf.gif) | Development Variance Permit 2020 fillable.pdf | 2020-12-24 12:09 | 128K | |
![[ ]](/icons/pdf.gif) | Development Variance Permit 2021FILLABLE.pdf | 2020-12-30 11:52 | 142K | |
![[ ]](/icons/pdf.gif) | Development Variance Permit 2022.pdf | 2021-12-22 16:14 | 116K | |
![[ ]](/icons/pdf.gif) | Development Variance Permit 2023.pdf | 2023-08-10 14:32 | 131K | |
![[ ]](/icons/pdf.gif) | Development Variance Permit fillable 2017.pdf | 2017-11-02 16:37 | 192K | |
![[ ]](/icons/pdf.gif) | Director of Bylaw and Development Services.pdf | 2026-02-26 11:54 | 168K | |
![[ ]](/icons/pdf.gif) | Directory.pdf | 2026-04-30 16:46 | 260K | |
![[ ]](/icons/pdf.gif) | Distracted Driving ICBC campaign.pdf | 2024-09-11 16:41 | 69K | |
![[ ]](/icons/pdf.gif) | DoF-Fin Report - KGSH.pdf | 2021-09-07 09:35 | 162K | |
![[ ]](/icons/pdf.gif) | DoF Finance May 2020.pdf | 2020-06-12 15:56 | 1.2M | |
![[ ]](/icons/pdf.gif) | Draft 2021 financial statements.pdf | 2022-05-06 14:47 | 1.5M | |
![[ ]](/icons/pdf.gif) | Draft FS 2022.pdf | 2023-04-21 16:21 | 966K | |
![[ ]](/icons/pdf.gif) | Draft Letter to Minister from Lake Cowichan.pdf | 2021-12-17 16:06 | 127K | |
![[ ]](/icons/pdf.gif) | Draft Protocol Framework - May 31 doc amended.pdf | 2023-05-05 15:40 | 213K | |
![[ ]](/icons/pdf.gif) | ECON AGENDA 13-03-2018.pdf | 2018-03-09 16:48 | 1.7M | |
![[ ]](/icons/pdf.gif) | ECON_AGENDA-13-03-2018.pdf | 2018-03-09 16:18 | 5.2M | |
![[ ]](/icons/pdf.gif) | ECON_AGENDA_09-18-18.pdf | 2018-09-14 16:20 | 142K | |
![[ ]](/icons/pdf.gif) | ECON_AGENDA_16-01-18.pdf | 2018-01-15 11:23 | 322K | |
![[ ]](/icons/pdf.gif) | EMC2024GRANT.pdf | 2024-02-23 15:00 | 279K | |
![[ ]](/icons/pdf.gif) | EMC 2025 Emergency Management Grants 2024-10-03.pdf | 2024-10-18 14:56 | 279K | |
![[ ]](/icons/pdf.gif) | EMCR24329 Letter.pdf | 2024-01-19 15:02 | 192K | |
![[ ]](/icons/pdf.gif) | EMCUPDATEJAN23.pdf | 2023-01-20 14:33 | 3.4M | |
![[ ]](/icons/pdf.gif) | EMO.pdf | 2021-07-23 15:16 | 2.2M | |
![[ ]](/icons/pdf.gif) | EOC2021.pdf | 2021-05-07 15:27 | 205K | |
![[ ]](/icons/pdf.gif) | ESD16-10-11.pdf | 2016-10-20 12:06 | 4.6M | |
![[ ]](/icons/pdf.gif) | ESD16-11-08.pdf | 2016-11-04 15:29 | 1.5M | |
![[ ]](/icons/pdf.gif) | ESD16-12-13.pdf | 2016-12-12 10:15 | 3.5M | |
![[ ]](/icons/pdf.gif) | ESD17-01-10.pdf | 2017-01-06 16:10 | 149K | |
![[ ]](/icons/pdf.gif) | ESD17-02-14.pdf | 2017-02-10 17:08 | 150K | |
![[ ]](/icons/pdf.gif) | ESD17-03-14.pdf | 2017-03-13 09:06 | 243K | |
![[ ]](/icons/pdf.gif) | ESD17-04-11.pdf | 2017-04-07 16:59 | 4.8M | |
![[ ]](/icons/pdf.gif) | ESD17-05-09.pdf | 2017-05-05 16:26 | 3.1M | |
![[ ]](/icons/pdf.gif) | ESD17-06-13.pdf | 2017-06-09 16:23 | 1.0M | |
![[ ]](/icons/pdf.gif) | ESD17-07-11.pdf | 2017-07-07 16:55 | 1.0M | |
![[ ]](/icons/pdf.gif) | ESD17-08-08.pdf | 2017-08-04 16:32 | 380K | |
![[ ]](/icons/pdf.gif) | ESD17-09-12.pdf | 2017-09-08 17:18 | 192K | |
![[ ]](/icons/pdf.gif) | ESD17-10-10.pdf | 2017-10-06 15:50 | 6.4M | |
![[ ]](/icons/pdf.gif) | ESD17-12-12.pdf | 2017-12-08 20:31 | 157K | |
![[ ]](/icons/pdf.gif) | ESD18-02-13.pdf | 2018-02-09 16:21 | 58K | |
![[ ]](/icons/pdf.gif) | ESD18-03-13.pdf | 2018-03-15 13:07 | 1.8M | |
![[ ]](/icons/pdf.gif) | ESD18-04-10.pdf | 2018-04-06 17:00 | 57K | |
![[ ]](/icons/pdf.gif) | ESD18-05-08.pdf | 2018-05-09 09:58 | 193K | |
![[ ]](/icons/pdf.gif) | ESD18-06-12.pdf | 2018-06-08 15:16 | 1.3M | |
![[ ]](/icons/pdf.gif) | ESD18-07-17.pdf | 2018-07-13 16:52 | 73K | |
![[ ]](/icons/pdf.gif) | ESD18-08-14.pdf | 2018-08-10 16:17 | 58K | |
![[ ]](/icons/pdf.gif) | ESD18-10-09.pdf | 2018-10-08 19:21 | 88K | |
![[ ]](/icons/pdf.gif) | Education Centre and Lakeview.pdf | 2021-03-16 11:14 | 352K | |
![[ ]](/icons/pdf.gif) | ElectionOfficer.pdf | 2022-03-23 12:44 | 51K | |
![[ ]](/icons/pdf.gif) | Election officials Advertisement 2022.pdf | 2022-09-07 11:00 | 86K | |
![[ ]](/icons/pdf.gif) | Elector-Response-Form-Disposal-of-Park-Land.pdf | 2016-10-19 11:58 | 167K | |
![[ ]](/icons/pdf.gif) | Email Contact List.pdf | 2016-10-19 11:58 | 244K | |
![[ ]](/icons/pdf.gif) | Emergency Equipment.pdf | 2023-02-13 18:05 | 71K | |
![[ ]](/icons/pdf.gif) | Employment Code of Conduct.pdf | 2022-05-06 14:47 | 597K | |
![[ ]](/icons/pdf.gif) | Event Invitation Poster.pdf | 2023-03-10 13:06 | 4.1M | |
![[ ]](/icons/pdf.gif) | Exec Summary 2022.pdf | 2023-04-21 16:21 | 36K | |
![[ ]](/icons/pdf.gif) | F-6-3.pdf | 2018-10-24 12:06 | 60K | |
![[ ]](/icons/pdf.gif) | F-6-4.pdf | 2018-10-24 12:06 | 70K | |
![[ ]](/icons/pdf.gif) | FA20-12-08.pdf | 2020-12-04 16:17 | 75K | |
![[ ]](/icons/pdf.gif) | FA21-01-12.pdf | 2021-01-08 16:51 | 75K | |
![[ ]](/icons/pdf.gif) | FA21-02-09.pdf | 2021-02-05 16:21 | 72K | |
![[ ]](/icons/pdf.gif) | FA21-03-09.pdf | 2021-03-09 15:34 | 75K | |
![[ ]](/icons/pdf.gif) | FA21-04-13.pdf | 2021-04-09 17:23 | 72K | |
![[ ]](/icons/pdf.gif) | FA21-05-11.pdf | 2021-05-07 15:19 | 74K | |
![[ ]](/icons/pdf.gif) | FA21-06-08.pdf | 2021-06-08 14:32 | 75K | |
![[ ]](/icons/pdf.gif) | FA21-07-13.pdf | 2021-07-09 16:20 | 79K | |
![[ ]](/icons/pdf.gif) | FA21-08-10.pdf | 2021-08-10 10:51 | 74K | |
![[ ]](/icons/pdf.gif) | FA21-09-07.pdf | 2021-09-03 16:02 | 75K | |
![[ ]](/icons/pdf.gif) | FA21-10-12.pdf | 2021-10-12 14:02 | 73K | |
![[ ]](/icons/pdf.gif) | FA21-11-09.pdf | 2021-11-05 16:42 | 74K | |
![[ ]](/icons/pdf.gif) | FA21-12-07.pdf | 2021-12-03 16:19 | 73K | |
![[ ]](/icons/pdf.gif) | FCMGMFC.pdf | 2022-12-16 14:15 | 107K | |
![[ ]](/icons/pdf.gif) | FCMemoBL1058.pdf | 2021-07-23 15:16 | 1.5M | |
![[ ]](/icons/pdf.gif) | FD, May 2020.pdf | 2020-06-12 15:56 | 136K | |
![[ ]](/icons/pdf.gif) | FDAPR21.pdf | 2021-06-04 15:18 | 86K | |
![[ ]](/icons/pdf.gif) | FD March-20.pdf | 2020-05-07 16:36 | 263K | |
![[ ]](/icons/pdf.gif) | FDNov20.pdf | 2020-12-04 16:02 | 93K | |
![[ ]](/icons/pdf.gif) | FDOct20.pdf | 2020-11-06 16:01 | 84K | |
![[ ]](/icons/pdf.gif) | FDOct2020.pdf | 2020-12-04 16:05 | 83K | |
![[ ]](/icons/pdf.gif) | FIN16-10-11.pdf | 2016-10-20 12:06 | 2.4M | |
![[ ]](/icons/pdf.gif) | FIN16-11-08.pdf | 2016-11-04 15:29 | 2.3M | |
![[ ]](/icons/pdf.gif) | FIN16-12-13.pdf | 2016-12-12 10:15 | 730K | |
![[ ]](/icons/pdf.gif) | FIN17-01-10.pdf | 2017-01-06 16:06 | 1.2M | |
![[ ]](/icons/pdf.gif) | FIN17-02-14.pdf | 2017-02-10 17:08 | 6.0M | |
![[ ]](/icons/pdf.gif) | FIN17-03-14.pdf | 2017-03-13 09:06 | 1.4M | |
![[ ]](/icons/pdf.gif) | FIN17-04-11.pdf | 2017-04-07 16:59 | 4.9M | |
![[ ]](/icons/pdf.gif) | FIN17-05-09.pdf | 2017-05-05 16:25 | 1.9M | |
![[ ]](/icons/pdf.gif) | FIN17-06-13.pdf | 2017-06-09 16:23 | 3.4M | |
![[ ]](/icons/pdf.gif) | FIN17-07-11.pdf | 2017-07-07 16:55 | 2.2M | |
![[ ]](/icons/pdf.gif) | FIN17-08-08.pdf | 2017-08-04 16:31 | 4.8M | |
![[ ]](/icons/pdf.gif) | FIN17-09-12.pdf | 2017-09-08 17:18 | 2.1M | |
![[ ]](/icons/pdf.gif) | FIN17-10-10.pdf | 2017-10-06 15:50 | 2.6M | |
![[ ]](/icons/pdf.gif) | FIN17-11-14.pdf | 2017-11-10 16:27 | 2.2M | |
![[ ]](/icons/pdf.gif) | FIN17-12-12.pdf | 2017-12-08 20:31 | 4.6M | |
![[ ]](/icons/pdf.gif) | FIN18-02-13.pdf | 2018-02-09 16:21 | 1.7M | |
![[ ]](/icons/pdf.gif) | FIN18-03-13.pdf | 2018-03-15 13:02 | 1.9M | |
![[ ]](/icons/pdf.gif) | FIN18-04-10.pdf | 2018-04-06 17:00 | 1.7M | |
![[ ]](/icons/pdf.gif) | FIN18-05-08.pdf | 2018-05-07 09:33 | 5.0M | |
![[ ]](/icons/pdf.gif) | FIN18-06-12.pdf | 2018-06-08 15:15 | 1.9M | |
![[ ]](/icons/pdf.gif) | FIN18-07-17.pdf | 2018-07-13 16:52 | 2.2M | |
![[ ]](/icons/pdf.gif) | FIN18-08-14.pdf | 2018-08-10 16:13 | 2.9M | |
![[ ]](/icons/pdf.gif) | FIN18-10-09.pdf | 2018-10-08 19:21 | 2.1M | |
![[ ]](/icons/pdf.gif) | FIN18-11-13.pdf | 2018-11-13 11:46 | 3.6M | |
![[ ]](/icons/pdf.gif) | FIN18-12-11.pdf | 2018-12-07 15:25 | 1.3M | |
![[ ]](/icons/pdf.gif) | FIN19-01-08.pdf | 2019-01-08 11:36 | 1.0M | |
![[ ]](/icons/pdf.gif) | FIN19-02-05.pdf | 2019-02-04 14:17 | 1.2M | |
![[ ]](/icons/pdf.gif) | FIN19-03-12.pdf | 2019-03-08 16:08 | 1.3M | |
![[ ]](/icons/pdf.gif) | FIN19-05-14.pdf | 2019-05-10 16:59 | 1.3M | |
![[ ]](/icons/pdf.gif) | FIN19-06-11.pdf | 2019-06-07 16:20 | 3.2M | |
![[ ]](/icons/pdf.gif) | FIN19-07-09 .pdf | 2019-07-05 17:10 | 6.0M | |
![[ ]](/icons/pdf.gif) | FIN19-08-13.pdf | 2019-08-09 16:48 | 1.2M | |
![[ ]](/icons/pdf.gif) | FIN19-09-03.pdf | 2019-09-02 18:42 | 1.1M | |
![[ ]](/icons/pdf.gif) | FIN19-10-08.pdf | 2019-10-07 11:52 | 1.8M | |
![[ ]](/icons/pdf.gif) | FIN19-11-12.pdf | 2019-11-08 16:24 | 2.6M | |
![[ ]](/icons/pdf.gif) | FIN19-12-3.pdf | 2019-12-03 15:25 | 1.1M | |
![[ ]](/icons/pdf.gif) | FIN20-01-14.pdf | 2020-01-13 08:26 | 1.4M | |
![[ ]](/icons/pdf.gif) | FIN20-02-11.pdf | 2020-02-07 14:44 | 1.0M | |
![[ ]](/icons/pdf.gif) | FIN20-03-10.pdf | 2020-03-06 16:33 | 2.2M | |
![[ ]](/icons/pdf.gif) | FIN20-07-14.pdf | 2020-07-10 16:01 | 75K | |
![[ ]](/icons/pdf.gif) | FIN20-08-11.pdf | 2020-08-11 19:29 | 72K | |
![[ ]](/icons/pdf.gif) | FIN20-09-08.pdf | 2020-09-04 15:54 | 78K | |
![[ ]](/icons/pdf.gif) | FIN20-10-13.pdf | 2020-10-09 15:37 | 73K | |
![[ ]](/icons/pdf.gif) | FIN20-11-10.pdf | 2020-11-09 18:26 | 78K | |
![[ ]](/icons/pdf.gif) | FINAL - Poverty Reduction Strategy Report.pdf | 2021-09-03 15:30 | 3.0M | |
![[ ]](/icons/pdf.gif) | FINAL RFP Economic Readiness Assessment.pdf | 2016-11-16 09:22 | 330K | |
![[ ]](/icons/pdf.gif) | FINAL Reg Rec.pdf | 2022-09-29 15:43 | 2.0M | |
![[ ]](/icons/unknown.gif) | FINAL Reg Rec.pptx | 2022-09-29 15:14 | 31M | |
![[ ]](/icons/pdf.gif) | FINANCE_AGENDA_09-18-18.pdf | 2018-09-14 16:24 | 3.4M | |
![[ ]](/icons/pdf.gif) | FINANCE_AGENDA_09_04_2019.pdf | 2019-04-05 16:11 | 2.8M | |
![[ ]](/icons/pdf.gif) | FINAPR21.pdf | 2021-05-07 15:18 | 760K | |
![[ ]](/icons/pdf.gif) | FINMAY21.pdf | 2021-06-09 09:57 | 887K | |
![[ ]](/icons/pdf.gif) | FIN_AGENDA-13-03-2018.pdf | 2018-03-09 16:17 | 1.2M | |
![[ ]](/icons/pdf.gif) | FIN_AGENDA_16-01-18.pdf | 2018-01-15 11:23 | 2.9M | |
![[ ]](/icons/pdf.gif) | FLNRORDAERIALSPRAY22.pdf | 2022-01-07 15:17 | 308K | |
![[ ]](/icons/pdf.gif) | FN, Treaty Agreements.pdf | 2020-06-12 15:57 | 1.0M | |
![[ ]](/icons/pdf.gif) | FNS LT UBCM_attach re Call for Municipalities to implement UNDRIP.pdf | 2024-09-20 18:00 | 1.0M | |
![[ ]](/icons/pdf.gif) | FOIPOLICY22.pdf | 2022-01-10 09:04 | 178K | |
![[ ]](/icons/pdf.gif) | FOI Request Fillable Form.pdf | 2026-03-26 16:26 | 200K | |
![[ ]](/icons/pdf.gif) | FORESTPOLICY21.pdf | 2021-06-18 14:46 | 229K | |
![[ ]](/icons/pdf.gif) | FS September.pdf | 2020-10-09 15:21 | 1.2M | |
![[ ]](/icons/pdf.gif) | FW 01 2018.pdf | 2018-05-09 16:38 | 180K | |
![[ ]](/icons/pdf.gif) | FW 03 2018.pdf | 2018-05-09 16:38 | 178K | |
![[ ]](/icons/pdf.gif) | FW 05 2017.pdf | 2017-08-21 14:31 | 256K | |
![[ ]](/icons/pdf.gif) | FW 06 2017.pdf | 2017-08-21 14:31 | 262K | |
![[ ]](/icons/pdf.gif) | FW 07 2017.pdf | 2017-08-21 14:31 | 263K | |
![[ ]](/icons/pdf.gif) | FW 07 2018.pdf | 2018-10-23 14:02 | 183K | |
![[ ]](/icons/pdf.gif) | FW 08 2017.pdf | 2017-10-31 09:44 | 319K | |
![[ ]](/icons/pdf.gif) | FW 08 2018.pdf | 2018-10-23 14:01 | 179K | |
![[ ]](/icons/pdf.gif) | FW 09 2017.pdf | 2017-10-31 09:43 | 316K | |
![[ ]](/icons/pdf.gif) | FW 09 2018.pdf | 2018-10-23 14:02 | 178K | |
![[ ]](/icons/pdf.gif) | FW 10 2017.pdf | 2018-04-16 15:08 | 117K | |
![[ ]](/icons/pdf.gif) | FW 10 2018.pdf | 2019-01-15 17:50 | 122K | |
![[ ]](/icons/pdf.gif) | FW 11 2017.pdf | 2018-04-16 15:08 | 118K | |
![[ ]](/icons/pdf.gif) | FW 11 2018.pdf | 2019-01-15 17:51 | 118K | |
![[ ]](/icons/pdf.gif) | FW 12 2017.pdf | 2018-04-16 15:08 | 117K | |
![[ ]](/icons/pdf.gif) | FW 12 2018.pdf | 2019-01-15 17:51 | 120K | |
![[ ]](/icons/pdf.gif) | FWMP brick form.pdf | 2024-10-17 10:53 | 526K | |
![[ ]](/icons/pdf.gif) | Feb 2019.pdf | 2019-03-18 09:59 | 68K | |
![[ ]](/icons/pdf.gif) | Festival Safety Plan.pdf | 2025-07-18 14:10 | 94K | |
![[ ]](/icons/pdf.gif) | Fin Disb April 2019.pdf | 2019-05-24 16:41 | 13K | |
![[ ]](/icons/pdf.gif) | Fin Disb Aug 2019.pdf | 2019-09-10 17:01 | 67K | |
![[ ]](/icons/pdf.gif) | Fin Disb Dec 2019.pdf | 2020-01-22 12:30 | 18K | |
![[ ]](/icons/pdf.gif) | Fin Disb Jan 2019.pdf | 2019-02-12 11:48 | 14K | |
![[ ]](/icons/pdf.gif) | Fin Disb July 2019.pdf | 2019-08-14 09:55 | 272K | |
![[ ]](/icons/pdf.gif) | Fin Disb June 2019.pdf | 2019-07-18 12:15 | 246K | |
![[ ]](/icons/pdf.gif) | Fin Disb Mar 2019.pdf | 2019-04-03 15:18 | 14K | |
![[ ]](/icons/pdf.gif) | Fin Disb May 2019.pdf | 2019-07-18 12:15 | 205K | |
![[ ]](/icons/unknown.gif) | Fin Disb Nov 2019 | 2019-12-02 15:51 | 15K | |
![[ ]](/icons/pdf.gif) | Fin Disb Nov 2019.pdf | 2019-12-03 15:47 | 186K | |
![[ ]](/icons/pdf.gif) | Fin Disb Oct 2019.pdf | 2019-11-06 16:34 | 16K | |
![[ ]](/icons/pdf.gif) | Fin Disb Sept 2019.pdf | 2019-10-18 10:15 | 68K | |
![[ ]](/icons/pdf.gif) | FinJan23.pdf | 2023-02-13 15:04 | 1.6M | |
![[ ]](/icons/pdf.gif) | FinNov20.pdf | 2020-12-07 09:26 | 1.3M | |
![[ ]](/icons/pdf.gif) | FinOct20.pdf | 2020-11-06 16:01 | 1.7M | |
![[ ]](/icons/pdf.gif) | Finance April 30-20.pdf | 2020-05-07 16:36 | 774K | |
![[ ]](/icons/pdf.gif) | Finance Report.pdf | 2020-04-14 15:00 | 782K | |
![[ ]](/icons/pdf.gif) | FinanceReportJuly20.pdf | 2020-08-07 15:20 | 1.6M | |
![[ ]](/icons/pdf.gif) | Financial-and-Admin-Agenda.pdf | 2016-10-19 12:01 | 1.1M | |
![[ ]](/icons/pdf.gif) | Financial Plan 2021-2025.pdf | 2021-03-11 08:33 | 131K | |
![[ ]](/icons/pdf.gif) | Financial Report for August 2020.pdf | 2020-09-04 14:37 | 1.3M | |
![[ ]](/icons/pdf.gif) | Financial Report for the Period Ending June 30, 2020.pdf | 2020-07-10 15:41 | 9.1M | |
![[ ]](/icons/pdf.gif) | Financial Statements.pdf | 2022-01-27 10:31 | 731K | |
![[ ]](/icons/pdf.gif) | Fire Dept Report.pdf | 2020-04-14 14:59 | 136K | |
![[ ]](/icons/pdf.gif) | Fire Risk Management Officer.pdf | 2016-10-19 13:03 | 173K | |
![[ ]](/icons/pdf.gif) | Fire Risk Officer.pdf | 2022-04-21 10:56 | 97K | |
![[IMG]](/icons/image2.gif) | FireSmart.jpg | 2017-04-13 15:26 | 324K | |
![[ ]](/icons/pdf.gif) | FireSmart Coordinator.pdf | 2024-06-14 14:12 | 134K | |
![[ ]](/icons/pdf.gif) | FireSmart Flyer 2017.pdf | 2017-04-13 15:38 | 233K | |
![[ ]](/icons/pdf.gif) | FireSmart Opportunities.pdf | 2021-06-17 14:54 | 123K | |
![[ ]](/icons/pdf.gif) | FireSmartOpportunity.pdf | 2021-07-13 14:09 | 123K | |
![[ ]](/icons/pdf.gif) | Firesmart.pdf | 2023-05-18 15:53 | 76K | |
![[ ]](/icons/pdf.gif) | Firesmart Summer Employee.pdf | 2025-05-13 09:35 | 111K | |
![[ ]](/icons/pdf.gif) | First Nation Feedback on ToCL OCP.pdf | 2023-10-20 12:19 | 139K | |
![[ ]](/icons/pdf.gif) | Fishery Notice.pdf | 2016-10-19 12:01 | 255K | |
![[ ]](/icons/pdf.gif) | Flood, Greenbelt.pdf | 2020-06-12 15:57 | 647K | |
![[ ]](/icons/pdf.gif) | Flushing.pdf | 2020-03-26 11:42 | 154K | |
![[ ]](/icons/pdf.gif) | Foreman Posting 2020.pdf | 2020-05-11 14:13 | 113K | |
![[ ]](/icons/pdf.gif) | Frisby.pdf | 2020-05-21 14:43 | 343K | |
![[ ]](/icons/pdf.gif) | GC23.pdf | 2023-03-31 16:13 | 41K | |
![[ ]](/icons/pdf.gif) | GFP23-27.pdf | 2023-03-31 16:14 | 57K | |
![[ ]](/icons/pdf.gif) | GMRRG2020.pdf | 2021-05-07 15:19 | 1.5M | |
![[ ]](/icons/pdf.gif) | GRANTS2021.pdf | 2021-05-07 15:18 | 409K | |
![[ ]](/icons/pdf.gif) | GSLOAD.pdf | 2021-05-14 15:53 | 1.3M | |
![[ ]](/icons/pdf.gif) | Garbage and Organic Totes.pdf | 2025-05-09 16:03 | 80K | |
![[ ]](/icons/pdf.gif) | Gardener - Categories 1 2 and 3.pdf | 2026-01-26 14:28 | 202K | |
![[ ]](/icons/pdf.gif) | Gen Fund 2022.pdf | 2022-01-21 11:40 | 679K | |
![[ ]](/icons/pdf.gif) | Gen Fund 2022 Preliminary Budget.pdf | 2022-01-19 14:59 | 703K | |
![[ ]](/icons/pdf.gif) | Gen Fund Budget.pdf | 2023-03-22 14:35 | 96K | |
![[ ]](/icons/pdf.gif) | Gen Fund Financial Plan 2022-2026.pdf | 2022-01-21 11:41 | 1.7M | |
![[ ]](/icons/pdf.gif) | General%20Fund%20Draft%20Budget.pdf | 2024-04-05 17:51 | 3.0M | |
![[ ]](/icons/pdf.gif) | General Fund.pdf | 2021-03-10 15:05 | 623K | |
![[ ]](/icons/pdf.gif) | General Fund2.pdf | 2024-04-09 12:30 | 2.9M | |
![[ ]](/icons/pdf.gif) | General Fund Draft Budget.pdf | 2024-03-28 15:33 | 2.9M | |
![[ ]](/icons/pdf.gif) | GeoScan Closure of Town Road ways.pdf | 2026-03-02 16:23 | 1.3M | |
![[ ]](/icons/pdf.gif) | Gerard.pdf | 2020-10-16 12:18 | 648K | |
![[ ]](/icons/pdf.gif) | Governance Structure.pdf | 2021-12-23 15:52 | 178K | |
![[ ]](/icons/pdf.gif) | Grantapproval.pdf | 2023-02-26 16:55 | 895K | |
![[ ]](/icons/pdf.gif) | Grant in Aid Requests 2024.pdf | 2024-03-28 15:33 | 309K | |
![[ ]](/icons/pdf.gif) | Grants in Aid Guidelines and Application 2012.pdf | 2016-10-19 12:01 | 42K | |
![[ ]](/icons/pdf.gif) | Greendale Notice to Residents.pdf | 2017-11-17 14:15 | 276K | |
![[ ]](/icons/pdf.gif) | GreendaleSewer23.pdf | 2023-09-08 15:24 | 630K | |
![[ ]](/icons/pdf.gif) | Greendalesewer.pdf | 2021-07-12 12:45 | 92K | |
![[ ]](/icons/pdf.gif) | Guiding Principles Plan 2023.pdf | 2023-05-23 11:46 | 147K | |
![[ ]](/icons/pdf.gif) | HNA.pdf | 2021-04-23 15:14 | 284K | |
![[ ]](/icons/pdf.gif) | HNR GIS analysis Town of Lake Cowichan Housing Needs Report Supplementary Analysis.pdf | 2026-02-04 15:43 | 6.8M | |
![[ ]](/icons/pdf.gif) | Habkirk Lake Cowichan Council Orientation Proposal.pdf | 2022-04-08 14:57 | 204K | |
![[ ]](/icons/pdf.gif) | Halltender.pdf | 2021-11-26 14:12 | 681K | |
![[ ]](/icons/pdf.gif) | Health Forward Summit.pdf | 2025-09-12 15:50 | 761K | |
![[ ]](/icons/pdf.gif) | Health Link Campaign.pdf | 2025-12-18 08:55 | 269K | |
![[ ]](/icons/pdf.gif) | Health Link Campaign Continued.pdf | 2025-12-24 09:20 | 228K | |
![[ ]](/icons/pdf.gif) | Health Link Campaign Continued 2026 times.pdf | 2025-12-24 09:20 | 224K | |
![[ ]](/icons/pdf.gif) | Health Minister re Doc Shortage 2025.pdf | 2025-02-21 16:06 | 80K | |
![[ ]](/icons/pdf.gif) | Heritage Sports Wall of Fame Form fillable.pdf | 2016-10-19 12:01 | 142K | |
![[ ]](/icons/pdf.gif) | Housing Accelerator Fund.pdf | 2024-02-26 15:09 | 89K | |
![[ ]](/icons/pdf.gif) | Housing Accelerator Fund Memo for Council.pdf | 2023-07-21 15:26 | 215K | |
![[ ]](/icons/pdf.gif) | Housing Types .pdf | 2023-03-22 10:29 | 73K | |
![[ ]](/icons/pdf.gif) | ICET CSIRAC22-11-25.pdf | 2022-11-18 15:34 | 920K | |
![[ ]](/icons/pdf.gif) | ICET_CSIRAC_June2022_Presentation.pdf | 2022-06-24 14:59 | 3.0M | |
![[ ]](/icons/pdf.gif) | ICIP-HALL.pdf | 2021-06-18 14:46 | 207K | |
![[ ]](/icons/pdf.gif) | ICIP.pdf | 2021-07-09 15:46 | 207K | |
![[ ]](/icons/pdf.gif) | INAUG18-11-06.pdf | 2018-11-02 16:37 | 93K | |
![[ ]](/icons/pdf.gif) | INAUG22-11-01.pdf | 2022-12-23 12:59 | 90K | |
![[ ]](/icons/pdf.gif) | Inaug-14-12-02.pdf | 2016-10-19 12:01 | 59K | |
![[ ]](/icons/pdf.gif) | Inaug-18-11-06.pdf | 2018-11-29 17:29 | 104K | |
![[ ]](/icons/pdf.gif) | Inauguration Mtg of Council 2022.pdf | 2022-10-28 15:21 | 74K | |
![[ ]](/icons/pdf.gif) | Increased lot density.pdf | 2024-04-23 13:00 | 134K | |
![[ ]](/icons/pdf.gif) | Information.pdf | 2022-08-05 10:28 | 114K | |
![[ ]](/icons/pdf.gif) | Inter-Community Business Licence_Nov2013.pdf | 2016-10-19 12:01 | 215K | |
![[ ]](/icons/pdf.gif) | Interim Housing Needs Assessment 2024.pdf | 2024-10-21 15:35 | 848K | |
![[ ]](/icons/pdf.gif) | Internal Post Bylaw Officer 25-03-28.pdf | 2025-03-21 08:53 | 124K | |
![[ ]](/icons/pdf.gif) | Investing in Canada.pdf | 2020-09-11 16:36 | 453K | |
![[ ]](/icons/pdf.gif) | Invitation to Bid Municipal Hall-Geotechnical Work.pdf | 2021-07-26 09:57 | 1.5M | |
![[ ]](/icons/pdf.gif) | Invitation to Tender.pdf | 2017-06-27 09:09 | 15K | |
![[ ]](/icons/pdf.gif) | Island Health.pdf | 2020-03-31 14:55 | 2.0M | |
![[ ]](/icons/pdf.gif) | IslandHealthmedical.pdf | 2021-11-17 16:24 | 113K | |
![[ ]](/icons/pdf.gif) | Jane and Mark Martin.pdf | 2020-04-14 15:00 | 237K | |
![[ ]](/icons/pdf.gif) | Jefferson, Greenbelt.pdf | 2020-06-12 15:56 | 35K | |
![[ ]](/icons/pdf.gif) | July 1 Poster.pdf | 2024-06-13 11:32 | 220K | |
![[ ]](/icons/pdf.gif) | July 1st Celebrations 23.pdf | 2023-05-19 14:37 | 255K | |
![[ ]](/icons/pdf.gif) | July 1st Celebrations 2025 FINAL.pdf | 2025-06-23 10:03 | 126K | |
![[ ]](/icons/pdf.gif) | July 2020 Incident.pdf | 2020-09-04 14:38 | 143K | |
![[ ]](/icons/pdf.gif) | Junior Application Lake Cowichan Fire Department.pdf | 2024-12-02 16:27 | 207K | |
![[ ]](/icons/pdf.gif) | KSMDISPLAY21.pdf | 2021-07-09 15:23 | 458K | |
![[ ]](/icons/pdf.gif) | Kaatzainsurance.pdf | 2021-09-28 10:52 | 253K | |
![[ ]](/icons/pdf.gif) | KinLC.pdf | 2021-11-12 17:10 | 67K | |
![[ ]](/icons/pdf.gif) | Kitchen Staff.pdf | 2021-07-13 18:50 | 52K | |
![[ ]](/icons/pdf.gif) | LC Community Health & Resilience Plan.pdf | 2026-01-16 15:04 | 566K | |
![[ ]](/icons/pdf.gif) | LC Curbside Recycling.pdf | 2016-12-21 09:13 | 89K | |
![[ ]](/icons/pdf.gif) | LCFA2024.pdf | 2024-05-24 16:10 | 1.9M | |
![[ ]](/icons/pdf.gif) | LCOW re Workforce Housing Strategy.pdf | 2024-07-19 16:05 | 13M | |
![[ ]](/icons/pdf.gif) | LCS-SJ12AWARD.pdf | 2021-06-18 14:46 | 37K | |
![[ ]](/icons/pdf.gif) | LD2024BG.pdf | 2024-05-24 16:05 | 254K | |
![[ ]](/icons/pdf.gif) | LETTER _ Partners_Aug 12_2021.pdf | 2021-08-12 17:50 | 484K | |
![[ ]](/icons/pdf.gif) | LGDAP.pdf | 2021-04-23 17:35 | 91K | |
![[ ]](/icons/pdf.gif) | LGLA21.pdf | 2021-01-29 14:15 | 194K | |
![[ ]](/icons/pdf.gif) | LGLA24.pdf | 2023-12-08 15:27 | 111K | |
![[ ]](/icons/pdf.gif) | LGPS-10127 Lake Cowichan Payment Letter Volunteer Fire.pdf | 2024-06-21 16:14 | 68K | |
![[ ]](/icons/pdf.gif) | LGPS-10588 - Lake Cowichan - 2024 FireSmart Community Funding.pdf | 2024-06-21 16:14 | 2.9M | |
![[ ]](/icons/pdf.gif) | LGPS_CEPF_FireDepartment_2025-ProgGuide_2025-30k.pdf | 2025-10-14 11:21 | 525K | |
![[ ]](/icons/pdf.gif) | LGPS_SCS_ProgGuide_2022.pdf | 2022-03-18 15:26 | 274K | |
![[ ]](/icons/pdf.gif) | LG matrix.pdf | 2025-09-15 11:39 | 585K | |
![[ ]](/icons/pdf.gif) | LOSCOVIDGRANT.pdf | 2021-04-23 15:13 | 88K | |
![[ ]](/icons/pdf.gif) | LPDec20.pdf | 2021-01-15 15:14 | 49K | |
![[ ]](/icons/pdf.gif) | Labour Position.pdf | 2025-01-09 14:03 | 124K | |
![[ ]](/icons/pdf.gif) | Labour Position 2019 .pdf | 2019-05-01 08:57 | 128K | |
![[ ]](/icons/pdf.gif) | Labour Position 2020.pdf | 2020-06-11 14:38 | 121K | |
![[ ]](/icons/pdf.gif) | Labour Position 2022.pdf | 2022-06-23 11:38 | 123K | |
![[ ]](/icons/pdf.gif) | Labour Temporary Position 2018.2.pdf | 2018-12-05 12:58 | 129K | |
![[ ]](/icons/pdf.gif) | Labour Temporary Position 2018 .pdf | 2019-05-10 11:36 | 135K | |
![[ ]](/icons/pdf.gif) | Labour Temporary Position 2018.pdf | 2018-08-09 14:00 | 136K | |
![[ ]](/icons/pdf.gif) | Labour Temporary Position 2018 rev.pdf | 2019-05-24 17:31 | 136K | |
![[ ]](/icons/pdf.gif) | Labour Temporary Position 2019 .pdf | 2019-05-10 11:38 | 135K | |
![[ ]](/icons/pdf.gif) | Labour Temporary Position 2019.pdf | 2019-01-07 15:01 | 129K | |
![[ ]](/icons/pdf.gif) | Labour Temporary Position2019.pdf | 2019-07-02 09:55 | 136K | |
![[ ]](/icons/pdf.gif) | Lake-Cowichan-First-Impressions-Assessment.pdf | 2022-12-09 12:38 | 137K | |
![[ ]](/icons/pdf.gif) | LakeCowichan-AP7222-2022PovRed.pdf | 2022-05-20 14:27 | 106K | |
![[ ]](/icons/pdf.gif) | Lake Cowichan - GTF Local Release - July 5, 2016.pdf | 2016-10-19 12:01 | 251K | |
![[ ]](/icons/pdf.gif) | Lake Cowichan - Project0650A117021.pdf | 2020-09-01 15:26 | 141K | |
![[ ]](/icons/pdf.gif) | Lake Cowichan 2026 Tax Insert.pdf | 2026-04-14 12:25 | 8.6M | |
![[ ]](/icons/pdf.gif) | Lake Cowichan ATNP.pdf | 2021-02-05 15:54 | 3.0M | |
![[ ]](/icons/pdf.gif) | Lake Cowichan Active Transportation Network Plan.pdf | 2021-07-29 12:53 | 13M | |
![[ ]](/icons/pdf.gif) | Lake Cowichan CWF 2024-2034 Agreement.pdf | 2024-09-24 11:52 | 140K | |
![[ ]](/icons/pdf.gif) | Lake Cowichan Mockup Package.pdf | 2025-06-06 16:03 | 2.6M | |
![[ ]](/icons/pdf.gif) | Lake Cowichan RCMPLake Cowichan Gazette.pdf | 2020-12-09 13:12 | 310K | |
![[ ]](/icons/pdf.gif) | Lake Cowichan WTP Monthly Report 2020-08.pdf | 2020-09-11 16:00 | 678K | |
![[ ]](/icons/pdf.gif) | Lake Cowichan WTP Monthly Report 2021-08.pdf | 2021-09-17 15:32 | 491K | |
![[ ]](/icons/pdf.gif) | Lake Cowichan WTP Monthly Report 2021-09.pdf | 2021-10-15 15:52 | 431K | |
![[ ]](/icons/pdf.gif) | Lake Cowichan_2017 CARIP.pdf | 2018-06-26 16:18 | 79K | |
![[ ]](/icons/pdf.gif) | Lake Days 2025 Schedule Final.pdf | 2025-05-22 12:16 | 1.7M | |
![[ ]](/icons/pdf.gif) | Lakewood25-07-02.pdf | 2025-07-04 16:30 | 95K | |
![[ ]](/icons/pdf.gif) | Landfill Permit 2026- Fill-Soil.pdf | 2026-04-29 09:45 | 151K | |
![[ ]](/icons/pdf.gif) | Land use notification.pdf | 2024-10-04 15:50 | 272K | |
![[ ]](/icons/pdf.gif) | Lawn and Garden Irrigation Permit.pdf | 2026-05-01 15:14 | 186K | |
![[ ]](/icons/pdf.gif) | Legion.pdf | 2020-10-09 15:21 | 307K | |
![[ ]](/icons/pdf.gif) | Leon Sign for Mildred Child Annex.pdf | 2026-04-14 13:22 | 180K | |
![[ ]](/icons/pdf.gif) | Letter for UBCM Support.pdf | 2021-09-17 15:32 | 90K | |
![[ ]](/icons/pdf.gif) | Letter of Support-CLCSS-Reaching Home TEM.pdf | 2025-12-12 16:17 | 112K | |
![[ ]](/icons/pdf.gif) | Letter re Riparian impacts TLC Town Hall.pdf | 2021-10-22 15:43 | 248K | |
![[ ]](/icons/pdf.gif) | Letter to CVRD - signed - April 26th, 2023.pdf | 2023-05-05 15:41 | 1.4M | |
![[ ]](/icons/pdf.gif) | Liquor License Amendment - Shaker Mill 15-03-12.pdf | 2016-10-19 12:02 | 18K | |
![[ ]](/icons/pdf.gif) | Lk-Cowichan Poster.pdf | 2021-06-11 17:02 | 2.5M | |
![[ ]](/icons/pdf.gif) | LoA.pdf | 2021-07-20 12:48 | 314K | |
![[ ]](/icons/pdf.gif) | Local Authority Emergency Plan.pdf | 2023-05-05 15:41 | 7.8M | |
![[ ]](/icons/pdf.gif) | Local Government Act highlights.pdf | 2025-01-27 16:12 | 129K | |
![[ ]](/icons/pdf.gif) | Local Government Act highlights training for APC.pdf | 2021-02-23 14:31 | 122K | |
![[ ]](/icons/pdf.gif) | Local Government Act training for APC.pdf | 2023-01-23 12:56 | 126K | |
![[ ]](/icons/pdf.gif) | Ltr-Min-Housing-Homes-for-People-Plan.pdf | 2023-05-19 14:37 | 1.2M | |
![[ ]](/icons/pdf.gif) | MAIL IN BALLOT.pdf | 2020-09-14 12:09 | 84K | |
![[ ]](/icons/pdf.gif) | MAYORAPR21.pdf | 2021-05-26 12:49 | 123K | |
![[ ]](/icons/pdf.gif) | MHAUG22.pdf | 2022-09-02 13:42 | 1.0M | |
![[ ]](/icons/pdf.gif) | MHFEB23.pdf | 2023-03-14 14:38 | 87K | |
![[ ]](/icons/pdf.gif) | MHGeo.pdf | 2020-11-06 16:01 | 649K | |
![[ ]](/icons/pdf.gif) | MHJAN23.pdf | 2023-02-10 15:33 | 596K | |
![[ ]](/icons/pdf.gif) | MHMAR23.pdf | 2023-04-06 14:48 | 332K | |
![[ ]](/icons/pdf.gif) | MHNov20.pdf | 2020-12-04 16:02 | 269K | |
![[ ]](/icons/pdf.gif) | MMA21FUND.pdf | 2021-03-19 15:24 | 653K | |
![[ ]](/icons/pdf.gif) | MMBC-Materials-List-Updated.pdf | 2016-10-19 12:02 | 453K | |
![[ ]](/icons/pdf.gif) | MNP2024.pdf | 2025-01-10 15:07 | 14M | |
![[ ]](/icons/pdf.gif) | MNPAUDIT22.pdf | 2022-12-09 12:39 | 5.5M | |
![[ ]](/icons/pdf.gif) | MR 22-11-22.pdf | 2022-12-01 09:54 | 330K | |
![[ ]](/icons/pdf.gif) | MR 22-12-20.pdf | 2022-12-23 12:11 | 232K | |
![[ ]](/icons/pdf.gif) | MR 23-03-28.pdf | 2023-03-30 15:53 | 198K | |
![[ ]](/icons/pdf.gif) | MR 2023-2nd.pdf | 2023-07-17 10:53 | 363K | |
![[ ]](/icons/pdf.gif) | MR 2023-3rd Quarter.pdf | 2023-10-16 14:44 | 251K | |
![[ ]](/icons/pdf.gif) | MR 2023-4th Quarter.pdf | 2023-12-27 12:19 | 198K | |
![[ ]](/icons/pdf.gif) | MR 2024-1st Quarter.pdf | 2024-03-28 15:40 | 248K | |
![[ ]](/icons/pdf.gif) | MR 2024-2nd Quarter.pdf | 2024-07-19 12:42 | 236K | |
![[ ]](/icons/pdf.gif) | MR 2024-3rd Quarter.pdf | 2024-10-29 10:52 | 322K | |
![[ ]](/icons/pdf.gif) | MR 2024-4th Quarter.pdf | 2024-12-20 11:21 | 376K | |
![[ ]](/icons/pdf.gif) | MR 2025-1st Quarter.pdf | 2025-04-03 16:29 | 212K | |
![[ ]](/icons/pdf.gif) | MR 2025-3rd Quarter.pdf | 2026-01-08 11:45 | 181K | |
![[ ]](/icons/pdf.gif) | MR 2025-4th Quarter.pdf | 2026-01-08 11:45 | 182K | |
![[ ]](/icons/pdf.gif) | MacFarlane,Greenbelt .pdf | 2020-06-12 15:57 | 29K | |
![[ ]](/icons/pdf.gif) | Mail voting.pdf | 2020-10-06 10:58 | 157K | |
![[ ]](/icons/pdf.gif) | Manager of Tourism and Business Development.pdf | 2026-03-02 12:51 | 208K | |
![[ ]](/icons/pdf.gif) | Maps_1_2_3_4_6_7_Oct24.pdf | 2018-11-01 17:12 | 19M | |
![[ ]](/icons/pdf.gif) | Maps_Jan22.pdf | 2019-02-25 12:07 | 12M | |
![[ ]](/icons/pdf.gif) | Maternity Clinic - New Location.pdf | 2020-03-29 09:53 | 125K | |
![[ ]](/icons/pdf.gif) | Mayor' Resignation.pdf | 2020-07-30 11:08 | 49K | |
![[ ]](/icons/pdf.gif) | Mayor's Resignation.pdf | 2020-07-30 09:53 | 62K | |
![[ ]](/icons/pdf.gif) | Mayor's Update.pdf | 2020-04-05 17:58 | 109K | |
![[ ]](/icons/pdf.gif) | Mayor November.pdf | 2020-11-25 08:59 | 157K | |
![[ ]](/icons/pdf.gif) | Mayor Report - April-22.pdf | 2022-05-02 15:53 | 224K | |
![[ ]](/icons/pdf.gif) | Mayor Report - Dec21.pdf | 2021-12-23 09:09 | 229K | |
![[ ]](/icons/pdf.gif) | Mayor Report - Feb22.pdf | 2022-03-01 16:27 | 209K | |
![[ ]](/icons/pdf.gif) | Mayor Report - Jan22.pdf | 2022-01-27 10:31 | 239K | |
![[ ]](/icons/pdf.gif) | Mayor Report - July21.pdf | 2021-09-03 16:37 | 165K | |
![[ ]](/icons/pdf.gif) | Mayor Report - July22.pdf | 2022-07-29 13:29 | 186K | |
![[ ]](/icons/pdf.gif) | Mayor Report - Jun22.pdf | 2022-07-15 08:33 | 237K | |
![[ ]](/icons/pdf.gif) | Mayor Report - June21.pdf | 2021-09-03 16:38 | 120K | |
![[ ]](/icons/pdf.gif) | Mayor Report - May.pdf | 2021-06-02 14:05 | 127K | |
![[ ]](/icons/pdf.gif) | Mayor Report - Nov21.pdf | 2021-12-23 09:09 | 227K | |
![[ ]](/icons/pdf.gif) | Mayor Report - Oct22.pdf | 2022-10-26 16:03 | 206K | |
![[ ]](/icons/pdf.gif) | Mayor Report - Sept22.pdf | 2022-10-05 16:30 | 213K | |
![[ ]](/icons/pdf.gif) | Mayor Report MAR21.pdf | 2021-05-26 12:52 | 113K | |
![[ ]](/icons/pdf.gif) | MayorReport Mar22.pdf | 2022-04-22 14:15 | 239K | |
![[ ]](/icons/pdf.gif) | Mayor Update 24-05-28.pdf | 2024-07-19 11:23 | 233K | |
![[ ]](/icons/pdf.gif) | Mayor and Council April 11 meetingR.pdf | 2023-04-21 15:13 | 85K | |
![[ ]](/icons/pdf.gif) | Mayor declaration.pdf | 2020-10-28 11:15 | 48K | |
![[ ]](/icons/pdf.gif) | Mayor of Lake Cowichan re COVID-19 (Coranvirus).pdf | 2020-03-16 14:01 | 82K | |
![[ ]](/icons/pdf.gif) | Mayors Report 2016 09.pdf | 2016-11-09 12:02 | 286K | |
![[ ]](/icons/pdf.gif) | Mayors Report April, 2017.pdf | 2017-06-13 14:31 | 374K | |
![[ ]](/icons/pdf.gif) | Mayors Report August 2018.pdf | 2018-09-14 09:04 | 143K | |
![[ ]](/icons/pdf.gif) | Mayors Report December, 2017.pdf | 2018-04-17 09:10 | 139K | |
![[ ]](/icons/pdf.gif) | Mayors Report Jan-2021.pdf | 2021-02-18 16:20 | 120K | |
![[ ]](/icons/pdf.gif) | Mayors Report January, 2018.pdf | 2018-04-20 16:45 | 134K | |
![[ ]](/icons/pdf.gif) | Mayors Report May, 2017.pdf | 2017-06-13 15:16 | 363K | |
![[ ]](/icons/pdf.gif) | Mayors Report November, 2017.pdf | 2018-04-17 08:59 | 152K | |
![[ ]](/icons/pdf.gif) | Mayors Report October, 2017.pdf | 2017-12-11 15:20 | 334K | |
![[ ]](/icons/pdf.gif) | Mayors Report October, 2018.pdf | 2018-11-22 13:08 | 123K | |
![[ ]](/icons/pdf.gif) | Mayors Report September, 2017.pdf | 2017-12-11 15:18 | 342K | |
![[ ]](/icons/pdf.gif) | Mayors Report September, 2018.pdf | 2018-11-22 13:08 | 157K | |
![[ ]](/icons/pdf.gif) | Measuringprogress.pdf | 2023-01-23 12:56 | 4.8M | |
![[ ]](/icons/pdf.gif) | Mechanic Position 2024.pdf | 2024-03-15 09:55 | 176K | |
![[ ]](/icons/pdf.gif) | MediaAdvisory_ Will Cole-Hamilton_ Jan 23 2020 speaker night fnl.pdf | 2020-01-07 12:07 | 838K | |
![[ ]](/icons/pdf.gif) | Media Policy.pdf | 2022-05-09 14:26 | 136K | |
![[ ]](/icons/pdf.gif) | Media Release.pdf | 2020-07-27 17:14 | 85K | |
![[ ]](/icons/pdf.gif) | Meeting Schedule Notice 2019.pdf | 2019-01-09 13:55 | 64K | |
![[ ]](/icons/pdf.gif) | Meeting Schedule Notice 2020.pdf | 2020-02-07 11:36 | 89K | |
![[ ]](/icons/pdf.gif) | Meeting Schedule Notice 2024.pdf | 2023-12-21 14:27 | 64K | |
![[ ]](/icons/pdf.gif) | Meetings and Bylaw process.pdf | 2020-03-27 08:53 | 261K | |
![[ ]](/icons/pdf.gif) | Memo OCPamendAgriculture.pdf | 2021-11-22 13:59 | 188K | |
![[ ]](/icons/pdf.gif) | Memo Zoning Bylaw.pdf | 2021-09-24 15:53 | 188K | |
![[ ]](/icons/pdf.gif) | Memosignbylaw.pdf | 2021-06-22 09:57 | 467K | |
![[ ]](/icons/pdf.gif) | Memo to APC Climate.pdf | 2022-01-24 11:33 | 271K | |
![[ ]](/icons/pdf.gif) | Memo to APC parks.pdf | 2022-01-24 11:33 | 751K | |
![[ ]](/icons/pdf.gif) | Memo to APC regarding HNA Data Report for Lake Cowichan.pdf | 2021-02-23 14:31 | 194K | |
![[ ]](/icons/pdf.gif) | Memo to APC short term rentals.pdf | 2022-03-21 16:29 | 156K | |
![[ ]](/icons/pdf.gif) | Memo to CAO re Mural Policy.pdf | 2024-09-06 15:12 | 549K | |
![[ ]](/icons/pdf.gif) | Memo to CAO updating subdivision works and services bylaw.pdf | 2023-01-06 15:01 | 176K | |
![[ ]](/icons/pdf.gif) | Memo updating subdivision and sign bylaws.pdf | 2021-03-23 14:33 | 100K | |
![[ ]](/icons/pdf.gif) | Message from the Acting Mayor 20-05-12.pdf | 2020-05-22 10:27 | 407K | |
![[ ]](/icons/pdf.gif) | Message from the Acting Mayor 20-05-14 re WTP.pdf | 2020-05-22 10:20 | 417K | |
![[ ]](/icons/pdf.gif) | Message from the Mayor.pdf | 2020-03-26 11:42 | 101K | |
![[ ]](/icons/pdf.gif) | Message from the Mayor 20-04-08.pdf | 2020-04-09 08:43 | 111K | |
![[ ]](/icons/pdf.gif) | Message from the Mayor 20-04-11.pdf | 2020-04-11 18:48 | 152K | |
![[ ]](/icons/pdf.gif) | Message from the Mayor 20-04-28.pdf | 2020-04-29 15:18 | 133K | |
![[ ]](/icons/pdf.gif) | MinutesCLC.pdf | 2021-11-22 14:27 | 119K | |
![[ ]](/icons/pdf.gif) | MtgFull21.pdf | 2020-12-04 16:02 | 352K | |
![[ ]](/icons/pdf.gif) | MuncipalLandLetter_March 24 20232 (002).pdf | 2023-03-24 15:47 | 75K | |
![[ ]](/icons/pdf.gif) | Munhall.pdf | 2021-01-26 09:34 | 425K | |
![[ ]](/icons/pdf.gif) | Municipal Budget.pdf | 2020-04-14 15:00 | 162K | |
![[ ]](/icons/pdf.gif) | Municipal Hall.pdf | 2020-06-12 15:56 | 375K | |
![[ ]](/icons/pdf.gif) | MunicipalHall.pdf | 2021-10-20 10:30 | 52K | |
![[ ]](/icons/pdf.gif) | MunicipalHallMtg.pdf | 2021-07-09 15:20 | 104K | |
![[ ]](/icons/pdf.gif) | Municipal Hall Update December 2022.pdf | 2023-01-06 15:01 | 65K | |
![[ ]](/icons/pdf.gif) | Municipal Hall Update Novemberr 2022.pdf | 2022-12-09 12:39 | 114K | |
![[ ]](/icons/pdf.gif) | Municipal Hall Upgrade.pdf | 2020-09-04 14:38 | 634K | |
![[ ]](/icons/pdf.gif) | Municipal Hall Upgrades.pdf | 2020-07-10 15:41 | 416K | |
![[ ]](/icons/pdf.gif) | MunicipalHallUpgrades.pdf | 2021-02-05 16:29 | 213K | |
![[ ]](/icons/pdf.gif) | Municipal Spending in Check.pdf | 2016-10-19 12:02 | 905K | |
![[ ]](/icons/pdf.gif) | Municpa; Services Agreement with Ts'uubaa-asatz.pdf | 2020-06-26 16:24 | 532K | |
![[ ]](/icons/pdf.gif) | Mural Permit Application 2025 FILLABLE.pdf | 2025-01-09 09:26 | 206K | |
![[ ]](/icons/pdf.gif) | Mural Policy.pdf | 2024-06-25 10:38 | 560K | |
![[ ]](/icons/pdf.gif) | NOTICE TO RESIDENTS burning.pdf | 2016-10-19 12:02 | 36K | |
![[ ]](/icons/pdf.gif) | NR - BC - GIS - Final Phase of Wastewater Treatment Plant Upgrades - Lake Cowichan - 2023.pdf | 2023-10-20 14:21 | 162K | |
![[ ]](/icons/pdf.gif) | NRFinalUpgrades.pdf | 2023-10-19 11:59 | 162K | |
![[ ]](/icons/pdf.gif) | NTU, pH, UV, Chlorine.pdf | 2020-08-21 20:08 | 1.2M | |
![[ ]](/icons/pdf.gif) | National Day of Mourning 2026.pdf | 2026-04-27 09:03 | 248K | |
![[ ]](/icons/pdf.gif) | News Release - Worlds Largest Hockey Stick Survey.pdf | 2023-06-23 15:03 | 108K | |
![[ ]](/icons/pdf.gif) | News Release_Lake Cowichan New Partner.pdf | 2016-10-19 12:02 | 155K | |
![[ ]](/icons/pdf.gif) | Nickelback25.pdf | 2025-07-18 14:09 | 222K | |
![[ ]](/icons/pdf.gif) | NoM.pdf | 2020-11-06 16:01 | 1.0M | |
![[ ]](/icons/pdf.gif) | Nomination notice.pdf | 2020-08-27 15:19 | 23K | |
![[ ]](/icons/pdf.gif) | Notes.pdf | 2020-09-11 15:14 | 143K | |
![[ ]](/icons/pdf.gif) | Notice - Burning Regulations Clarified CoVid.pdf | 2020-04-16 09:30 | 139K | |
![[ ]](/icons/pdf.gif) | Notice - Open Burning Prohibited CoVid.pdf | 2020-04-08 14:49 | 148K | |
![[ ]](/icons/pdf.gif) | Notice2026-Meeting-Schedule.pdf | 2025-12-22 12:37 | 152K | |
![[ ]](/icons/pdf.gif) | Notice Special Mtg 25-05-06.pdf | 2025-05-01 16:06 | 191K | |
![[ ]](/icons/pdf.gif) | Notice Special Mtg 25-07-08.pdf | 2025-07-04 14:24 | 166K | |
![[ ]](/icons/pdf.gif) | Notice Special Mtg 25-08-19.pdf | 2025-08-15 14:44 | 162K | |
![[ ]](/icons/pdf.gif) | Notice of CW and SPEC meeting time change 26-05-07.pdf | 2026-05-08 12:33 | 233K | |
![[ ]](/icons/pdf.gif) | Notice of Intent Zoning Amend 1104 for REG24-06-25.pdf | 2024-05-09 14:08 | 129K | |
![[ ]](/icons/pdf.gif) | Notice of Nomination.pdf | 2022-08-10 11:38 | 217K | |
![[ ]](/icons/unknown.gif) | Notice of Official Community Plan.docx | 2018-12-17 14:55 | 52K | |
![[ ]](/icons/pdf.gif) | Notice of Official Community Plan.pdf | 2018-12-17 14:59 | 94K | |
![[ ]](/icons/pdf.gif) | Notification_LakeCowichan.pdf | 2023-06-23 15:03 | 187K | |
![[ ]](/icons/pdf.gif) | OCP - working groups.pdf | 2017-11-30 12:51 | 229K | |
![[ ]](/icons/pdf.gif) | OCP 2023 Background Analysis.pdf | 2023-10-26 15:50 | 611K | |
![[ ]](/icons/pdf.gif) | OCP Consolidated.pdf | 2024-03-04 12:46 | 5.6M | |
![[ ]](/icons/pdf.gif) | OCP Open House Transcript of Responses and Comments for distribution.pdf | 2023-10-26 15:50 | 1.1M | |
![[ ]](/icons/pdf.gif) | OCPamend.pdf | 2022-09-21 14:41 | 337K | |
![[ ]](/icons/pdf.gif) | OCP amendment to support agriculture.pdf | 2021-12-17 15:25 | 165K | |
![[ ]](/icons/pdf.gif) | OCP for APC approval.pdf | 2024-01-22 09:13 | 5.8M | |
![[ ]](/icons/pdf.gif) | OCP for council approval.pdf | 2024-03-13 09:22 | 5.5M | |
![[ ]](/icons/pdf.gif) | OCP redux.pdf | 2024-01-22 09:13 | 697K | |
![[ ]](/icons/pdf.gif) | OHOCSURVEY23.pdf | 2023-01-20 14:33 | 438K | |
![[ ]](/icons/pdf.gif) | OHTAKI- student application selection-2009.pdf | 2016-10-19 12:02 | 107K | |
![[ ]](/icons/pdf.gif) | OHTAKI HOMESTAY 2016 fill.pdf | 2016-11-09 15:29 | 606K | |
![[ ]](/icons/pdf.gif) | OHTAKI STUDENT 2017 fillable.pdf | 2017-11-06 15:59 | 281K | |
![[ ]](/icons/pdf.gif) | OHTAKI SUPERVISOR 2016 fillable.pdf | 2016-11-07 16:46 | 191K | |
![[ ]](/icons/pdf.gif) | OHTAKI TEACHER APP.pdf | 2022-01-20 17:08 | 128K | |
![[ ]](/icons/pdf.gif) | OHTAKI_09-18-18.pdf | 2018-09-14 16:20 | 222K | |
![[ ]](/icons/pdf.gif) | OIPC.pdf | 2020-11-09 20:33 | 133K | |
![[ ]](/icons/pdf.gif) | OOCHN Poster_8.5x11-2.pdf | 2023-08-23 11:25 | 2.7M | |
![[ ]](/icons/pdf.gif) | OPRDec20.pdf | 2021-01-15 15:14 | 1.8M | |
![[ ]](/icons/pdf.gif) | OWTonnage.pdf | 2021-01-15 15:13 | 236K | |
![[ ]](/icons/pdf.gif) | Official Results 2018.pdf | 2018-10-20 21:50 | 99K | |
![[ ]](/icons/pdf.gif) | Ohtaki.pdf | 2020-12-04 16:01 | 905K | |
![[ ]](/icons/pdf.gif) | Ohtaki16-10-04.pdf | 2016-10-20 12:07 | 334K | |
![[ ]](/icons/pdf.gif) | Ohtaki17-02-14.pdf | 2017-02-10 17:08 | 358K | |
![[ ]](/icons/pdf.gif) | Ohtaki17-03-07.pdf | 2017-03-03 17:12 | 474K | |
![[ ]](/icons/pdf.gif) | Ohtaki17-04-04.pdf | 2017-04-01 11:22 | 330K | |
![[ ]](/icons/pdf.gif) | Ohtaki17-05-02.pdf | 2017-04-28 16:40 | 377K | |
![[ ]](/icons/pdf.gif) | Ohtaki18-02-06.pdf | 2018-02-03 19:54 | 200K | |
![[ ]](/icons/pdf.gif) | Ohtaki18-05-01.pdf | 2018-04-27 20:46 | 285K | |
![[ ]](/icons/pdf.gif) | Ohtaki18-06-05.pdf | 2018-06-01 17:31 | 212K | |
![[ ]](/icons/pdf.gif) | Ohtaki18-08-07.pdf | 2018-08-05 16:43 | 196K | |
![[ ]](/icons/pdf.gif) | Ohtaki18-09-04.pdf | 2018-09-04 10:43 | 203K | |
![[ ]](/icons/pdf.gif) | Ohtaki18-09-25.pdf | 2018-09-21 17:29 | 222K | |
![[ ]](/icons/pdf.gif) | Ohtaki18-10-02.pdf | 2018-10-02 09:07 | 663K | |
![[ ]](/icons/pdf.gif) | Ohtaki18-10-09.pdf | 2018-10-02 09:05 | 662K | |
![[ ]](/icons/pdf.gif) | Ohtaki19-05-14.pdf | 2019-05-10 16:59 | 214K | |
![[ ]](/icons/pdf.gif) | Ohtaki Delegation logo.pdf | 2024-10-04 15:50 | 45K | |
![[ ]](/icons/pdf.gif) | Ohtaki Select Committee 23.pdf | 2023-01-06 15:01 | 377K | |
![[ ]](/icons/pdf.gif) | Ohtaki TOR 2023.pdf | 2023-01-06 15:01 | 60K | |
![[ ]](/icons/pdf.gif) | Open House Brochure.pdf | 2023-09-14 10:16 | 173K | |
![[ ]](/icons/pdf.gif) | Open House for OCP.pdf | 2023-06-26 11:39 | 129K | |
![[ ]](/icons/pdf.gif) | OperationsPerformanceReport.pdf | 2020-12-11 14:07 | 2.7M | |
![[ ]](/icons/unknown.gif) | Our Health Our Community Survey - Town of Lake Cowichan - December 13, 2022.pptx | 2022-12-09 12:39 | 3.7M | |
![[ ]](/icons/pdf.gif) | Overdose-Advisory-Cowichan 26-01-21.pdf | 2026-01-21 11:24 | 125K | |
![[ ]](/icons/pdf.gif) | OverdoseAdvisoryMarch29.pdf | 2022-03-30 09:18 | 306K | |
![[ ]](/icons/pdf.gif) | OversightCommittee.pdf | 2022-05-06 14:47 | 61K | |
![[ ]](/icons/pdf.gif) | PARCEL_TAX_04-16-19.pdf | 2019-04-12 15:56 | 95K | |
![[ ]](/icons/pdf.gif) | PARKREC-AGENDA-06-07-16.pdf | 2016-10-19 12:02 | 324K | |
![[ ]](/icons/pdf.gif) | PARKS&REC_05-07-16(1).pdf | 2016-10-19 12:02 | 467K | |
![[ ]](/icons/pdf.gif) | PARKS&REC_05-07-16.pdf | 2016-10-19 12:02 | 467K | |
![[ ]](/icons/pdf.gif) | PARKS,-REC.,-CULT-01-03-16.pdf | 2016-10-19 12:02 | 104K | |
![[ ]](/icons/pdf.gif) | PARKSREC-AGENDA-16-05-03.pdf | 2016-10-19 12:03 | 1.1M | |
![[ ]](/icons/pdf.gif) | PARKSREC_AGENDA-04-05-16.pdf | 2016-10-19 12:03 | 1.9M | |
![[ ]](/icons/pdf.gif) | PARKSREC_AGENDA_02-08-16.pdf | 2016-10-19 12:03 | 1.4M | |
![[ ]](/icons/pdf.gif) | PARKS_04-16-19.pdf | 2019-04-12 15:56 | 51K | |
![[ ]](/icons/pdf.gif) | PARKS_AGENDA_06-03-18.pdf | 2018-03-02 15:45 | 314K | |
![[ ]](/icons/pdf.gif) | PARKS_AGENDA_10-07-2018.pdf | 2018-07-06 16:13 | 126K | |
![[ ]](/icons/pdf.gif) | PGSI.pdf | 2020-11-06 16:01 | 306K | |
![[ ]](/icons/pdf.gif) | PH-15-03-24 FULL.pdf | 2016-10-19 12:03 | 235K | |
![[ ]](/icons/pdf.gif) | PH21-03-23.pdf | 2021-03-19 15:24 | 227K | |
![[ ]](/icons/pdf.gif) | PH21-06-22.pdf | 2021-06-21 17:17 | 421K | |
![[ ]](/icons/pdf.gif) | PH21-08-24.pdf | 2021-08-20 11:19 | 340K | |
![[ ]](/icons/pdf.gif) | PH21-09-28.pdf | 2021-09-27 15:47 | 212K | |
![[ ]](/icons/pdf.gif) | PH22-03-22.pdf | 2022-03-18 15:26 | 178K | |
![[ ]](/icons/pdf.gif) | PH22-11-22.pdf | 2022-11-18 15:55 | 273K | |
![[ ]](/icons/pdf.gif) | PH23-03-28.pdf | 2023-03-24 15:48 | 391K | |
![[ ]](/icons/pdf.gif) | PH23-05-23.pdf | 2023-05-19 14:37 | 285K | |
![[ ]](/icons/pdf.gif) | PH24-03-26-1.pdf | 2024-03-22 12:09 | 312K | |
![[ ]](/icons/pdf.gif) | PH24-03-26-2.pdf | 2024-03-22 12:09 | 290K | |
![[ ]](/icons/pdf.gif) | PH24-06-25.pdf | 2024-06-21 16:09 | 306K | |
![[ ]](/icons/pdf.gif) | PH24-09-24.pdf | 2024-09-20 18:26 | 339K | |
![[ ]](/icons/pdf.gif) | PH24-11-26.pdf | 2024-11-22 14:56 | 304K | |
![[ ]](/icons/pdf.gif) | PH AD 23-03-28.pdf | 2023-03-24 15:48 | 149K | |
![[ ]](/icons/pdf.gif) | PH Zoning Bylaw 1055.pdf | 2021-09-17 14:00 | 52K | |
![[ ]](/icons/pdf.gif) | PH for 3 Bylaws 1079-1081.pdf | 2022-11-18 15:35 | 227K | |
![[ ]](/icons/pdf.gif) | PH for 1110.pdf | 2024-11-15 14:35 | 131K | |
![[ ]](/icons/pdf.gif) | PIMAY21.pdf | 2021-05-14 15:54 | 338K | |
![[ ]](/icons/pdf.gif) | PR20-01-21.pdf | 2020-01-17 15:53 | 237K | |
![[ ]](/icons/pdf.gif) | PR20-02-18.pdf | 2020-02-14 16:51 | 594K | |
![[ ]](/icons/pdf.gif) | PR20-03-17.pdf | 2020-03-13 17:14 | 1.4M | |
![[ ]](/icons/pdf.gif) | PR20-07-21.pdf | 2020-07-17 16:32 | 73K | |
![[ ]](/icons/pdf.gif) | PR20-09-15.pdf | 2020-09-14 15:55 | 71K | |
![[ ]](/icons/pdf.gif) | PR20-10-20.pdf | 2020-10-16 15:58 | 70K | |
![[ ]](/icons/pdf.gif) | PR20-11-17.pdf | 2020-11-13 20:24 | 69K | |
![[ ]](/icons/pdf.gif) | PR21-01-19.pdf | 2021-01-15 16:14 | 72K | |
![[ ]](/icons/pdf.gif) | PR21-02-16.pdf | 2021-02-12 16:29 | 73K | |
![[ ]](/icons/pdf.gif) | PR21-03-16.pdf | 2021-03-16 11:16 | 75K | |
![[ ]](/icons/pdf.gif) | PR21-04-20.pdf | 2021-04-20 10:45 | 72K | |
![[ ]](/icons/pdf.gif) | PR21-05-18.pdf | 2021-05-14 15:54 | 73K | |
![[ ]](/icons/pdf.gif) | PR21-06-15.pdf | 2021-06-14 12:01 | 72K | |
![[ ]](/icons/pdf.gif) | PR21-07-20.pdf | 2021-07-20 12:55 | 75K | |
![[ ]](/icons/pdf.gif) | PR21-08-17.pdf | 2021-08-13 15:29 | 72K | |
![[ ]](/icons/pdf.gif) | PR21-09-21.pdf | 2021-09-17 15:55 | 72K | |
![[ ]](/icons/pdf.gif) | PR21-10-19.pdf | 2021-10-15 16:34 | 70K | |
![[ ]](/icons/pdf.gif) | PR21-11-16.pdf | 2021-11-12 17:14 | 70K | |
![[ ]](/icons/pdf.gif) | PR21-12-14.pdf | 2021-12-10 14:33 | 69K | |
![[ ]](/icons/pdf.gif) | PRNOV21.pdf | 2021-12-10 14:33 | 163K | |
![[ ]](/icons/pdf.gif) | PR October 2020.pdf | 2020-11-13 14:15 | 302K | |
![[ ]](/icons/pdf.gif) | PRSept2020.pdf | 2020-10-16 15:47 | 22K | |
![[ ]](/icons/pdf.gif) | PTRP17-04-25.pdf | 2017-04-21 17:09 | 333K | |
![[ ]](/icons/pdf.gif) | PTRP18-04-10.pdf | 2018-04-06 17:00 | 210K | |
![[ ]](/icons/pdf.gif) | PTRP21-04-13.pdf | 2021-04-09 17:45 | 65K | |
![[ ]](/icons/pdf.gif) | PTRP22-04-12.pdf | 2022-04-08 14:57 | 65K | |
![[ ]](/icons/pdf.gif) | PTRP23-04-11.pdf | 2023-04-05 16:29 | 103K | |
![[ ]](/icons/pdf.gif) | PTRRP-20-04-22.pdf | 2021-04-09 17:42 | 74K | |
![[ ]](/icons/pdf.gif) | PTRRP24-04-09.pdf | 2024-04-05 15:35 | 212K | |
![[ ]](/icons/pdf.gif) | PTRRP25-04-08.pdf | 2025-04-04 15:42 | 212K | |
![[ ]](/icons/pdf.gif) | PTRRP26-04-14.pdf | 2026-04-10 16:28 | 342K | |
![[ ]](/icons/pdf.gif) | PUBLIC SERVICE ANNOUNCEMENT.pdf | 2021-01-18 08:46 | 137K | |
![[ ]](/icons/pdf.gif) | PUBLIC_HEARING_01-22-19.pdf | 2019-01-18 17:21 | 914K | |
![[ ]](/icons/pdf.gif) | PUBLIC_HEARING_04-23-19.pdf | 2019-04-18 16:46 | 514K | |
![[ ]](/icons/pdf.gif) | PUBLIC_HEARING_23-08-16.pdf | 2016-10-19 12:03 | 423K | |
![[ ]](/icons/pdf.gif) | PUBLIC_HEARING_28-03-17.pdf | 2017-03-24 16:20 | 1.3M | |
![[ ]](/icons/pdf.gif) | PUBLIC_WORKS_04-16-19.pdf | 2019-04-12 15:56 | 50K | |
![[ ]](/icons/pdf.gif) | PW&E-Agenda-16-05-03.pdf | 2016-10-19 12:04 | 3.8M | |
![[ ]](/icons/pdf.gif) | PW&ENVIR_05-07-16.pdf | 2016-10-19 12:04 | 1.1M | |
![[ ]](/icons/pdf.gif) | PW&ENV_AGENDA-06-07-16.pdf | 2016-10-19 12:04 | 1.6M | |
![[ ]](/icons/pdf.gif) | PW&E_AGENDA-04-05-16.pdf | 2016-10-19 12:04 | 923K | |
![[ ]](/icons/pdf.gif) | PW-&E-AGENDA-01-03-16.pdf | 2016-10-19 12:04 | 2.9M | |
![[ ]](/icons/pdf.gif) | PW-15-12-01-FULL.pdf | 2016-10-19 12:04 | 950K | |
![[ ]](/icons/pdf.gif) | PW-16-02-02-FULL.pdf | 2016-10-19 12:04 | 273K | |
![[ ]](/icons/pdf.gif) | PW20-02-18.pdf | 2020-02-14 16:51 | 563K | |
![[ ]](/icons/pdf.gif) | PW20-03-17.pdf | 2020-03-13 17:14 | 2.0M | |
![[ ]](/icons/pdf.gif) | PW20-07-21.pdf | 2020-07-21 13:06 | 71K | |
![[ ]](/icons/pdf.gif) | PW20-09-15.pdf | 2020-09-11 16:02 | 79K | |
![[ ]](/icons/pdf.gif) | PW20-10-20.pdf | 2020-10-16 15:56 | 72K | |
![[ ]](/icons/pdf.gif) | PW20-11-17.pdf | 2020-11-13 20:24 | 72K | |
![[ ]](/icons/pdf.gif) | PW21-01-19.pdf | 2021-01-15 16:21 | 74K | |
![[ ]](/icons/pdf.gif) | PW21-02-16.pdf | 2021-02-12 16:29 | 72K | |
![[ ]](/icons/pdf.gif) | PW21-03-16.pdf | 2021-03-16 13:04 | 72K | |
![[ ]](/icons/pdf.gif) | PW21-04-20.pdf | 2021-04-19 12:01 | 75K | |
![[ ]](/icons/pdf.gif) | PW21-05-18.pdf | 2021-05-14 15:53 | 80K | |
![[ ]](/icons/pdf.gif) | PW21-06-15.pdf | 2021-06-14 12:01 | 76K | |
![[ ]](/icons/pdf.gif) | PW21-07-20.pdf | 2021-07-16 16:37 | 76K | |
![[ ]](/icons/pdf.gif) | PW21-08-17.pdf | 2021-08-17 10:34 | 77K | |
![[ ]](/icons/pdf.gif) | PW21-09-21.pdf | 2021-09-17 15:52 | 74K | |
![[ ]](/icons/pdf.gif) | PW21-10-19.pdf | 2021-10-18 11:15 | 71K | |
![[ ]](/icons/pdf.gif) | PW21-11-16.pdf | 2021-11-16 10:53 | 71K | |
![[ ]](/icons/pdf.gif) | PW21-12-14.pdf | 2021-12-10 14:39 | 71K | |
![[ ]](/icons/pdf.gif) | PW21-12-14OAKLANE.pdf | 2021-12-10 14:33 | 95K | |
![[ ]](/icons/pdf.gif) | PWCB2021.pdf | 2021-01-15 15:13 | 234K | |
![[ ]](/icons/pdf.gif) | PWDec20.pdf | 2021-01-15 15:56 | 469K | |
![[ ]](/icons/pdf.gif) | PWES16-09-06.pdf | 2016-10-19 12:04 | 1.2M | |
![[ ]](/icons/pdf.gif) | PWES16-10-04.pdf | 2016-10-20 12:07 | 291K | |
![[ ]](/icons/pdf.gif) | PWES16-11-01.pdf | 2016-10-28 16:29 | 277K | |
![[ ]](/icons/pdf.gif) | PWES16-12-06.pdf | 2016-12-02 16:01 | 5.8M | |
![[ ]](/icons/pdf.gif) | PWES17-02-07.pdf | 2017-02-03 17:10 | 511K | |
![[ ]](/icons/pdf.gif) | PWES17-03-07.pdf | 2017-03-03 17:12 | 381K | |
![[ ]](/icons/pdf.gif) | PWES17-04-04.pdf | 2017-04-01 11:22 | 1.7M | |
![[ ]](/icons/pdf.gif) | PWES17-05-02.pdf | 2017-04-28 16:41 | 276K | |
![[ ]](/icons/pdf.gif) | PWES17-06-06.pdf | 2017-06-06 10:24 | 177K | |
![[ ]](/icons/pdf.gif) | PWES17-07-04.pdf | 2017-06-30 16:35 | 648K | |
![[ ]](/icons/pdf.gif) | PWES17-09-05.pdf | 2017-09-04 18:01 | 3.1M | |
![[ ]](/icons/pdf.gif) | PWES17-10-03.pdf | 2017-10-03 11:04 | 262K | |
![[ ]](/icons/pdf.gif) | PWES17-11-07.pdf | 2017-11-03 17:11 | 649K | |
![[ ]](/icons/pdf.gif) | PWES17-12-05.pdf | 2017-12-01 16:37 | 180K | |
![[ ]](/icons/pdf.gif) | PWES18-01-09.pdf | 2018-01-08 08:56 | 320K | |
![[ ]](/icons/pdf.gif) | PWES18-02-06.pdf | 2018-02-03 19:54 | 581K | |
![[ ]](/icons/pdf.gif) | PWES18-04-03.pdf | 2018-03-29 17:34 | 81K | |
![[ ]](/icons/pdf.gif) | PWES18-05-01.pdf | 2018-04-27 21:01 | 81K | |
![[ ]](/icons/pdf.gif) | PWES18-06-05.pdf | 2018-06-01 17:31 | 86K | |
![[ ]](/icons/pdf.gif) | PWES18-08-07.pdf | 2018-08-05 16:43 | 402K | |
![[ ]](/icons/pdf.gif) | PWES18-09-04.pdf | 2018-09-04 10:43 | 333K | |
![[ ]](/icons/pdf.gif) | PWES18-10-02.pdf | 2018-10-02 09:01 | 603K | |
![[ ]](/icons/pdf.gif) | PWES18-12-04.pdf | 2018-11-30 17:01 | 5.5M | |
![[ ]](/icons/pdf.gif) | PWES19-01-15.pdf | 2019-01-13 17:20 | 209K | |
![[ ]](/icons/pdf.gif) | PWES19-02-19.pdf | 2019-02-15 16:47 | 724K | |
![[ ]](/icons/pdf.gif) | PWES19-03-19.pdf | 2019-03-16 00:01 | 2.8M | |
![[ ]](/icons/pdf.gif) | PWES19-05-21 .pdf | 2019-05-18 12:18 | 543K | |
![[ ]](/icons/pdf.gif) | PWES19-06-18.pdf | 2019-06-14 23:59 | 290K | |
![[ ]](/icons/pdf.gif) | PWES19-07-16.pdf | 2019-07-13 12:36 | 202K | |
![[ ]](/icons/pdf.gif) | PWES19-08-20.pdf | 2019-08-16 16:55 | 3.8M | |
![[ ]](/icons/pdf.gif) | PWES19-09-10.pdf | 2019-09-06 16:47 | 238K | |
![[ ]](/icons/pdf.gif) | PWES19-10-15.pdf | 2019-10-11 16:41 | 590K | |
![[ ]](/icons/pdf.gif) | PWES19-11-19.pdf | 2019-11-15 18:35 | 6.6M | |
![[ ]](/icons/pdf.gif) | PWES19-12-10.pdf | 2019-12-07 07:45 | 2.7M | |
![[ ]](/icons/pdf.gif) | PWES20-01-21.pdf | 2020-01-17 15:53 | 670K | |
![[ ]](/icons/pdf.gif) | PWES_10-07-2018.pdf | 2018-07-06 16:13 | 753K | |
![[ ]](/icons/pdf.gif) | PW Memo.pdf | 2025-06-24 12:59 | 39K | |
![[ ]](/icons/pdf.gif) | PWNOV21.pdf | 2021-12-10 14:33 | 274K | |
![[ ]](/icons/pdf.gif) | PW October 20-11-17.pdf | 2020-11-13 14:15 | 535K | |
![[ ]](/icons/pdf.gif) | PWSep23.pdf | 2023-09-08 15:24 | 198K | |
![[ ]](/icons/pdf.gif) | PWSept20-10-20.pdf | 2020-10-16 15:47 | 48K | |
![[ ]](/icons/pdf.gif) | PW_AGENDA_06-03-18.pdf | 2018-03-02 15:45 | 308K | |
![[ ]](/icons/pdf.gif) | PW memo.pdf | 2025-06-24 13:02 | 39K | |
![[ ]](/icons/pdf.gif) | PWorks.pdf | 2022-12-09 12:39 | 318K | |
![[ ]](/icons/pdf.gif) | PWorks20-12-15.pdf | 2020-12-11 15:04 | 72K | |
![[ ]](/icons/pdf.gif) | PWreportnov20.pdf | 2020-12-11 14:08 | 894K | |
![[ ]](/icons/pdf.gif) | PWs.pdf | 2021-11-12 14:53 | 580K | |
![[ ]](/icons/pdf.gif) | Parcel Taxes 2025.pdf | 2025-04-03 08:34 | 110K | |
![[ ]](/icons/pdf.gif) | Parking Dominates Our Cities.pdf | 2023-05-23 11:46 | 1.6M | |
![[ ]](/icons/pdf.gif) | Parks.pdf | 2021-11-12 14:53 | 422K | |
![[ ]](/icons/pdf.gif) | Parks20-12-15.pdf | 2020-12-11 14:49 | 71K | |
![[ ]](/icons/pdf.gif) | ParksDec20.pdf | 2021-01-15 15:31 | 229K | |
![[ ]](/icons/pdf.gif) | ParksPlaygrounds.pdf | 2020-03-26 11:42 | 292K | |
![[ ]](/icons/pdf.gif) | Parks Position 2018.pdf | 2018-04-06 16:38 | 157K | |
![[ ]](/icons/pdf.gif) | ParksReportNov20.pdf | 2020-12-11 14:07 | 400K | |
![[ ]](/icons/pdf.gif) | Parks Temporary Position 2018.pdf | 2018-04-06 15:04 | 158K | |
![[ ]](/icons/pdf.gif) | Parksreport.pdf | 2022-12-09 12:39 | 260K | |
![[ ]](/icons/pdf.gif) | Part III Social Economics.pdf | 2023-04-24 15:30 | 162K | |
![[ ]](/icons/pdf.gif) | Part Time Cashier Receptionist External.pdf | 2023-09-06 16:53 | 80K | |
![[ ]](/icons/pdf.gif) | Partnership agreement.pdf | 2021-12-17 15:25 | 169K | |
![[ ]](/icons/pdf.gif) | Patsula 7bi.pdf | 2020-05-07 16:36 | 3.3M | |
![[ ]](/icons/pdf.gif) | Payroll and Accounts Payable Clerk.pdf | 2026-01-16 15:47 | 177K | |
![[ ]](/icons/pdf.gif) | Permanent Seasonal Parks 2022.pdf | 2022-10-27 16:38 | 125K | |
![[ ]](/icons/pdf.gif) | Permissive Tax Exemption Application.pdf | 2025-09-16 12:13 | 192K | |
![[ ]](/icons/pdf.gif) | Phearing 09012.pdf | 2019-12-07 07:45 | 811K | |
![[ ]](/icons/pdf.gif) | Philip Perras Letter RE Call to support the TenR.pdf | 2025-04-17 15:34 | 75K | |
![[ ]](/icons/pdf.gif) | Pickleball.pdf | 2020-05-21 14:56 | 1.0M | |
![[ ]](/icons/pdf.gif) | Plumbing Inspection Authorization Form town logo.pdf | 2016-10-19 12:03 | 30K | |
![[ ]](/icons/pdf.gif) | Port Moody.pdf | 2020-03-31 14:55 | 3.8M | |
![[IMG]](/icons/image2.gif) | Poster A just Society sm.jpeg | 2019-03-18 14:01 | 114K | |
![[ ]](/icons/pdf.gif) | Prelim Election Results.pdf | 2022-10-15 21:48 | 48K | |
![[ ]](/icons/unknown.gif) | Presentation to Council.pptx | 2021-07-23 15:17 | 5.2M | |
![[ ]](/icons/pdf.gif) | Procedure Bylaw Ad.pdf | 2021-10-15 10:54 | 77K | |
![[ ]](/icons/pdf.gif) | Property Assessments and Taxation by Class.pdf | 2021-03-10 15:05 | 358K | |
![[ ]](/icons/pdf.gif) | Property Owner Review of File and Records.pdf | 2026-03-26 16:26 | 322K | |
![[ ]](/icons/pdf.gif) | Property Tax Revenue.pdf | 2021-03-10 15:05 | 569K | |
![[ ]](/icons/pdf.gif) | Property for Sale-Lakeview.pdf | 2017-04-03 14:42 | 238K | |
![[ ]](/icons/pdf.gif) | Provincial-Housing Agenda.pdf | 2024-11-18 15:16 | 423K | |
![[ ]](/icons/pdf.gif) | Public Consult for Budget Mtg 26-03-05.pdf | 2026-03-02 12:51 | 256K | |
![[ ]](/icons/pdf.gif) | Public Meeting 26-05-04.pdf | 2026-04-29 14:45 | 150K | |
![[ ]](/icons/pdf.gif) | Public Meeting 2025-05-05.pdf | 2025-04-23 16:30 | 134K | |
![[ ]](/icons/pdf.gif) | Public Notice-Trespass on Public Lands.pdf | 2016-10-19 12:03 | 47K | |
![[ ]](/icons/pdf.gif) | PublicW20-10-20.pdf | 2020-10-23 17:15 | 80K | |
![[ ]](/icons/pdf.gif) | PublicWorks.pdf | 2020-08-18 14:14 | 70K | |
![[ ]](/icons/pdf.gif) | Public Works Permit Payment fillable.pdf | 2016-10-19 12:03 | 38K | |
![[ ]](/icons/pdf.gif) | R&S- Capital List.pdf | 2021-10-18 11:15 | 1.5M | |
![[ ]](/icons/pdf.gif) | R3 amends.pdf | 2025-09-15 11:39 | 221K | |
![[ ]](/icons/pdf.gif) | RAR-11SouthShore.pdf | 2024-06-07 11:35 | 1.3M | |
![[ ]](/icons/pdf.gif) | RAR.pdf | 2024-06-25 10:38 | 105K | |
![[ ]](/icons/pdf.gif) | RBStructure.pdf | 2020-12-07 09:34 | 379K | |
![[ ]](/icons/pdf.gif) | RCCFP20.pdf | 2021-06-04 15:18 | 534K | |
![[ ]](/icons/pdf.gif) | RCMAY21.pdf | 2021-05-21 14:35 | 189K | |
![[ ]](/icons/pdf.gif) | REDIP23.pdf | 2023-10-20 14:21 | 191K | |
![[ ]](/icons/pdf.gif) | REG-15-01-27-FULL.pdf | 2016-10-19 12:05 | 2.4M | |
![[ ]](/icons/pdf.gif) | REG-15-03-24 FULL.pdf | 2016-10-19 12:05 | 2.1M | |
![[ ]](/icons/pdf.gif) | REG-15-04-28 FULL.pdf | 2016-10-19 12:05 | 1.7M | |
![[ ]](/icons/pdf.gif) | REG-15-06-23-FULL.pdf | 2016-10-19 12:05 | 2.2M | |
![[ ]](/icons/pdf.gif) | REG-15-09-15-FULL.pdf | 2016-10-19 12:05 | 1.3M | |
![[ ]](/icons/pdf.gif) | REG-16-02-23-FULL.pdf | 2016-10-19 12:05 | 1.9M | |
![[ ]](/icons/pdf.gif) | REG-AGENDA-22-03-16.pdf | 2016-10-19 12:06 | 3.0M | |
![[ ]](/icons/pdf.gif) | REG-AGENDA 22-03-16.pdf | 2016-10-19 12:05 | 3.0M | |
![[ ]](/icons/pdf.gif) | REG-AGENDA24-05-16.pdf | 2016-10-19 12:06 | 4.1M | |
![[ ]](/icons/pdf.gif) | REG-Agenda22-12-15.pdf | 2016-10-19 12:06 | 5.0M | |
![[ ]](/icons/pdf.gif) | REG-May-26-2015.pdf | 2016-10-19 12:07 | 2.4M | |
![[ ]](/icons/pdf.gif) | REG12-01-31.pdf | 2016-10-19 12:07 | 32K | |
![[ ]](/icons/pdf.gif) | REG12-02-28.pdf | 2016-10-19 12:07 | 31K | |
![[ ]](/icons/pdf.gif) | REG12-03-27.pdf | 2016-10-19 12:07 | 31K | |
![[ ]](/icons/pdf.gif) | REG12-04-24.pdf | 2016-10-19 12:07 | 32K | |
![[ ]](/icons/pdf.gif) | REG12-05-22.pdf | 2016-10-19 12:07 | 31K | |
![[ ]](/icons/pdf.gif) | REG12-06-26.pdf | 2016-10-19 12:07 | 32K | |
![[ ]](/icons/pdf.gif) | REG12-07-24.pdf | 2016-10-19 12:07 | 31K | |
![[ ]](/icons/pdf.gif) | REG12-08-28.pdf | 2016-10-19 12:07 | 31K | |
![[ ]](/icons/pdf.gif) | REG12-09-18.pdf | 2016-10-19 12:07 | 31K | |
![[ ]](/icons/pdf.gif) | REG12-10-30.pdf | 2016-10-19 12:07 | 32K | |
![[ ]](/icons/pdf.gif) | REG12-11-27.pdf | 2016-10-19 12:07 | 32K | |
![[ ]](/icons/pdf.gif) | REG12-12-18.pdf | 2016-10-19 12:07 | 390K | |
![[ ]](/icons/pdf.gif) | REG13-01-08.pdf | 2016-10-19 12:07 | 26K | |
![[ ]](/icons/pdf.gif) | REG13-01-22.pdf | 2016-10-19 12:07 | 31K | |
![[ ]](/icons/pdf.gif) | REG13-02-26.pdf | 2016-10-19 12:07 | 31K | |
![[ ]](/icons/pdf.gif) | REG13-03-26.pdf | 2016-10-19 12:07 | 31K | |
![[ ]](/icons/pdf.gif) | REG13-04-23.pdf | 2016-10-19 12:07 | 32K | |
![[ ]](/icons/pdf.gif) | REG13-05-28.pdf | 2016-10-19 12:07 | 32K | |
![[ ]](/icons/pdf.gif) | REG13-06-25.pdf | 2016-10-19 12:07 | 32K | |
![[ ]](/icons/pdf.gif) | REG13-07-12.pdf | 2016-10-19 12:07 | 183K | |
![[ ]](/icons/pdf.gif) | REG13-07-23.pdf | 2016-10-19 12:07 | 31K | |
![[ ]](/icons/pdf.gif) | REG13-08-27 cancelled.pdf | 2016-10-19 12:07 | 195K | |
![[ ]](/icons/pdf.gif) | REG13-09-24.pdf | 2016-10-19 12:07 | 54K | |
![[ ]](/icons/pdf.gif) | REG13-10-22.pdf | 2016-10-19 12:07 | 52K | |
![[ ]](/icons/pdf.gif) | REG13-11-26.pdf | 2016-10-19 12:07 | 53K | |
![[ ]](/icons/pdf.gif) | REG13-12-17.pdf | 2016-10-19 12:07 | 258K | |
![[ ]](/icons/pdf.gif) | REG14-01-28.pdf | 2016-10-19 12:07 | 351K | |
![[ ]](/icons/pdf.gif) | REG14-02-25.pdf | 2016-10-19 12:07 | 353K | |
![[ ]](/icons/pdf.gif) | REG14-03-25.pdf | 2016-10-19 12:07 | 351K | |
![[ ]](/icons/pdf.gif) | REG14-04-22.pdf | 2016-10-19 12:07 | 351K | |
![[ ]](/icons/pdf.gif) | REG14-05-27.pdf | 2016-10-19 12:07 | 344K | |
![[ ]](/icons/pdf.gif) | REG14-06-24.pdf | 2016-10-19 12:07 | 341K | |
![[ ]](/icons/pdf.gif) | REG14-07-22 Amend.pdf | 2016-10-19 12:07 | 341K | |
![[ ]](/icons/pdf.gif) | REG14-08-26.pdf | 2016-10-19 12:07 | 344K | |
![[ ]](/icons/pdf.gif) | REG14-09-16.pdf | 2016-10-19 12:07 | 347K | |
![[ ]](/icons/pdf.gif) | REG14-10-28.pdf | 2016-10-19 12:07 | 348K | |
![[ ]](/icons/pdf.gif) | REG14-11-25.pdf | 2016-10-19 12:07 | 347K | |
![[ ]](/icons/pdf.gif) | REG14-12-23.pdf | 2016-10-19 12:07 | 425K | |
![[ ]](/icons/pdf.gif) | REG15-07-28-FULL.pdf | 2016-10-19 12:07 | 1.2M | |
![[ ]](/icons/pdf.gif) | REG15-08-25-FULL.pdf | 2016-10-19 12:08 | 536K | |
![[ ]](/icons/pdf.gif) | REG15-10-27-FULL.pdf | 2016-10-19 12:08 | 2.5M | |
![[ ]](/icons/pdf.gif) | REG16-01-26-FULL.pdf | 2016-10-19 12:08 | 2.2M | |
![[ ]](/icons/pdf.gif) | REG16-01-26 FULL.pdf | 2016-10-19 12:08 | 2.2M | |
![[ ]](/icons/pdf.gif) | REG16-09-20.pdf | 2016-10-19 12:08 | 5.1M | |
![[ ]](/icons/pdf.gif) | REG16-10-25.pdf | 2016-10-21 16:20 | 4.4M | |
![[ ]](/icons/pdf.gif) | REG16-11-22.pdf | 2016-11-18 16:08 | 6.2M | |
![[ ]](/icons/pdf.gif) | REG16-12-20.pdf | 2017-04-11 11:28 | 6.2M | |
![[ ]](/icons/pdf.gif) | REG17-01-24.pdf | 2017-01-20 19:39 | 2.5M | |
![[ ]](/icons/pdf.gif) | REG17-02-28.pdf | 2017-02-28 16:17 | 3.3M | |
![[ ]](/icons/pdf.gif) | REG17-03-28.pdf | 2017-03-24 16:20 | 3.9M | |
![[ ]](/icons/pdf.gif) | REG17-04-25.pdf | 2017-04-25 20:05 | 1.7M | |
![[ ]](/icons/pdf.gif) | REG17-05-23.pdf | 2017-05-22 18:16 | 3.3M | |
![[ ]](/icons/pdf.gif) | REG17-06-27.pdf | 2017-06-26 11:10 | 2.6M | |
![[ ]](/icons/pdf.gif) | REG17-07-25.pdf | 2017-07-21 17:07 | 2.0M | |
![[ ]](/icons/pdf.gif) | REG17-08-22.pdf | 2017-08-18 16:07 | 5.6M | |
![[ ]](/icons/pdf.gif) | REG17-09-19.pdf | 2017-09-18 17:10 | 3.2M | |
![[ ]](/icons/pdf.gif) | REG17-10-24.pdf | 2017-10-20 16:39 | 6.1M | |
![[ ]](/icons/pdf.gif) | REG17-11-28.pdf | 2017-11-28 15:47 | 2.3M | |
![[ ]](/icons/pdf.gif) | REG17-12-19.pdf | 2017-12-15 16:54 | 3.8M | |
![[ ]](/icons/pdf.gif) | REG18-01-30.pdf | 2018-01-29 12:36 | 6.0M | |
![[ ]](/icons/pdf.gif) | REG18-02-27.pdf | 2018-03-26 15:55 | 2.9M | |
![[ ]](/icons/pdf.gif) | REG18-03-27.pdf | 2018-03-27 20:51 | 2.1M | |
![[ ]](/icons/pdf.gif) | REG18-04-24.pdf | 2018-04-24 08:58 | 2.2M | |
![[ ]](/icons/pdf.gif) | REG18-05-22.pdf | 2018-05-18 17:46 | 2.7M | |
![[ ]](/icons/pdf.gif) | REG18-06-26.pdf | 2018-06-22 16:47 | 6.0M | |
![[ ]](/icons/pdf.gif) | REG18-07-24.pdf | 2018-07-23 16:55 | 3.5M | |
![[ ]](/icons/pdf.gif) | REG18-08-28.pdf | 2018-08-25 14:41 | 5.1M | |
![[ ]](/icons/pdf.gif) | REG18-09-25.pdf | 2018-09-21 17:22 | 3.3M | |
![[ ]](/icons/pdf.gif) | REG18-10-23.pdf | 2018-10-22 14:58 | 6.6M | |
![[ ]](/icons/pdf.gif) | REG18-11-27.pdf | 2018-11-25 17:43 | 5.5M | |
![[ ]](/icons/pdf.gif) | REG18-12-18.pdf | 2018-12-28 12:58 | 2.0M | |
![[ ]](/icons/pdf.gif) | REG19-01-22.pdf | 2019-01-22 12:22 | 5.1M | |
![[ ]](/icons/pdf.gif) | REG19-02-26.pdf | 2019-02-22 16:01 | 1.3M | |
![[ ]](/icons/pdf.gif) | REG19-03-26.pdf | 2019-03-22 17:15 | 1.1M | |
![[ ]](/icons/pdf.gif) | REG19-05-28.pdf | 2019-05-24 16:41 | 1.5M | |
![[ ]](/icons/pdf.gif) | REG19-06-25.pdf | 2019-06-21 16:31 | 1.4M | |
![[ ]](/icons/pdf.gif) | REG19-07-23.pdf | 2019-07-19 16:16 | 1.4M | |
![[ ]](/icons/pdf.gif) | REG19-08-27.pdf | 2019-08-25 21:45 | 2.1M | |
![[ ]](/icons/pdf.gif) | REG19-09-17.pdf | 2019-09-13 16:12 | 1.6M | |
![[ ]](/icons/pdf.gif) | REG19-10-22.pdf | 2019-10-18 16:03 | 1.6M | |
![[ ]](/icons/pdf.gif) | REG19-11-26.pdf | 2019-11-24 17:10 | 4.7M | |
![[ ]](/icons/pdf.gif) | REG19-12-17.pdf | 2019-12-15 17:48 | 6.1M | |
![[ ]](/icons/pdf.gif) | REG20-01-28.pdf | 2020-01-24 15:43 | 1.4M | |
![[ ]](/icons/pdf.gif) | REG20-02-25.pdf | 2020-02-21 15:24 | 1.9M | |
![[ ]](/icons/pdf.gif) | REG20-06-16.pdf | 2020-06-12 16:04 | 105K | |
![[ ]](/icons/pdf.gif) | REG20-06-30.pdf | 2020-06-26 16:43 | 89K | |
![[ ]](/icons/pdf.gif) | REG20-07-28.pdf | 2020-07-30 09:55 | 101K | |
![[ ]](/icons/pdf.gif) | REG20-08-25.pdf | 2020-09-01 15:27 | 100K | |
![[ ]](/icons/pdf.gif) | REG20-09-29.pdf | 2020-09-28 10:19 | 99K | |
![[ ]](/icons/pdf.gif) | REG20-10-27.pdf | 2020-10-23 17:43 | 98K | |
![[ ]](/icons/pdf.gif) | REG20-11-24.pdf | 2020-11-23 10:04 | 100K | |
![[ ]](/icons/pdf.gif) | REG20-12-22.pdf | 2020-12-18 16:12 | 223K | |
![[ ]](/icons/pdf.gif) | REG21-01-26.pdf | 2021-01-26 09:34 | 105K | |
![[ ]](/icons/pdf.gif) | REG21-02-23.pdf | 2021-04-13 14:58 | 109K | |
![[ ]](/icons/pdf.gif) | REG21-03-23.pdf | 2021-03-23 09:21 | 115K | |
![[ ]](/icons/pdf.gif) | REG21-04-27.pdf | 2021-04-23 17:14 | 111K | |
![[ ]](/icons/pdf.gif) | REG21-05-25.pdf | 2021-05-21 14:35 | 101K | |
![[ ]](/icons/pdf.gif) | REG21-06-22.pdf | 2021-06-18 16:20 | 109K | |
![[ ]](/icons/pdf.gif) | REG21-07-27.pdf | 2021-07-23 16:01 | 113K | |
![[ ]](/icons/pdf.gif) | REG21-08-24.pdf | 2021-08-20 14:53 | 115K | |
![[ ]](/icons/pdf.gif) | REG21-09-28.pdf | 2021-09-28 10:54 | 106K | |
![[ ]](/icons/pdf.gif) | REG21-10-26.pdf | 2021-10-22 16:12 | 106K | |
![[ ]](/icons/pdf.gif) | REG21-11-23.pdf | 2021-11-22 14:51 | 109K | |
![[ ]](/icons/pdf.gif) | REG21-12-21.pdf | 2023-01-19 16:05 | 112K | |
![[ ]](/icons/pdf.gif) | REG22-01-25.pdf | 2022-01-21 16:45 | 108K | |
![[ ]](/icons/pdf.gif) | REG22-02-22.pdf | 2022-02-18 15:08 | 111K | |
![[ ]](/icons/pdf.gif) | REG22-03-22.pdf | 2022-03-18 16:13 | 106K | |
![[ ]](/icons/pdf.gif) | REG22-04-26.pdf | 2022-04-27 08:30 | 112K | |
![[ ]](/icons/pdf.gif) | REG22-05-24.pdf | 2022-05-24 15:58 | 103K | |
![[ ]](/icons/pdf.gif) | REG22-06-28.pdf | 2022-06-24 15:33 | 112K | |
![[ ]](/icons/pdf.gif) | REG22-07-26.pdf | 2022-07-27 14:07 | 103K | |
![[ ]](/icons/pdf.gif) | REG22-09-27.pdf | 2022-09-23 16:11 | 101K | |
![[ ]](/icons/pdf.gif) | REG22-10-25.pdf | 2022-10-21 15:28 | 106K | |
![[ ]](/icons/pdf.gif) | REG22-11-22.pdf | 2022-11-18 15:38 | 115K | |
![[ ]](/icons/pdf.gif) | REG22-12-20.pdf | 2022-12-16 14:15 | 173K | |
![[ ]](/icons/pdf.gif) | REG 22.pdf | 2021-12-17 16:06 | 64K | |
![[ ]](/icons/pdf.gif) | REG23-01-24.pdf | 2023-01-20 14:33 | 107K | |
![[ ]](/icons/pdf.gif) | REG23-02-28.pdf | 2023-02-26 16:54 | 267K | |
![[ ]](/icons/pdf.gif) | REG23-03-28.pdf | 2023-03-27 08:26 | 249K | |
![[ ]](/icons/pdf.gif) | REG23-04-25.pdf | 2023-04-25 15:00 | 248K | |
![[ ]](/icons/pdf.gif) | REG23-05-23.pdf | 2023-05-19 14:37 | 234K | |
![[ ]](/icons/pdf.gif) | REG23-06-27.pdf | 2023-06-23 15:03 | 225K | |
![[ ]](/icons/pdf.gif) | REG23-07-25.pdf | 2023-07-21 16:11 | 259K | |
![[ ]](/icons/pdf.gif) | REG23-09-26.pdf | 2023-09-23 17:28 | 262K | |
![[ ]](/icons/pdf.gif) | REG23-10-24.pdf | 2023-10-23 10:50 | 232K | |
![[ ]](/icons/pdf.gif) | REG23-11-28.pdf | 2023-11-24 15:42 | 261K | |
![[ ]](/icons/pdf.gif) | REG23-12-19.pdf | 2023-12-15 14:31 | 297K | |
![[ ]](/icons/pdf.gif) | REG23AD.pdf | 2022-12-16 14:15 | 64K | |
![[ ]](/icons/pdf.gif) | REG24-01-23.pdf | 2024-01-19 16:01 | 257K | |
![[ ]](/icons/pdf.gif) | REG24-02-27.pdf | 2024-02-23 15:37 | 225K | |
![[ ]](/icons/pdf.gif) | REG24-03-26.pdf | 2024-03-22 12:09 | 274K | |
![[ ]](/icons/pdf.gif) | REG24-04-23.pdf | 2024-04-19 14:47 | 219K | |
![[ ]](/icons/pdf.gif) | REG24-05-28.pdf | 2024-05-24 15:53 | 230K | |
![[ ]](/icons/pdf.gif) | REG24-06-25.pdf | 2024-06-21 16:08 | 228K | |
![[ ]](/icons/pdf.gif) | REG24-07-23.pdf | 2024-07-19 14:20 | 246K | |
![[ ]](/icons/pdf.gif) | REG24-09-24.pdf | 2024-09-24 11:52 | 297K | |
![[ ]](/icons/pdf.gif) | REG24-10-22.pdf | 2024-10-18 14:57 | 271K | |
![[ ]](/icons/pdf.gif) | REG24-11-26.pdf | 2024-11-22 14:24 | 255K | |
![[ ]](/icons/pdf.gif) | REG24-12-17.pdf | 2024-12-17 17:58 | 242K | |
![[ ]](/icons/pdf.gif) | REG25-01-28.pdf | 2025-01-24 15:43 | 242K | |
![[ ]](/icons/pdf.gif) | REG25-02-25.pdf | 2025-02-24 14:23 | 245K | |
![[ ]](/icons/pdf.gif) | REG25-03-25.pdf | 2025-03-21 16:13 | 246K | |
![[ ]](/icons/pdf.gif) | REG25-04-22.pdf | 2025-04-17 15:40 | 251K | |
![[ ]](/icons/pdf.gif) | REG25-05-27.pdf | 2025-05-23 13:16 | 243K | |
![[ ]](/icons/pdf.gif) | REG25-06-24.pdf | 2025-06-24 13:00 | 309K | |
![[ ]](/icons/pdf.gif) | REG25-07-22.pdf | 2025-07-18 14:06 | 315K | |
![[ ]](/icons/pdf.gif) | REG25-09-16.pdf | 2025-09-12 16:06 | 314K | |
![[ ]](/icons/pdf.gif) | REG25-10-28.pdf | 2025-12-17 17:11 | 303K | |
![[ ]](/icons/pdf.gif) | REG25-11-25.pdf | 2025-12-17 17:11 | 297K | |
![[ ]](/icons/pdf.gif) | REG25-12-16.pdf | 2025-12-12 16:17 | 319K | |
![[ ]](/icons/unknown.gif) | REG25-12-16 Agenda.docm | 2025-12-12 16:17 | 319K | |
![[ ]](/icons/pdf.gif) | REG26-01-27.pdf | 2026-01-23 16:00 | 303K | |
![[ ]](/icons/pdf.gif) | REG26-02-24.pdf | 2026-02-20 16:31 | 385K | |
![[ ]](/icons/pdf.gif) | REG26-03-24.pdf | 2026-03-20 11:43 | 403K | |
![[ ]](/icons/pdf.gif) | REG26-04-28.pdf | 2026-04-23 16:33 | 401K | |
![[ ]](/icons/pdf.gif) | REG26-05-26.pdf | 2026-05-22 16:22 | 412K | |
![[ ]](/icons/pdf.gif) | REG2024.pdf | 2023-12-15 14:31 | 64K | |
![[ ]](/icons/pdf.gif) | REGULAR-24-11-15.pdf | 2016-10-19 12:09 | 6.2M | |
![[ ]](/icons/pdf.gif) | REGULAR-AGENDA-26-04-16.pdf | 2016-10-19 12:10 | 5.7M | |
![[ ]](/icons/pdf.gif) | REG_AGENDA-28-06-16.pdf | 2016-10-19 12:09 | 3.5M | |
![[ ]](/icons/pdf.gif) | REG_AGENDA_23-04-19.pdf | 2019-04-18 16:46 | 1.9M | |
![[ ]](/icons/pdf.gif) | REG_AGENDA_23-08-16.pdf | 2016-10-19 12:09 | 1.9M | |
![[ ]](/icons/pdf.gif) | REG_AGENDA_26-07-16.pdf | 2016-10-19 12:09 | 3.9M | |
![[ ]](/icons/pdf.gif) | REG_AGENDA_27-02-18.pdf | 2018-02-26 08:45 | 3.0M | |
![[ ]](/icons/pdf.gif) | REQUEST FOR EXPRESSIONS OF INTEREST.pdf | 2022-05-18 11:17 | 76K | |
![[ ]](/icons/pdf.gif) | REQUEST FOR PROPOSALS- Stormwater.pdf | 2024-10-25 15:01 | 124K | |
![[ ]](/icons/pdf.gif) | REQUEST FOR QUOTATION TRAIL REJUVENATION CLEC.pdf | 2026-02-26 11:54 | 148K | |
![[ ]](/icons/pdf.gif) | RFP-Financial Audit 2019-2023.pdf | 2019-09-19 09:47 | 87K | |
![[ ]](/icons/pdf.gif) | RFP-Financial Audit 2024-2028.pdf | 2024-09-19 14:38 | 87K | |
![[ ]](/icons/pdf.gif) | RFP.pdf | 2021-08-31 10:52 | 116K | |
![[ ]](/icons/pdf.gif) | RFP ATNP.pdf | 2020-09-24 13:48 | 81K | |
![[ ]](/icons/pdf.gif) | RFP Community Wildfire Protection Plan Mapping.pdf | 2017-04-12 15:47 | 312K | |
![[ ]](/icons/pdf.gif) | RFP Density Bonus Rental only Zone Evalution.pdf | 2026-02-19 13:55 | 250K | |
![[ ]](/icons/pdf.gif) | RFP Downtown-Parking.pdf | 2024-04-26 14:18 | 651K | |
![[ ]](/icons/pdf.gif) | RFPFUEL.pdf | 2021-01-29 16:19 | 370K | |
![[ ]](/icons/pdf.gif) | RFP Insurance Services 2023 page 1.pdf | 2023-09-13 10:38 | 99K | |
![[ ]](/icons/pdf.gif) | RFP for Active Transportation Plan.pdf | 2020-09-24 13:34 | 145K | |
![[ ]](/icons/pdf.gif) | RFP for Asset Management Plan FINAL.v2.pdf | 2019-09-23 15:43 | 128K | |
![[ ]](/icons/pdf.gif) | RFP for Columbarium.pdf | 2018-04-12 17:06 | 107K | |
![[ ]](/icons/pdf.gif) | RFP for DCC'S.pdf | 2021-06-08 16:20 | 312K | |
![[ ]](/icons/pdf.gif) | RFP for DCC's.pdf | 2021-08-31 10:52 | 196K | |
![[ ]](/icons/pdf.gif) | RFP for Demolition.pdf | 2018-09-11 08:24 | 154K | |
![[ ]](/icons/pdf.gif) | RFP for Demolition of Mildred Child Annex.pdf | 2023-09-01 12:28 | 258K | |
![[ ]](/icons/pdf.gif) | RFP for Fuel Treatment.pdf | 2021-01-18 14:02 | 176K | |
![[ ]](/icons/pdf.gif) | RFP for Recyclables 2023.pdf | 2023-08-18 16:38 | 726K | |
![[ ]](/icons/pdf.gif) | RFP for Residential Demolition.pdf | 2019-07-18 14:58 | 91K | |
![[ ]](/icons/pdf.gif) | RFQ01-2026.pdf | 2026-01-27 15:49 | 157K | |
![[ ]](/icons/pdf.gif) | RFQ01-2026 rev1.pdf | 2026-02-19 13:30 | 146K | |
![[ ]](/icons/pdf.gif) | RFQ Text Centennial(2)dg-26Jan2018.pdf | 2018-01-26 14:06 | 149K | |
![[ ]](/icons/pdf.gif) | RG Memo 2026 Parcel Tax Roll Review Panel.pdf | 2026-04-14 13:22 | 324K | |
![[ ]](/icons/pdf.gif) | RPT to LC-EDC Update.pdf | 2023-02-24 15:56 | 1.7M | |
![[ ]](/icons/pdf.gif) | R S 14-05-06.pdf | 2016-10-19 12:04 | 236K | |
![[ ]](/icons/pdf.gif) | R S 14-10-31.pdf | 2016-10-19 12:04 | 183K | |
![[ ]](/icons/pdf.gif) | Re- CLEC & Lakeview .pdf | 2021-04-20 10:45 | 106K | |
![[ ]](/icons/pdf.gif) | Receptionist and Accounts Receivable Clerk.pdf | 2026-01-16 15:47 | 173K | |
![[ ]](/icons/pdf.gif) | Recyclables RFP.pdf | 2023-08-02 16:31 | 95K | |
![[ ]](/icons/pdf.gif) | Reference.pdf | 2021-07-23 15:17 | 100K | |
![[ ]](/icons/pdf.gif) | Referendum.pdf | 2020-11-02 14:48 | 91K | |
![[ ]](/icons/pdf.gif) | Refurbishment of Signs.pdf | 2020-07-17 14:45 | 1.1M | |
![[ ]](/icons/pdf.gif) | Reg-Feb-24-15.pdf | 2016-10-19 12:06 | 2.5M | |
![[ ]](/icons/pdf.gif) | Reg12-03-06.pdf | 2016-10-19 12:07 | 189K | |
![[ ]](/icons/pdf.gif) | Reg12-04-17.pdf | 2016-10-19 12:07 | 184K | |
![[ ]](/icons/pdf.gif) | Reg12-05-08.pdf | 2016-10-19 12:07 | 191K | |
![[ ]](/icons/pdf.gif) | Reg13-05-07.pdf | 2016-10-19 12:07 | 191K | |
![[ ]](/icons/pdf.gif) | Reg13-06-18.pdf | 2016-10-19 12:07 | 162K | |
![[ ]](/icons/pdf.gif) | Reg14-12-02.pdf | 2016-10-19 12:07 | 186K | |
![[ ]](/icons/pdf.gif) | Reg 15-12-22.pdf | 2016-10-19 12:04 | 134K | |
![[ ]](/icons/pdf.gif) | Reg2021.pdf | 2020-11-20 16:36 | 23K | |
![[ ]](/icons/pdf.gif) | Reg Agenda 19 09 17.pdf | 2017-09-15 16:11 | 3.2M | |
![[ ]](/icons/pdf.gif) | Regional Adaptation Invitation letters May 3 Mayor Tim McGonigle.pdf | 2023-05-19 14:37 | 179K | |
![[ ]](/icons/pdf.gif) | Regional Growth Strategy.pdf | 2025-01-24 15:39 | 217K | |
![[ ]](/icons/pdf.gif) | Regional Housing Needs Assessment RPT Summary Form.pdf | 2021-02-23 21:14 | 1.5M | |
![[ ]](/icons/pdf.gif) | Regular Meeting Schedule for 2025.pdf | 2024-11-20 12:28 | 143K | |
![[ ]](/icons/pdf.gif) | Remembrance Day 2025.pdf | 2025-11-07 13:37 | 186K | |
![[ ]](/icons/pdf.gif) | Removal of Park Dedication-Bylaw 980-2016.pdf | 2016-10-19 12:10 | 265K | |
![[ ]](/icons/pdf.gif) | RentalHousing.pdf | 2021-11-22 13:59 | 1.6M | |
![[ ]](/icons/pdf.gif) | Rental Only Zoning.pdf | 2024-04-23 13:00 | 136K | |
![[ ]](/icons/pdf.gif) | Rental Only Zoning Analysis.pdf | 2024-09-06 15:12 | 1.4M | |
![[ ]](/icons/pdf.gif) | Request for Information 2009.pdf | 2016-10-19 12:10 | 40K | |
![[ ]](/icons/pdf.gif) | Respectful Spaces Bylaw.pdf | 2024-09-20 18:00 | 385K | |
![[ ]](/icons/pdf.gif) | Results - Mayor.pdf | 2020-10-24 23:28 | 111K | |
![[ ]](/icons/pdf.gif) | Revised Land Use Designations.pdf | 2023-04-24 15:30 | 347K | |
![[ ]](/icons/pdf.gif) | River Road Watermain RFP.pdf | 2019-09-24 10:16 | 292K | |
![[ ]](/icons/pdf.gif) | Rivernew.pdf | 2023-04-24 15:30 | 433K | |
![[ ]](/icons/pdf.gif) | Rivers Edge Memorial Garden.pdf | 2020-07-17 15:10 | 458K | |
![[ ]](/icons/pdf.gif) | Road Prioritization.pdf | 2020-07-17 15:59 | 69K | |
![[ ]](/icons/pdf.gif) | Round Table invitation Sep 24.pdf | 2025-09-12 15:51 | 1.3M | |
![[ ]](/icons/pdf.gif) | Running.pdf | 2018-06-29 14:51 | 391K | |
![[ ]](/icons/pdf.gif) | SAANICH-CARIP.pdf | 2021-06-18 14:46 | 1.6M | |
![[ ]](/icons/pdf.gif) | SIGNAGEGUIDE.pdf | 2021-07-20 12:48 | 1.0M | |
![[ ]](/icons/pdf.gif) | SLOOP24.pdf | 2024-03-08 15:19 | 14M | |
![[ ]](/icons/pdf.gif) | SOFI22.pdf | 2023-06-23 15:03 | 2.4M | |
![[ ]](/icons/pdf.gif) | SOFI2021.pdf | 2022-06-24 14:59 | 1.7M | |
![[ ]](/icons/pdf.gif) | SOFI2023.pdf | 2024-06-21 16:08 | 4.3M | |
![[ ]](/icons/pdf.gif) | SOOKETOBC.pdf | 2021-06-04 15:18 | 84K | |
![[ ]](/icons/pdf.gif) | SP02-22.pdf | 2022-02-04 15:29 | 735K | |
![[ ]](/icons/pdf.gif) | SP21-01-12.pdf | 2021-01-08 16:51 | 68K | |
![[ ]](/icons/pdf.gif) | SP21-02-09.pdf | 2021-02-05 16:21 | 70K | |
![[ ]](/icons/pdf.gif) | SP21-03-09.pdf | 2021-03-05 15:27 | 65K | |
![[ ]](/icons/pdf.gif) | SP21-04-13.pdf | 2021-04-13 10:26 | 72K | |
![[ ]](/icons/pdf.gif) | SP21-05-11.pdf | 2021-05-07 15:19 | 70K | |
![[ ]](/icons/pdf.gif) | SP21-06-08.pdf | 2021-06-04 15:18 | 71K | |
![[ ]](/icons/pdf.gif) | SP21-07-13.pdf | 2021-07-09 16:20 | 71K | |
![[ ]](/icons/pdf.gif) | SP21-08-10.pdf | 2021-08-10 10:51 | 70K | |
![[ ]](/icons/pdf.gif) | SP21-09-07.pdf | 2021-09-03 16:02 | 74K | |
![[ ]](/icons/pdf.gif) | SP21-10-12.pdf | 2021-10-12 18:31 | 67K | |
![[ ]](/icons/pdf.gif) | SP21-11-09.pdf | 2021-11-05 15:59 | 69K | |
![[ ]](/icons/pdf.gif) | SP21-12-07.pdf | 2021-12-03 16:19 | 67K | |
![[ ]](/icons/pdf.gif) | SP24-10-01.pdf | 2024-10-04 15:51 | 1.1M | |
![[ ]](/icons/pdf.gif) | SP2021-22.pdf | 2022-01-07 15:18 | 200K | |
![[ ]](/icons/pdf.gif) | SPEC-15-01-13-FULL.pdf | 2016-10-19 12:10 | 1.7M | |
![[ ]](/icons/pdf.gif) | SPEC21-02-02.pdf | 2021-01-29 14:28 | 74K | |
![[ ]](/icons/pdf.gif) | SPEC21-05-11.pdf | 2021-05-07 15:19 | 79K | |
![[ ]](/icons/pdf.gif) | SPEC21-10-12.pdf | 2021-10-12 18:31 | 78K | |
![[ ]](/icons/pdf.gif) | SPEC21-11-30.pdf | 2021-11-26 14:12 | 73K | |
![[ ]](/icons/pdf.gif) | SPEC22-05-10.pdf | 2022-05-10 12:58 | 84K | |
![[ ]](/icons/pdf.gif) | SPEC22-09-06.pdf | 2022-09-02 13:45 | 76K | |
![[ ]](/icons/pdf.gif) | SPEC23-05-09.pdf | 2023-05-05 15:55 | 197K | |
![[ ]](/icons/pdf.gif) | SPEC23-09-12.pdf | 2023-09-08 15:25 | 202K | |
![[ ]](/icons/pdf.gif) | SPEC24-05-14.pdf | 2024-05-10 15:06 | 199K | |
![[ ]](/icons/pdf.gif) | SPEC25-05-06.pdf | 2025-05-01 15:44 | 226K | |
![[ ]](/icons/pdf.gif) | SPEC25-07-08.pdf | 2025-07-04 12:06 | 255K | |
![[ ]](/icons/pdf.gif) | SPEC25-08-19.pdf | 2025-08-15 14:42 | 251K | |
![[ ]](/icons/pdf.gif) | SPEC25-08-21.pdf | 2025-08-15 14:42 | 248K | |
![[ ]](/icons/pdf.gif) | SPEC25-09-09.pdf | 2025-09-05 16:04 | 251K | |
![[ ]](/icons/pdf.gif) | SPEC25-12-23.pdf | 2025-12-19 13:28 | 262K | |
![[ ]](/icons/pdf.gif) | SPEC26-05-12.pdf | 2026-05-08 17:19 | 370K | |
![[ ]](/icons/pdf.gif) | SPEC26-05-12 Agenda.pdf | 2026-05-08 17:13 | 370K | |
![[ ]](/icons/pdf.gif) | SPECIAL-15-05-05 FULL.pdf | 2016-10-19 12:10 | 531K | |
![[ ]](/icons/pdf.gif) | SPECIAL-MEETING-10-05-16.pdf | 2016-10-19 12:10 | 2.9M | |
![[ ]](/icons/pdf.gif) | SPECIAL16-01-05-FULL.pdf | 2016-10-19 12:10 | 585K | |
![[ ]](/icons/pdf.gif) | SPECIAL16-01-05 FULL.pdf | 2016-10-19 12:10 | 585K | |
![[ ]](/icons/pdf.gif) | SPECIAL20-02-04 .pdf | 2020-01-31 15:22 | 565K | |
![[ ]](/icons/pdf.gif) | SPECIAL20-02-04.pdf | 2020-01-31 15:28 | 565K | |
![[ ]](/icons/pdf.gif) | SPECIAL MEETING_06-03-18.pdf | 2018-03-02 15:45 | 503K | |
![[ ]](/icons/pdf.gif) | SPQ2021 Fillable.pdf | 2021-02-03 12:36 | 128K | |
![[ ]](/icons/pdf.gif) | SP and Budget meeting 25-03-28.pdf | 2025-03-25 18:04 | 85K | |
![[ ]](/icons/pdf.gif) | SRDP24-01.pdf | 2024-02-23 15:00 | 846K | |
![[ ]](/icons/pdf.gif) | SRTUP24-02-27.pdf | 2024-02-23 15:02 | 119K | |
![[ ]](/icons/pdf.gif) | STP Slope - RFP.pdf | 2019-10-11 15:38 | 676K | |
![[ ]](/icons/pdf.gif) | SW23.pdf | 2023-03-31 16:14 | 239K | |
![[ ]](/icons/pdf.gif) | SWFP23-27.pdf | 2023-03-31 16:14 | 368K | |
![[ ]](/icons/pdf.gif) | Safespaces.pdf | 2023-11-14 14:14 | 715K | |
![[ ]](/icons/pdf.gif) | Sahtlam.pdf | 2020-09-11 15:58 | 81K | |
![[ ]](/icons/pdf.gif) | Save the Date.pdf | 2023-08-17 16:09 | 206K | |
![[ ]](/icons/pdf.gif) | Seasonal Parks Position.pdf | 2022-02-09 17:11 | 125K | |
![[ ]](/icons/pdf.gif) | Seasonal Parks Position 2019.pdf | 2019-08-29 10:07 | 129K | |
![[ ]](/icons/pdf.gif) | Seasonal Parks Position 2019 rev.pdf | 2019-02-28 08:46 | 130K | |
![[ ]](/icons/pdf.gif) | Seasonal Parks Position 2020.pdf | 2020-01-15 09:40 | 130K | |
![[ ]](/icons/pdf.gif) | Security 2020.pdf | 2020-06-15 14:15 | 81K | |
![[ ]](/icons/pdf.gif) | Senior Care Membership.pdf | 2017-07-31 11:21 | 235K | |
![[ ]](/icons/pdf.gif) | September building.pdf | 2020-10-09 15:21 | 40K | |
![[ ]](/icons/pdf.gif) | SewageSlopeRepair_TenderPackage_Comb20200203.pdf | 2020-02-05 16:19 | 5.2M | |
![[ ]](/icons/pdf.gif) | Sewer%20Fund%20Draft%20Budget.pdf | 2024-04-05 17:50 | 672K | |
![[ ]](/icons/pdf.gif) | Sewer & Water Fin Plan 2022-2026 Options 1 and 2.pdf | 2022-01-21 11:41 | 1.2M | |
![[ ]](/icons/pdf.gif) | Sewer Fund.pdf | 2021-03-10 15:05 | 74K | |
![[ ]](/icons/pdf.gif) | Sewer Fund1.pdf | 2024-04-05 18:05 | 672K | |
![[ ]](/icons/pdf.gif) | Sewer Fund Draft Budget.pdf | 2024-03-28 15:33 | 660K | |
![[ ]](/icons/pdf.gif) | SewerGreendale.pdf | 2021-11-16 11:16 | 1.2M | |
![[ ]](/icons/pdf.gif) | Short term Rentals.pdf | 2025-01-27 16:12 | 213K | |
![[ ]](/icons/pdf.gif) | SignAuthority.pdf | 2020-11-20 16:34 | 276K | |
![[ ]](/icons/pdf.gif) | Sign application 2017 Fillable.pdf | 2017-11-06 14:41 | 436K | |
![[ ]](/icons/pdf.gif) | Sign application 2023 FILLABLE.pdf | 2023-07-28 15:29 | 193K | |
![[ ]](/icons/pdf.gif) | Sign application 2024 Fillable.pdf | 2024-05-01 15:04 | 195K | |
![[ ]](/icons/pdf.gif) | Siren.pdf | 2022-06-24 14:59 | 93K | |
![[ ]](/icons/pdf.gif) | Siren Complaint.pdf | 2022-05-20 14:28 | 947K | |
![[ ]](/icons/pdf.gif) | Slide Deck for Airshed Roundtable.pdf | 2024-03-26 08:22 | 4.9M | |
![[ ]](/icons/pdf.gif) | Sock Rocket Custom Sock Info Pack 2025.pdf | 2025-06-06 16:02 | 383K | |
![[ ]](/icons/pdf.gif) | Sole.pdf | 2020-03-27 08:53 | 106K | |
![[ ]](/icons/pdf.gif) | Special-Meeting-Agenda-Feb-1715.pdf | 2016-10-19 12:10 | 817K | |
![[ ]](/icons/pdf.gif) | Special16-05-30.pdf | 2016-12-21 10:29 | 184K | |
![[ ]](/icons/pdf.gif) | Special17-05-09.pdf | 2017-05-05 16:09 | 925K | |
![[ ]](/icons/pdf.gif) | Special17-05-29.pdf | 2017-07-21 17:07 | 184K | |
![[ ]](/icons/pdf.gif) | Special17-10-10.pdf | 2017-10-06 15:40 | 178K | |
![[ ]](/icons/pdf.gif) | Special17-11-14.pdf | 2017-11-10 16:27 | 1.0M | |
![[ ]](/icons/pdf.gif) | Special18-05-08.pdf | 2018-05-04 17:32 | 1.0M | |
![[ ]](/icons/pdf.gif) | Special18-10-09.pdf | 2018-10-18 12:52 | 217K | |
![[ ]](/icons/pdf.gif) | Special19-05-14.pdf | 2019-05-10 16:59 | 843K | |
![[ ]](/icons/pdf.gif) | Special20-04-01.pdf | 2020-03-31 15:36 | 104K | |
![[ ]](/icons/pdf.gif) | Special20-04-15.pdf | 2020-04-14 14:40 | 90K | |
![[ ]](/icons/pdf.gif) | Special20-04-27.pdf | 2020-04-30 11:01 | 85K | |
![[ ]](/icons/pdf.gif) | Special20-05-08.pdf | 2020-05-07 16:41 | 92K | |
![[ ]](/icons/pdf.gif) | Special20-05-22.pdf | 2020-05-21 15:07 | 182K | |
![[ ]](/icons/pdf.gif) | Special20-08-11.pdf | 2020-08-08 10:12 | 73K | |
![[ ]](/icons/pdf.gif) | Special20-10-13.pdf | 2020-10-09 14:17 | 71K | |
![[ ]](/icons/pdf.gif) | Special20-12-15.pdf | 2020-12-18 14:51 | 73K | |
![[ ]](/icons/pdf.gif) | Sponsorship Request LetterR.pdf | 2025-04-17 15:34 | 204K | |
![[ ]](/icons/pdf.gif) | Staff Report 42 Savoy Road DP 2021-005.pdf | 2021-12-17 16:05 | 263K | |
![[ ]](/icons/pdf.gif) | Staff Report DP05-23.pdf | 2024-01-19 15:02 | 1.0M | |
![[ ]](/icons/pdf.gif) | Staff Report_DP_2020-0004_Point_Ideal_26.6.20.b.pdf | 2020-06-26 16:24 | 599K | |
![[ ]](/icons/pdf.gif) | Staff Report_DVP_2020-0004_Point_Ideal_26.6.20.pdf | 2020-06-26 16:24 | 970K | |
![[ ]](/icons/pdf.gif) | Staff report for DP and DVP 88 Cowichan Lake Road.pdf | 2022-04-22 15:00 | 1.2M | |
![[ ]](/icons/pdf.gif) | Staff report for Development Variance Permit and Development Permit Lot 1 Edgewood Drive.pdf | 2021-11-19 15:46 | 733K | |
![[ ]](/icons/pdf.gif) | Staff report for hardship variance 8 and 12 Prospect Ave.pdf | 2021-10-28 17:46 | 335K | |
![[ ]](/icons/pdf.gif) | Staff report to Council re ADU bylaw.pdf | 2024-05-24 15:53 | 185K | |
![[ ]](/icons/pdf.gif) | StatementofFinancialInformation2019.pdf | 2020-08-07 15:20 | 1.3M | |
![[ ]](/icons/pdf.gif) | Stay cool in Cowichan.pdf | 2024-08-02 16:49 | 3.4M | |
![[ ]](/icons/pdf.gif) | Strata VIS2901manhole.pdf | 2025-05-09 16:03 | 49K | |
![[ ]](/icons/pdf.gif) | Strategic Planning Questionnaire.pdf | 2020-03-13 17:14 | 627K | |
![[ ]](/icons/pdf.gif) | StreetMap.pdf | 2025-10-20 10:38 | 1.9M | |
![[ ]](/icons/pdf.gif) | Street to Stream Event 2025.pdf | 2025-09-04 16:44 | 440K | |
![[ ]](/icons/pdf.gif) | SubdivisionRevisionsNo.3.pdf | 2021-11-22 13:59 | 351K | |
![[ ]](/icons/pdf.gif) | Summary.pdf | 2021-02-26 16:05 | 77K | |
![[ ]](/icons/pdf.gif) | Summary Attachment BR.pdf | 2021-02-23 21:08 | 118K | |
![[ ]](/icons/pdf.gif) | Summary of Cowichan Region Climate Gathering.pdf | 2025-02-21 14:44 | 421K | |
![[ ]](/icons/pdf.gif) | Summer Student - Campground Operations.pdf | 2026-02-25 16:11 | 170K | |
![[ ]](/icons/pdf.gif) | Summer Student - Fire Smart.pdf | 2026-01-28 13:36 | 165K | |
![[ ]](/icons/pdf.gif) | Summer Student - Public Works.pdf | 2026-01-26 14:28 | 170K | |
![[ ]](/icons/pdf.gif) | Summer Students Ad.pdf | 2024-01-15 09:07 | 111K | |
![[ ]](/icons/pdf.gif) | Summer Students Ad 2025.pdf | 2025-03-31 12:30 | 114K | |
![[ ]](/icons/pdf.gif) | Sunscreen CW25-03-11.pdf | 2025-03-07 16:11 | 51K | |
![[ ]](/icons/pdf.gif) | Sunscreen Risks.pdf | 2024-04-05 15:35 | 470K | |
![[ ]](/icons/pdf.gif) | Superintendent Position 2020.pdf | 2020-05-19 15:28 | 142K | |
![[ ]](/icons/pdf.gif) | SuspensionGlassandFoam.pdf | 2021-11-19 10:10 | 127K | |
![[ ]](/icons/pdf.gif) | Synopsis Regional Climate Adaptation.pdf | 2024-02-26 15:09 | 138K | |
![[ ]](/icons/pdf.gif) | TFNAGREE24.pdf | 2024-05-24 15:53 | 1.2M | |
![[ ]](/icons/pdf.gif) | TLC%20APC%20Review.pdf | 2024-03-26 09:06 | 673K | |
![[ ]](/icons/pdf.gif) | TLC APC Review.pdf | 2024-03-26 09:13 | 673K | |
![[ ]](/icons/pdf.gif) | TLC INAUG 22.pdf | 2022-10-28 15:08 | 114K | |
![[ ]](/icons/pdf.gif) | TLC Strategic Plan 2025.pdf | 2025-04-04 15:38 | 422K | |
![[ ]](/icons/pdf.gif) | TSREVIEW.pdf | 2021-06-04 15:51 | 310K | |
![[ ]](/icons/pdf.gif) | TUP26-01 Notice.pdf | 2026-01-08 13:56 | 226K | |
![[ ]](/icons/pdf.gif) | TUP170CLR.pdf | 2020-11-20 16:34 | 822K | |
![[ ]](/icons/pdf.gif) | TUP2025-01.pdf | 2025-04-17 15:34 | 304K | |
![[ ]](/icons/pdf.gif) | TUP2025-01 25-04-24 Notice for REG mtg.pdf | 2025-04-02 10:03 | 227K | |
![[ ]](/icons/pdf.gif) | TUP2025-02 25-04-24 Notice for REG mtg.pdf | 2025-04-02 10:00 | 200K | |
![[ ]](/icons/pdf.gif) | Taxes Newsletter 2024.pdf | 2024-06-26 09:46 | 356K | |
![[ ]](/icons/pdf.gif) | Taxes Newsletter 2025.pdf | 2025-05-02 15:50 | 305K | |
![[ ]](/icons/pdf.gif) | Taxes Newsletter 2026.pdf | 2026-05-22 14:49 | 388K | |
![[ ]](/icons/pdf.gif) | Tax sale notice 2024.pdf | 2024-10-04 08:48 | 75K | |
![[ ]](/icons/pdf.gif) | Tax sale notice 2024 week 1.pdf | 2024-09-24 15:33 | 80K | |
![[ ]](/icons/pdf.gif) | Tax sale notice 2025 Sept 26.pdf | 2025-09-26 16:32 | 156K | |
![[ ]](/icons/pdf.gif) | Tax sale notice 2025 week 1.pdf | 2025-09-17 10:31 | 155K | |
![[ ]](/icons/pdf.gif) | Tax sale notice 2025 week 2.pdf | 2025-09-24 10:12 | 151K | |
![[ ]](/icons/pdf.gif) | TeamBC.pdf | 2021-01-15 15:14 | 475K | |
![[ ]](/icons/pdf.gif) | Terms of reference for OCP 2023.pdf | 2023-01-23 12:57 | 110K | |
![[ ]](/icons/pdf.gif) | Tourism Stakeholder Sessions.pdf | 2021-04-13 10:26 | 115K | |
![[ ]](/icons/pdf.gif) | Town-of-Lake-Cowichan-Inerim-Housing-Needs-Assessment-2024-Council-Review.pdf | 2025-10-31 10:57 | 1.7M | |
![[ ]](/icons/pdf.gif) | Town-of-Lake-Cowichan-Sandhu-Sewer-System-Capacity-Assessment-2026-03-16.pdf | 2026-06-05 14:18 | 400K | |
![[ ]](/icons/pdf.gif) | Town-of-Lake-Cowichan-Uptown-Area-Parking-Study_2025-04-17_Rev-2.pdf | 2026-06-05 14:20 | 2.1M | |
![[ ]](/icons/pdf.gif) | Town-of-Lake-Cowichan-Uptown-Area-Parking Study_2025-04-17_(Rev-2).pdf | 2026-06-05 14:14 | 2.1M | |
![[ ]](/icons/pdf.gif) | Town of Lake Cowichan Audit Service Plan 2023.pdf | 2023-12-08 15:27 | 2.1M | |
![[ ]](/icons/pdf.gif) | Town of Lake Cowichan Housing Needs Report Supplementary Analysis - Draft Report - 2025-12-10.pdf | 2025-12-12 13:48 | 6.8M | |
![[ ]](/icons/pdf.gif) | Town of Lake Cowichan Inerim Housing Needs Assessment 2024.pdf | 2025-02-21 13:29 | 1.7M | |
![[ ]](/icons/pdf.gif) | Town of Lake Cowichan Inerim Housing Needs Assessment 2024 Council Review.pdf | 2024-12-13 15:06 | 1.7M | |
![[ ]](/icons/pdf.gif) | Town of Lake Cowichan Uptown Area Parking Study_2025-04-17_(Rev-2).pdf | 2025-05-09 16:03 | 5.3M | |
![[ ]](/icons/pdf.gif) | Training for APC.pdf | 2021-09-20 15:48 | 127K | |
![[ ]](/icons/pdf.gif) | Truth and Rec acknowledged 2024.pdf | 2024-09-27 09:54 | 160K | |
![[ ]](/icons/pdf.gif) | Twin Aviation Inc.pdf | 2020-03-31 14:55 | 248K | |
![[ ]](/icons/pdf.gif) | UBCM-RCMP.pdf | 2021-02-19 15:15 | 55K | |
![[ ]](/icons/pdf.gif) | UBCM25student.pdf | 2025-07-18 14:10 | 176K | |
![[ ]](/icons/pdf.gif) | UBCM Regional EOC Grant Backgrounder Feb 2022.pdf | 2022-04-22 15:00 | 254K | |
![[ ]](/icons/pdf.gif) | UBCM Regional ESS Grant Backgrounder Jan 2022.pdf | 2022-01-21 15:58 | 100K | |
![[ ]](/icons/pdf.gif) | UBI 2019 POSTER March.pdf | 2019-03-18 14:01 | 322K | |
![[ ]](/icons/pdf.gif) | UB Overage REG23-06-27.pdf | 2023-06-23 15:03 | 1.7M | |
![[ ]](/icons/pdf.gif) | UM-Addendum _7a-HeroldEng-Terraced-Seating-Culvert-21Sep2016.pdf | 2016-10-19 12:11 | 88K | |
![[ ]](/icons/pdf.gif) | UPGRADE OF WASTE SERVICES 2025.pdf | 2025-01-09 09:19 | 129K | |
![[ ]](/icons/pdf.gif) | UnOfficial Results 2018.pdf | 2018-10-21 23:43 | 99K | |
![[ ]](/icons/pdf.gif) | Unfair_Taxation_Benefitting_Railway_and_Industrial_Operations.pdf | 2021-11-19 15:47 | 155K | |
![[ ]](/icons/pdf.gif) | Unsightly Premises Bylaw.pdf | 2020-08-12 00:26 | 336K | |
![[ ]](/icons/pdf.gif) | Update 2.pdf | 2020-04-06 11:53 | 73K | |
![[ ]](/icons/pdf.gif) | Use Agree w BC Transit.pdf | 2022-11-18 15:36 | 931K | |
![[ ]](/icons/pdf.gif) | VIS2901manhole.pdf | 2025-03-07 16:11 | 2.3M | |
![[ ]](/icons/pdf.gif) | VOLUME 1_FINAL_ISMP_Rev0-20150618.pdf | 2020-01-15 15:50 | 25M | |
![[ ]](/icons/pdf.gif) | VOLUME 2_FINAL_ISMP_Rev0-20150618.pdf | 2020-01-15 15:50 | 2.2M | |
![[ ]](/icons/pdf.gif) | Vacant lands for housing.pdf | 2023-04-21 15:13 | 102K | |
![[ ]](/icons/pdf.gif) | VaccineRegister-IslandHealth-POSTER.pdf | 2021-05-14 14:39 | 216K | |
![[ ]](/icons/pdf.gif) | Vehicles for Sale 2023.pdf | 2023-08-21 15:46 | 86K | |
![[ ]](/icons/pdf.gif) | Visitor Centre Ad.pdf | 2025-03-07 16:23 | 64K | |
![[ ]](/icons/pdf.gif) | Visitor Centre Adv.pdf | 2023-02-09 14:14 | 64K | |
![[ ]](/icons/pdf.gif) | Volunteer Fire Fighter Application 2012 fillable.pdf | 2016-10-19 12:11 | 130K | |
![[ ]](/icons/pdf.gif) | Volunteer Fire Fighters Ad.pdf | 2021-09-09 08:31 | 66K | |
![[ ]](/icons/pdf.gif) | Vomacka.pdf | 2020-06-12 15:56 | 283K | |
![[ ]](/icons/pdf.gif) | Voting by Mail.pdf | 2020-09-04 16:19 | 690K | |
![[ ]](/icons/pdf.gif) | W7PPW 20-11-17.pdf | 2020-11-13 14:15 | 374K | |
![[ ]](/icons/pdf.gif) | WEIR21-07-08.pdf | 2021-06-18 14:46 | 270K | |
![[ ]](/icons/pdf.gif) | WHS Companion Document_Case Studies.pdf | 2024-11-08 15:15 | 3.3M | |
![[ ]](/icons/pdf.gif) | WHS Companion Document_Context.pdf | 2024-11-08 15:15 | 3.6M | |
![[ ]](/icons/pdf.gif) | WHS Companion Document_Worker Snapshots.pdf | 2024-11-08 15:16 | 2.3M | |
![[ ]](/icons/pdf.gif) | WILDLIFEBYLAW.pdf | 2022-09-02 13:43 | 884K | |
![[TXT]](/icons/text.gif) | WS_FTP.LOG | 2025-09-08 14:59 | 33K | |
![[ ]](/icons/pdf.gif) | WTDec20.pdf | 2021-01-15 15:32 | 375K | |
![[ ]](/icons/pdf.gif) | WTFeb.pdf | 2021-03-16 13:01 | 372K | |
![[ ]](/icons/pdf.gif) | WTP.pdf | 2021-11-12 14:53 | 1.1M | |
![[ ]](/icons/pdf.gif) | WTPDEC22.pdf | 2022-12-09 12:39 | 389K | |
![[ ]](/icons/pdf.gif) | WTP Invitation to Tender.pdf | 2017-04-28 12:20 | 107K | |
![[ ]](/icons/pdf.gif) | WTPNOV21.pdf | 2021-12-10 14:33 | 820K | |
![[ ]](/icons/pdf.gif) | WTPOperation Oct 2020.pdf | 2020-11-13 14:27 | 6.9M | |
![[ ]](/icons/pdf.gif) | WTPOperationsSept2020.pdf | 2020-10-16 15:47 | 2.9M | |
![[ ]](/icons/pdf.gif) | WTPPW20-10-20.pdf | 2020-10-16 15:47 | 309K | |
![[ ]](/icons/pdf.gif) | WTP and WWTP Operator.pdf | 2025-03-05 12:11 | 67K | |
![[ ]](/icons/pdf.gif) | WWTPdesign.pdf | 2023-11-12 11:47 | 119K | |
![[ ]](/icons/pdf.gif) | Wachsmuth_BC_STR_2024Short term rental report.pdf | 2025-03-20 14:25 | 6.8M | |
![[ ]](/icons/pdf.gif) | Waste Collections.pdf | 2022-12-09 12:39 | 480K | |
![[ ]](/icons/pdf.gif) | Water%20Fund%20Draft%20Budget.pdf | 2024-04-05 17:50 | 689K | |
![[ ]](/icons/pdf.gif) | Water Consumption Report.pdf | 2016-10-19 12:11 | 431K | |
![[ ]](/icons/pdf.gif) | Water Fund.pdf | 2024-04-05 18:03 | 689K | |
![[ ]](/icons/pdf.gif) | Water Fund1.pdf | 2024-04-09 10:14 | 677K | |
![[ ]](/icons/pdf.gif) | Water Fund Draft Budget.pdf | 2024-03-28 15:32 | 669K | |
![[ ]](/icons/pdf.gif) | Water Treatment Plant Update.pdf | 2020-07-21 20:29 | 1.8M | |
![[ ]](/icons/pdf.gif) | WaterTreatmentPlantUpgrades.pdf | 2020-08-14 18:27 | 1.5M | |
![[ ]](/icons/pdf.gif) | WaterTreatmentReport.pdf | 2020-12-11 14:07 | 606K | |
![[ ]](/icons/pdf.gif) | Water and Sewer.pdf | 2022-01-19 14:05 | 811K | |
![[ ]](/icons/pdf.gif) | Watermain River Crossings .pdf | 2018-03-16 12:53 | 388K | |
![[ ]](/icons/pdf.gif) | Watermain upgrades.pdf | 2022-12-09 12:39 | 459K | |
![[ ]](/icons/pdf.gif) | Weatheralert.pdf | 2021-12-24 11:29 | 91K | |
![[ ]](/icons/pdf.gif) | We heard.pdf | 2023-06-26 11:40 | 7.4M | |
![[ ]](/icons/pdf.gif) | WildSafeBC-Cowichan-Valley-Annual-Report-2021.pdf | 2022-05-06 15:01 | 2.5M | |
![[ ]](/icons/pdf.gif) | Wildfire Emergency Response.pdf | 2023-06-11 16:21 | 247K | |
![[ ]](/icons/pdf.gif) | WildfireSmokeHealth.pdf | 2021-07-23 15:17 | 196K | |
![[ ]](/icons/pdf.gif) | Workforce housing strategy notes.pdf | 2023-02-14 10:50 | 2.9M | |
![[ ]](/icons/pdf.gif) | YES2025.pdf | 2025-03-07 16:10 | 9.4M | |
![[ ]](/icons/pdf.gif) | YouthCouncil.pdf | 2021-01-22 15:01 | 27K | |
![[ ]](/icons/pdf.gif) | ZA2025-01.pdf | 2025-08-15 14:20 | 224K | |
![[ ]](/icons/pdf.gif) | ZA2025-02.pdf | 2025-08-15 14:20 | 436K | |
![[ ]](/icons/pdf.gif) | ZA2025-02 134 Cowichan Lake Rd Rd 2025-09-09 staff report.pdf | 2025-09-05 16:02 | 196K | |
![[ ]](/icons/pdf.gif) | Zone 1058 Amends.pdf | 2021-06-04 15:27 | 129K | |
![[ ]](/icons/pdf.gif) | Zoning 1002 Amends - March 6.pdf | 2018-02-16 15:46 | 84K | |
![[ ]](/icons/pdf.gif) | Zoning 1007 Amendment.pdf | 2018-08-10 16:50 | 131K | |
![[ ]](/icons/pdf.gif) | Zoning 1024 Amendment.pdf | 2019-11-25 15:47 | 129K | |
![[ ]](/icons/pdf.gif) | Zoning 1030 and 1033 Amends.pdf | 2020-02-13 15:10 | 239K | |
![[ ]](/icons/pdf.gif) | Zoning Amend 1099PH.pdf | 2024-03-18 14:05 | 152K | |
![[ ]](/icons/pdf.gif) | Zoning Amend Reg26-01-27 1124-2025.pdf | 2026-01-08 11:45 | 182K | |
![[ ]](/icons/pdf.gif) | Zoning Amend SPEC25-08-19.pdf | 2025-08-14 09:35 | 181K | |
![[ ]](/icons/pdf.gif) | Zoning Amend SPEC25-09-09 bylaw 1122.pdf | 2025-08-29 11:40 | 197K | |
![[ ]](/icons/pdf.gif) | Zoning Amendment Bylaw1005-2018.pdf | 2018-06-14 17:02 | 70K | |
![[ ]](/icons/pdf.gif) | Zoning_BL1055-2021_Mapsheet1_ADOPTED.pdf | 2022-06-20 13:45 | 1.9M | |
![[ ]](/icons/pdf.gif) | Zoning_BL1055-2021_Mapsheet2_ADOPTED.pdf | 2022-06-20 13:45 | 2.0M | |
![[ ]](/icons/pdf.gif) | Zoning amendment 163 Neva Road.pdf | 2022-11-18 15:36 | 317K | |
![[ ]](/icons/pdf.gif) | Zoning amendment Lakewood Manor.pdf | 2022-11-18 15:36 | 1.0M | |
![[ ]](/icons/pdf.gif) | accesscommittee.pdf | 2023-02-10 15:33 | 385K | |
![[ ]](/icons/pdf.gif) | add_1_river_xings_wm_2018-04-03.pdf | 2018-04-03 16:26 | 26K | |
![[ ]](/icons/pdf.gif) | add_1_river_xings_wm_rev_2017-11-09.pdf | 2017-11-17 15:22 | 697K | |
![[ ]](/icons/pdf.gif) | add_2_river_xings_wm_2017-11-10.pdf | 2017-11-17 15:22 | 41K | |
![[ ]](/icons/pdf.gif) | adph21-03-23.pdf | 2021-03-19 15:42 | 89K | |
![[ ]](/icons/pdf.gif) | advisoryplanningcommissionappointments.pdf | 2021-01-08 14:47 | 396K | |
![[ ]](/icons/pdf.gif) | aet2025.pdf | 2025-05-23 13:27 | 802K | |
![[ ]](/icons/pdf.gif) | apc2025.pdf | 2025-01-10 15:06 | 495K | |
![[ ]](/icons/pdf.gif) | apcappointment.pdf | 2021-09-03 15:29 | 433K | |
![[ ]](/icons/pdf.gif) | apc db resign.pdf | 2025-10-21 14:31 | 339K | |
![[ ]](/icons/unknown.gif) | applications.php | 2023-01-17 15:53 | 4.7K | |
![[ ]](/icons/pdf.gif) | appointapc22-04-22.pdf | 2022-04-22 15:00 | 225K | |
![[ ]](/icons/pdf.gif) | arbutusstreettender.pdf | 2021-10-08 15:23 | 467K | |
![[ ]](/icons/pdf.gif) | audit financial statements acceptance.pdf | 2022-05-06 14:47 | 485K | |
![[ ]](/icons/pdf.gif) | audit findings 2022.pdf | 2023-04-21 16:21 | 3.5M | |
![[ ]](/icons/pdf.gif) | auditservice24-28.pdf | 2024-11-22 14:24 | 419K | |
![[ ]](/icons/pdf.gif) | avchambers24.pdf | 2024-06-21 16:14 | 89K | |
![[ ]](/icons/pdf.gif) | backyardhens.pdf | 2021-01-08 17:16 | 97K | |
![[ ]](/icons/pdf.gif) | bccf22.pdf | 2022-09-02 13:41 | 473K | |
![[ ]](/icons/pdf.gif) | bchydro.pdf | 2023-01-10 15:19 | 277K | |
![[ ]](/icons/pdf.gif) | beo3q.pdf | 2024-10-04 15:50 | 601K | |
![[ ]](/icons/pdf.gif) | beo4q24.pdf | 2025-02-07 15:35 | 1.7M | |
![[ ]](/icons/pdf.gif) | biapr23.pdf | 2023-05-05 15:40 | 45K | |
![[ ]](/icons/pdf.gif) | biapr24.pdf | 2024-05-10 15:05 | 44K | |
![[ ]](/icons/pdf.gif) | biapr25.pdf | 2025-05-09 16:03 | 52K | |
![[ ]](/icons/pdf.gif) | biapril22.pdf | 2022-05-06 14:47 | 90K | |
![[ ]](/icons/pdf.gif) | biaug22.pdf | 2022-10-07 14:44 | 43K | |
![[ ]](/icons/pdf.gif) | biaug23.pdf | 2023-09-08 15:23 | 46K | |
![[ ]](/icons/pdf.gif) | biaug24.pdf | 2024-09-06 15:14 | 595K | |
![[ ]](/icons/pdf.gif) | biaugust2021.pdf | 2021-09-03 15:29 | 66K | |
![[ ]](/icons/pdf.gif) | bidec21.pdf | 2022-01-07 15:17 | 41K | |
![[ ]](/icons/pdf.gif) | bidec22.pdf | 2023-02-10 15:33 | 42K | |
![[ ]](/icons/pdf.gif) | bidec23.pdf | 2024-02-09 15:47 | 46K | |
![[ ]](/icons/pdf.gif) | bidec24.pdf | 2025-01-10 15:06 | 53K | |
![[ ]](/icons/pdf.gif) | bifeb23.pdf | 2023-03-10 13:05 | 44K | |
![[ ]](/icons/pdf.gif) | bifeb24.pdf | 2024-04-05 15:34 | 46K | |
![[ ]](/icons/pdf.gif) | bifeb25.pdf | 2025-03-07 16:11 | 55K | |
![[ ]](/icons/pdf.gif) | bijan23.pdf | 2023-03-10 13:05 | 43K | |
![[ ]](/icons/pdf.gif) | bijan24.pdf | 2024-03-08 15:17 | 45K | |
![[ ]](/icons/pdf.gif) | bijan25.pdf | 2025-03-07 16:11 | 54K | |
![[ ]](/icons/pdf.gif) | bijul23.pdf | 2023-09-08 15:23 | 47K | |
![[ ]](/icons/pdf.gif) | bijul24.pdf | 2024-09-06 15:13 | 53K | |
![[ ]](/icons/pdf.gif) | bijuly22.pdf | 2022-09-02 13:41 | 41K | |
![[ ]](/icons/pdf.gif) | bijuly2021.pdf | 2021-08-06 15:42 | 66K | |
![[ ]](/icons/pdf.gif) | bijun23.pdf | 2023-07-07 15:30 | 44K | |
![[ ]](/icons/pdf.gif) | bijun24.pdf | 2024-07-05 14:38 | 52K | |
![[ ]](/icons/pdf.gif) | bijun25.pdf | 2025-07-04 16:31 | 55K | |
![[ ]](/icons/pdf.gif) | bijune22.pdf | 2022-07-08 14:33 | 71K | |
![[ ]](/icons/pdf.gif) | bijune2021.pdf | 2021-07-09 15:44 | 77K | |
![[ ]](/icons/pdf.gif) | bimar23.pdf | 2023-04-06 14:47 | 42K | |
![[ ]](/icons/pdf.gif) | bimar24.pdf | 2024-05-10 15:05 | 45K | |
![[ ]](/icons/pdf.gif) | bimar25.pdf | 2025-04-04 15:35 | 52K | |
![[ ]](/icons/pdf.gif) | bimay22.pdf | 2022-07-08 14:34 | 71K | |
![[ ]](/icons/pdf.gif) | bimay23.pdf | 2023-06-09 15:45 | 41K | |
![[ ]](/icons/pdf.gif) | bimay24.pdf | 2024-06-07 11:34 | 52K | |
![[ ]](/icons/pdf.gif) | bimay25.pdf | 2025-06-06 15:58 | 55K | |
![[ ]](/icons/pdf.gif) | binov22.pdf | 2022-12-09 12:38 | 43K | |
![[ ]](/icons/pdf.gif) | binov23.pdf | 2023-12-08 15:26 | 47K | |
![[ ]](/icons/pdf.gif) | binov24.pdf | 2024-12-06 15:24 | 52K | |
![[ ]](/icons/pdf.gif) | bioct22.pdf | 2022-11-18 15:33 | 40K | |
![[ ]](/icons/pdf.gif) | bioct24.pdf | 2024-12-06 15:24 | 54K | |
![[ ]](/icons/pdf.gif) | birnov2021.pdf | 2021-12-03 15:20 | 77K | |
![[ ]](/icons/pdf.gif) | biroct2021.pdf | 2021-11-05 15:58 | 83K | |
![[ ]](/icons/pdf.gif) | bisep23.pdf | 2023-10-06 14:14 | 47K | |
![[ ]](/icons/pdf.gif) | bisep24.pdf | 2024-10-04 15:50 | 53K | |
![[ ]](/icons/pdf.gif) | bisept22.pdf | 2022-11-18 15:34 | 44K | |
![[ ]](/icons/pdf.gif) | bluegrass.pdf | 2021-09-17 15:32 | 508K | |
![[ ]](/icons/pdf.gif) | bov appoint.pdf | 2022-11-18 15:34 | 337K | |
![[ ]](/icons/pdf.gif) | budget26-02-10.pdf | 2026-02-10 15:19 | 265K | |
![[ ]](/icons/pdf.gif) | buildingreportdec.pdf | 2021-01-08 14:50 | 83K | |
![[ ]](/icons/pdf.gif) | buildingreportfeb.pdf | 2021-03-05 15:33 | 73K | |
![[ ]](/icons/pdf.gif) | buildingreportjan.pdf | 2021-02-05 15:34 | 82K | |
![[ ]](/icons/pdf.gif) | buildingreportmarch.pdf | 2021-04-09 15:48 | 80K | |
![[ ]](/icons/pdf.gif) | buspullover.pdf | 2021-04-16 16:21 | 428K | |
![[ ]](/icons/pdf.gif) | bylaw1060-2021.pdf | 2021-07-23 15:16 | 10M | |
![[ ]](/icons/pdf.gif) | bylaw1060.pdf | 2021-08-20 15:33 | 382K | |
![[ ]](/icons/pdf.gif) | bylawamendmentcouncilprocedure.pdf | 2021-10-08 17:09 | 64K | |
![[ ]](/icons/pdf.gif) | bylawaugsept.pdf | 2021-10-08 15:23 | 98K | |
![[ ]](/icons/pdf.gif) | bylawjuly2021.pdf | 2021-08-06 15:42 | 50K | |
![[ ]](/icons/pdf.gif) | bylawjune2021.pdf | 2021-07-09 15:45 | 472K | |
![[ ]](/icons/pdf.gif) | bylawmay2021.pdf | 2021-07-09 15:45 | 492K | |
![[ ]](/icons/pdf.gif) | bylawnov.pdf | 2021-12-03 15:20 | 50K | |
![[ ]](/icons/pdf.gif) | bylawoctober2021.pdf | 2021-11-05 16:30 | 70K | |
![[ ]](/icons/pdf.gif) | bylawofficerreportjan.pdf | 2021-02-05 16:19 | 1.2M | |
![[ ]](/icons/pdf.gif) | canadahealthycommunitiesinitiative.pdf | 2021-02-12 15:19 | 56K | |
![[ ]](/icons/pdf.gif) | cao-wtp22-02-18.pdf | 2022-02-18 15:30 | 532K | |
![[ ]](/icons/pdf.gif) | caoavinfrastructure.pdf | 2024-05-11 11:44 | 146K | |
![[ ]](/icons/pdf.gif) | caomiabcvoting.pdf | 2021-07-23 15:16 | 342K | |
![[ ]](/icons/pdf.gif) | caoprivatesanistation.pdf | 2022-03-04 15:13 | 658K | |
![[ ]](/icons/pdf.gif) | capitalbudget2021.pdf | 2021-01-08 14:47 | 459K | |
![[ ]](/icons/pdf.gif) | cat station request.pdf | 2024-04-05 15:35 | 6.9M | |
![[ ]](/icons/pdf.gif) | census.pdf | 2021-04-23 15:22 | 114K | |
![[ ]](/icons/pdf.gif) | cfs2024.pdf | 2025-05-01 15:39 | 1.4M | |
![[ ]](/icons/pdf.gif) | cha-villageproject.pdf | 2022-02-18 15:09 | 148K | |
![[ ]](/icons/pdf.gif) | chickens.pdf | 2020-10-30 12:30 | 67K | |
![[ ]](/icons/pdf.gif) | claccorrespondence.pdf | 2021-10-15 15:52 | 130K | |
![[ ]](/icons/pdf.gif) | clac gia request 2023.pdf | 2023-04-06 14:48 | 486K | |
![[ ]](/icons/pdf.gif) | claspaintchambers.pdf | 2023-11-24 15:04 | 419K | |
![[ ]](/icons/pdf.gif) | clean-hands-soap-water.pdf | 2020-03-25 15:53 | 1.0M | |
![[ ]](/icons/pdf.gif) | cleanbc_roadmap_2030.pdf | 2022-05-20 17:12 | 9.2M | |
![[ ]](/icons/pdf.gif) | clecaug21.pdf | 2021-09-21 09:30 | 651K | |
![[ ]](/icons/pdf.gif) | clecbp2024.pdf | 2024-03-08 15:36 | 100K | |
![[ ]](/icons/pdf.gif) | clecjul21.pdf | 2021-08-17 10:34 | 426K | |
![[ ]](/icons/pdf.gif) | clecjun21.pdf | 2021-07-16 15:33 | 463K | |
![[ ]](/icons/pdf.gif) | cleclakeviewjan21.pdf | 2021-02-12 16:22 | 584K | |
![[ ]](/icons/pdf.gif) | clecmay21.pdf | 2021-06-11 15:01 | 375K | |
![[ ]](/icons/pdf.gif) | clecsept2021.pdf | 2021-10-15 15:52 | 461K | |
![[ ]](/icons/pdf.gif) | climatehub.pdf | 2022-04-08 14:57 | 615K | |
![[ ]](/icons/pdf.gif) | clrs25.pdf | 2025-06-20 14:33 | 5.4M | |
![[ ]](/icons/pdf.gif) | cocmembership23.pdf | 2023-05-05 15:40 | 347K | |
![[ ]](/icons/pdf.gif) | coe.pdf | 2023-01-10 15:12 | 114K | |
![[ ]](/icons/pdf.gif) | commandtruckpurchase.pdf | 2021-10-08 15:23 | 455K | |
![[ ]](/icons/pdf.gif) | committees.pdf | 2021-04-09 15:47 | 1.1M | |
![[ ]](/icons/pdf.gif) | communitycleanupday.pdf | 2021-09-03 11:41 | 175K | |
![[ ]](/icons/pdf.gif) | communityservices.pdf | 2020-07-24 14:41 | 47K | |
![[ ]](/icons/pdf.gif) | conflictinterest.pdf | 2022-11-18 15:34 | 94K | |
![[ ]](/icons/pdf.gif) | conflict of nterest.pdf | 2023-01-23 12:56 | 173K | |
![[ ]](/icons/pdf.gif) | councilcoc23.pdf | 2023-04-06 14:48 | 2.0M | |
![[ ]](/icons/pdf.gif) | covid19_stress_management_5_accessible.pdf | 2020-03-25 15:26 | 275K | |
![[ ]](/icons/pdf.gif) | covidrestartgrant23-05-09.pdf | 2023-05-05 15:40 | 289K | |
![[ ]](/icons/pdf.gif) | cp-alcapp22-02-18.pdf | 2022-02-18 15:09 | 443K | |
![[ ]](/icons/pdf.gif) | dapr_2019_report.pdf | 2022-02-21 17:59 | 2.4M | |
![[ ]](/icons/pdf.gif) | delegations.pdf | 2021-04-09 15:47 | 1.0M | |
![[ ]](/icons/pdf.gif) | demorfq.pdf | 2021-08-13 16:23 | 66K | |
![[ ]](/icons/pdf.gif) | developmentcostreview.pdf | 2021-11-05 16:42 | 74K | |
![[ ]](/icons/pdf.gif) | directoroffinanceJan.pdf | 2021-02-10 10:36 | 9.9M | |
![[ ]](/icons/pdf.gif) | directoroffinanceJan21.pdf | 2021-02-10 10:33 | 9.9M | |
![[ ]](/icons/pdf.gif) | directoroffinancedec20.pdf | 2021-02-10 09:21 | 9.9M | |
![[ ]](/icons/pdf.gif) | directoroffinancefeb.pdf | 2021-03-05 15:49 | 8.7M | |
![[ ]](/icons/pdf.gif) | directoroffinancefeb21.pdf | 2021-02-10 10:28 | 9.9M | |
![[ ]](/icons/pdf.gif) | directoroffinancejan21.pdf | 2021-02-10 10:25 | 9.9M | |
![[ ]](/icons/pdf.gif) | dp2025-01-2.pdf | 2025-05-23 13:16 | 4.8M | |
![[ ]](/icons/pdf.gif) | dp2025-01-3.pdf | 2025-05-23 13:15 | 3.7M | |
![[ ]](/icons/pdf.gif) | dp2025-02-2.pdf | 2025-05-23 13:17 | 6.1M | |
![[ ]](/icons/pdf.gif) | dp2025-02-3.pdf | 2025-05-23 13:17 | 479K | |
![[ ]](/icons/pdf.gif) | dp2025-03-2.pdf | 2025-07-04 12:07 | 5.5M | |
![[ ]](/icons/pdf.gif) | dp2025-03-3.pdf | 2025-07-04 12:07 | 304K | |
![[ ]](/icons/pdf.gif) | dp2025-04-2.pdf | 2025-07-04 12:07 | 5.5M | |
![[ ]](/icons/pdf.gif) | dp2025-04-3.pdf | 2025-07-04 12:06 | 2.2M | |
![[ ]](/icons/pdf.gif) | dp2025-04-4.pdf | 2025-07-04 12:08 | 3.4M | |
![[ ]](/icons/pdf.gif) | draft delegation bylaw.pdf | 2025-09-15 11:39 | 39K | |
![[ ]](/icons/pdf.gif) | duckpond.pdf | 2021-02-12 16:22 | 383K | |
![[ ]](/icons/pdf.gif) | duckpond22-06.pdf | 2022-06-10 15:31 | 337K | |
![[ ]](/icons/pdf.gif) | edc review.pdf | 2025-09-12 15:50 | 1.9M | |
![[ ]](/icons/pdf.gif) | electionofficersappt.pdf | 2022-05-06 15:13 | 401K | |
![[ ]](/icons/unknown.gif) | elections 2022.php | 2023-01-16 10:49 | 1.8K | |
![[ ]](/icons/pdf.gif) | electionsignguide2022.pdf | 2022-01-10 08:35 | 274K | |
![[ ]](/icons/pdf.gif) | enelsonbcambass2024.pdf | 2024-06-07 11:35 | 2.4M | |
![[ ]](/icons/pdf.gif) | entennial-Park-ToLC-Geotechl-Assessment(Lewkowich)-16Jun2016.pdf | 2016-10-19 11:58 | 1.7M | |
![[ ]](/icons/pdf.gif) | fcm22expense.pdf | 2022-06-10 15:31 | 226K | |
![[ ]](/icons/pdf.gif) | fdapr22.pdf | 2022-06-10 15:31 | 473K | |
![[ ]](/icons/pdf.gif) | fdapr23r.pdf | 2023-06-09 15:46 | 113K | |
![[ ]](/icons/pdf.gif) | fdapr24r.pdf | 2024-06-07 11:35 | 2.6M | |
![[ ]](/icons/pdf.gif) | fdapr25.pdf | 2025-05-09 16:05 | 872K | |
![[ ]](/icons/pdf.gif) | fdapr25r.pdf | 2025-05-09 16:20 | 2.6M | |
![[ ]](/icons/pdf.gif) | fdaug22.pdf | 2022-10-07 14:45 | 80K | |
![[ ]](/icons/pdf.gif) | fdaug23r.pdf | 2023-10-06 14:14 | 1.6M | |
![[ ]](/icons/pdf.gif) | fdaug24r.pdf | 2024-09-06 15:12 | 198K | |
![[ ]](/icons/pdf.gif) | fdaugust2021.pdf | 2021-10-08 15:24 | 1.9M | |
![[ ]](/icons/pdf.gif) | fddec20.pdf | 2021-02-05 15:34 | 154K | |
![[ ]](/icons/pdf.gif) | fddec21.pdf | 2022-02-04 15:28 | 810K | |
![[ ]](/icons/pdf.gif) | fddec22.pdf | 2023-02-13 18:04 | 78K | |
![[ ]](/icons/pdf.gif) | fddec22r.pdf | 2023-02-10 15:33 | 126K | |
![[ ]](/icons/pdf.gif) | fddec23r.pdf | 2024-02-09 15:47 | 192K | |
![[ ]](/icons/pdf.gif) | fddec24.pdf | 2025-02-07 15:35 | 26K | |
![[ ]](/icons/pdf.gif) | fdfeb22.pdf | 2022-04-08 14:57 | 597K | |
![[ ]](/icons/pdf.gif) | fdfeb23r.pdf | 2023-04-06 14:48 | 101K | |
![[ ]](/icons/pdf.gif) | fdfeb24r.pdf | 2024-03-08 15:18 | 93K | |
![[ ]](/icons/pdf.gif) | fdfeb25r.pdf | 2025-03-07 16:11 | 2.7M | |
![[ ]](/icons/pdf.gif) | fdjan22.pdf | 2022-04-08 14:57 | 254K | |
![[ ]](/icons/pdf.gif) | fdjan23r.pdf | 2023-03-10 13:06 | 1.3M | |
![[ ]](/icons/pdf.gif) | fdjan24r.pdf | 2024-02-09 15:47 | 108K | |
![[ ]](/icons/pdf.gif) | fdjan25r.pdf | 2025-02-07 15:35 | 2.5M | |
![[ ]](/icons/pdf.gif) | fdjul22.pdf | 2022-09-02 13:42 | 78K | |
![[ ]](/icons/pdf.gif) | fdjul23r.pdf | 2023-09-08 15:24 | 118K | |
![[ ]](/icons/pdf.gif) | fdjul24r.pdf | 2024-09-06 15:21 | 179K | |
![[ ]](/icons/pdf.gif) | fdjuly2021.pdf | 2021-09-03 15:29 | 1.9M | |
![[ ]](/icons/pdf.gif) | fdjun23r.pdf | 2023-09-08 15:24 | 103K | |
![[ ]](/icons/pdf.gif) | fdjun24r.pdf | 2024-07-05 14:38 | 179K | |
![[ ]](/icons/pdf.gif) | fdjun25r.pdf | 2025-07-04 16:30 | 2.3M | |
![[ ]](/icons/pdf.gif) | fdjune22.pdf | 2022-07-08 14:34 | 884K | |
![[ ]](/icons/pdf.gif) | fdjune2021.pdf | 2021-08-06 15:42 | 112K | |
![[ ]](/icons/pdf.gif) | fdmar22.pdf | 2022-04-08 14:57 | 59K | |
![[ ]](/icons/pdf.gif) | fdmar23r.pdf | 2023-05-05 15:41 | 1.4M | |
![[ ]](/icons/pdf.gif) | fdmar24r.pdf | 2024-05-10 15:06 | 103K | |
![[ ]](/icons/pdf.gif) | fdmar25r.pdf | 2025-04-04 15:38 | 2.7M | |
![[ ]](/icons/pdf.gif) | fdmay22.pdf | 2022-07-08 14:34 | 99K | |
![[ ]](/icons/pdf.gif) | fdmay23r.pdf | 2023-09-08 15:24 | 137K | |
![[ ]](/icons/pdf.gif) | fdmay24r.pdf | 2024-06-07 11:35 | 2.6M | |
![[ ]](/icons/pdf.gif) | fdmay25r.pdf | 2025-06-06 16:01 | 2.6M | |
![[ ]](/icons/pdf.gif) | fdmay2021.pdf | 2021-07-09 15:41 | 1.0M | |
![[ ]](/icons/pdf.gif) | fdnov22.pdf | 2023-01-06 15:01 | 75K | |
![[ ]](/icons/pdf.gif) | fdnov22r.pdf | 2023-01-06 15:01 | 127K | |
![[ ]](/icons/pdf.gif) | fdnov23r.pdf | 2023-12-08 15:26 | 117K | |
![[ ]](/icons/pdf.gif) | fdnov24r.pdf | 2024-12-06 15:25 | 2.7M | |
![[ ]](/icons/pdf.gif) | fdnov2021.pdf | 2021-12-03 15:20 | 143K | |
![[ ]](/icons/pdf.gif) | fdoct22.pdf | 2022-12-09 12:38 | 580K | |
![[ ]](/icons/pdf.gif) | fdoct23r.pdf | 2023-12-08 15:26 | 99K | |
![[ ]](/icons/pdf.gif) | fdoct24r.pdf | 2024-11-08 15:14 | 2.6M | |
![[ ]](/icons/pdf.gif) | fdoct2021.pdf | 2021-12-03 15:20 | 149K | |
![[ ]](/icons/pdf.gif) | fdsep24r.pdf | 2024-10-04 15:50 | 3.0M | |
![[ ]](/icons/pdf.gif) | fdsept22.pdf | 2022-10-07 14:45 | 63K | |
![[ ]](/icons/pdf.gif) | fdsept2021.pdf | 2021-11-05 15:58 | 443K | |
![[ ]](/icons/pdf.gif) | finalfin21.pdf | 2021-03-19 15:24 | 465K | |
![[ ]](/icons/pdf.gif) | financemarch.pdf | 2021-04-09 16:28 | 1.2M | |
![[ ]](/icons/pdf.gif) | financenovember.pdf | 2021-12-03 15:21 | 1.3M | |
![[ ]](/icons/pdf.gif) | financeoctober.pdf | 2021-11-05 15:59 | 9.4M | |
![[ ]](/icons/pdf.gif) | financeseptember.pdf | 2021-10-08 15:24 | 2.9M | |
![[ ]](/icons/pdf.gif) | finapr23.pdf | 2023-05-05 15:41 | 871K | |
![[ ]](/icons/pdf.gif) | finapr24.pdf | 2024-05-10 15:06 | 1.1M | |
![[ ]](/icons/pdf.gif) | finapr25.pdf | 2025-05-09 16:02 | 1.1M | |
![[ ]](/icons/pdf.gif) | finapril22.pdf | 2022-05-06 14:52 | 1.2M | |
![[ ]](/icons/pdf.gif) | finaug22.pdf | 2022-09-02 13:42 | 807K | |
![[ ]](/icons/pdf.gif) | finaug23.pdf | 2023-09-08 15:24 | 806K | |
![[ ]](/icons/pdf.gif) | finaug24.pdf | 2024-09-06 15:11 | 1.2M | |
![[ ]](/icons/pdf.gif) | finaug2021.pdf | 2021-09-03 15:30 | 9.3M | |
![[ ]](/icons/pdf.gif) | findec21.pdf | 2022-01-07 15:17 | 1.0M | |
![[ ]](/icons/pdf.gif) | findec22.pdf | 2023-01-10 15:02 | 1.3M | |
![[ ]](/icons/pdf.gif) | findec23.pdf | 2024-01-05 15:42 | 880K | |
![[ ]](/icons/pdf.gif) | findec24.pdf | 2025-01-10 15:06 | 1.1M | |
![[ ]](/icons/pdf.gif) | finfeb22.pdf | 2022-03-08 10:32 | 1.3M | |
![[ ]](/icons/pdf.gif) | finfeb23.pdf | 2023-03-10 13:06 | 893K | |
![[ ]](/icons/pdf.gif) | finfeb24.pdf | 2024-03-08 16:29 | 7.9M | |
![[ ]](/icons/pdf.gif) | finfeb25.pdf | 2025-03-07 16:10 | 1.2M | |
![[ ]](/icons/pdf.gif) | finjan22.pdf | 2022-02-04 15:28 | 794K | |
![[ ]](/icons/pdf.gif) | finjan24.pdf | 2024-02-09 15:48 | 4.7M | |
![[ ]](/icons/pdf.gif) | finjan25.pdf | 2025-02-07 15:36 | 1.1M | |
![[ ]](/icons/pdf.gif) | finjuly2021.pdf | 2021-08-06 15:42 | 1.7M | |
![[ ]](/icons/pdf.gif) | finjun23.pdf | 2023-07-07 15:31 | 904K | |
![[ ]](/icons/pdf.gif) | finjun24.pdf | 2024-07-05 14:39 | 1.5M | |
![[ ]](/icons/pdf.gif) | finjun25.pdf | 2025-07-04 16:29 | 1.1M | |
![[ ]](/icons/pdf.gif) | finjune22.pdf | 2022-07-08 14:34 | 1.6M | |
![[ ]](/icons/pdf.gif) | finjune2021.pdf | 2021-07-09 15:46 | 9.6M | |
![[ ]](/icons/pdf.gif) | finmar22.pdf | 2022-04-08 14:57 | 809K | |
![[ ]](/icons/pdf.gif) | finmar23.pdf | 2023-04-06 14:48 | 844K | |
![[ ]](/icons/pdf.gif) | finmar24.pdf | 2024-04-05 15:35 | 4.8M | |
![[ ]](/icons/pdf.gif) | finmar25.pdf | 2025-04-04 15:37 | 1.1M | |
![[ ]](/icons/pdf.gif) | finmay22.pdf | 2022-06-10 15:31 | 818K | |
![[ ]](/icons/pdf.gif) | finmay23.pdf | 2023-06-09 15:46 | 812K | |
![[ ]](/icons/pdf.gif) | finmay24.pdf | 2024-06-07 11:35 | 1.1M | |
![[ ]](/icons/pdf.gif) | finmay25.pdf | 2025-06-06 16:03 | 1.1M | |
![[ ]](/icons/pdf.gif) | finnov22.pdf | 2022-12-09 12:38 | 823K | |
![[ ]](/icons/pdf.gif) | finnov23.pdf | 2023-12-08 15:27 | 943K | |
![[ ]](/icons/pdf.gif) | finnov24.pdf | 2024-12-06 15:25 | 1.1M | |
![[ ]](/icons/pdf.gif) | finoct22.pdf | 2022-11-18 15:34 | 809K | |
![[ ]](/icons/pdf.gif) | finoct23.pdf | 2023-11-14 14:04 | 791K | |
![[ ]](/icons/pdf.gif) | finoct24.pdf | 2024-11-08 15:15 | 1.2M | |
![[ ]](/icons/pdf.gif) | finsep23.pdf | 2023-10-06 14:14 | 788K | |
![[ ]](/icons/pdf.gif) | finsep24.pdf | 2024-10-04 15:50 | 1.0M | |
![[ ]](/icons/pdf.gif) | finsept22.pdf | 2022-10-07 14:45 | 786K | |
![[ ]](/icons/pdf.gif) | firedepjan21.pdf | 2021-03-05 15:49 | 162K | |
![[ ]](/icons/pdf.gif) | firedeptdonor.pdf | 2021-12-03 15:41 | 550K | |
![[ ]](/icons/pdf.gif) | firedeptoct.pdf | 2021-12-03 15:20 | 149K | |
![[ ]](/icons/pdf.gif) | firedeptoctnov.pdf | 2021-12-03 15:20 | 1.4M | |
![[ ]](/icons/pdf.gif) | fireincidentreportfeb.pdf | 2021-04-09 15:48 | 460K | |
![[ ]](/icons/pdf.gif) | fireincidentreportmarch.pdf | 2021-04-09 15:55 | 167K | |
![[ ]](/icons/pdf.gif) | firereportsept.pdf | 2023-11-14 14:14 | 80K | |
![[ ]](/icons/pdf.gif) | freedomofinformationrequest.pdf | 2021-01-08 14:47 | 525K | |
![[ ]](/icons/pdf.gif) | full ocp.pdf | 2024-09-26 11:13 | 5.5M | |
![[ ]](/icons/pdf.gif) | fundrequest21.pdf | 2021-03-19 15:24 | 243K | |
![[ ]](/icons/pdf.gif) | georgecuffcommittee.pdf | 2021-12-03 15:22 | 2.3M | |
![[ ]](/icons/pdf.gif) | gff.pdf | 2024-04-08 17:44 | 77K | |
![[ ]](/icons/pdf.gif) | gia22.pdf | 2022-04-08 14:57 | 244K | |
![[ ]](/icons/pdf.gif) | giaclrss22.pdf | 2022-07-22 14:46 | 190K | |
![[ ]](/icons/pdf.gif) | grantinaid21.pdf | 2021-03-05 15:32 | 413K | |
![[ ]](/icons/pdf.gif) | grantopportunities.pdf | 2021-12-17 15:25 | 177K | |
![[ ]](/icons/pdf.gif) | gtmp.pdf | 2021-03-12 15:21 | 6.5M | |
![[ ]](/icons/pdf.gif) | halljune22.pdf | 2022-06-10 16:41 | 318K | |
![[ ]](/icons/pdf.gif) | heritagesignpallies.pdf | 2021-04-09 15:47 | 1.0M | |
![[ ]](/icons/pdf.gif) | housing forum.pdf | 2023-10-06 14:14 | 427K | |
![[ ]](/icons/pdf.gif) | housinggrant.pdf | 2022-01-07 15:18 | 64K | |
![[ ]](/icons/pdf.gif) | insurance2023.pdf | 2023-10-20 14:20 | 324K | |
![[ ]](/icons/pdf.gif) | it_greendale_wm_rev_2017-09-05.pdf | 2017-09-07 15:56 | 15K | |
![[ ]](/icons/pdf.gif) | jdooleymayorcityofnelson.pdf | 2021-02-05 15:32 | 1.0M | |
![[ ]](/icons/pdf.gif) | khs22budget.pdf | 2022-10-07 14:45 | 316K | |
![[ ]](/icons/pdf.gif) | kincanada.pdf | 2021-01-08 14:48 | 661K | |
![[ ]](/icons/pdf.gif) | labachbears.pdf | 2022-11-18 15:35 | 2.6M | |
![[ ]](/icons/pdf.gif) | lakedays25.pdf | 2025-03-21 15:42 | 2.9M | |
![[ ]](/icons/pdf.gif) | lakedaysBG.pdf | 2025-05-09 16:05 | 225K | |
![[ ]](/icons/pdf.gif) | lakedaysBGr.pdf | 2025-05-23 13:20 | 555K | |
![[ ]](/icons/pdf.gif) | landmark request wilson road.pdf | 2024-07-19 14:20 | 366K | |
![[ ]](/icons/pdf.gif) | langleyphcs.pdf | 2021-08-20 12:57 | 221K | |
![[ ]](/icons/pdf.gif) | lcbaaintro.pdf | 2024-01-19 16:01 | 361K | |
![[ ]](/icons/pdf.gif) | lccg expand24.pdf | 2024-01-05 15:56 | 103K | |
![[ ]](/icons/pdf.gif) | lcfdtender8.pdf | 2024-10-18 14:57 | 285K | |
![[ ]](/icons/pdf.gif) | lcfncommunityengage23.pdf | 2023-04-21 15:13 | 386K | |
![[ ]](/icons/pdf.gif) | lcsgia24-11-24.pdf | 2024-12-06 15:25 | 494K | |
![[ ]](/icons/pdf.gif) | lcshealthfair23.pdf | 2023-03-10 13:06 | 355K | |
![[ ]](/icons/pdf.gif) | lookout.pdf | 2025-06-20 14:07 | 1.0M | |
![[ ]](/icons/pdf.gif) | martinbreuhan.pdf | 2020-07-24 14:48 | 78K | |
![[ ]](/icons/pdf.gif) | mdsheltering22-02-22.pdf | 2022-02-18 15:09 | 21K | |
![[ ]](/icons/unknown.gif) | meeting-schedule - 2018.php | 2017-12-14 14:37 | 27K | |
![[ ]](/icons/unknown.gif) | meeting-schedule.php | 2024-11-22 15:05 | 21K | |
![[ ]](/icons/pdf.gif) | meters24.pdf | 2024-02-11 16:51 | 793K | |
![[ ]](/icons/pdf.gif) | mhapr.pdf | 2023-05-05 16:11 | 1.0M | |
![[ ]](/icons/pdf.gif) | mhapr23.pdf | 2023-05-05 15:42 | 1.0M | |
![[ ]](/icons/pdf.gif) | mhfeb23.pdf | 2023-03-10 14:26 | 139K | |
![[ ]](/icons/pdf.gif) | mhgenerator.pdf | 2022-12-09 12:47 | 136K | |
![[ ]](/icons/pdf.gif) | mhmay23.pdf | 2023-06-09 15:46 | 1.4M | |
![[ ]](/icons/pdf.gif) | mhoct22.pdf | 2022-11-18 15:35 | 428K | |
![[ ]](/icons/pdf.gif) | mhprogressreport.pdf | 2021-11-05 15:59 | 1.2M | |
![[ ]](/icons/pdf.gif) | mileage23.pdf | 2023-07-21 15:26 | 378K | |
![[ ]](/icons/pdf.gif) | moh24fund.pdf | 2024-01-19 16:19 | 176K | |
![[ ]](/icons/pdf.gif) | mosaic2022.pdf | 2022-07-22 14:46 | 204K | |
![[ ]](/icons/pdf.gif) | motspeedlimits.pdf | 2022-01-21 16:08 | 1.2M | |
![[ ]](/icons/pdf.gif) | municipalhallmtg.pdf | 2021-09-03 15:31 | 1.7M | |
![[ ]](/icons/pdf.gif) | municipalhallupdate.pdf | 2021-10-08 15:24 | 375K | |
![[ ]](/icons/pdf.gif) | municipalhallupgradesapril.pdf | 2021-04-09 15:47 | 379K | |
![[ ]](/icons/pdf.gif) | municipalhallupgradesjan.pdf | 2021-02-05 16:35 | 213K | |
![[ ]](/icons/pdf.gif) | municipalhallupgradesmar.pdf | 2021-03-05 15:32 | 45K | |
![[ ]](/icons/pdf.gif) | muralpolicy.pdf | 2024-11-08 15:39 | 306K | |
![[ ]](/icons/pdf.gif) | nakahara.pdf | 2022-09-02 13:51 | 451K | |
![[ ]](/icons/pdf.gif) | nasim parking 25-7-16_Redacted.pdf | 2025-07-18 14:09 | 399K | |
![[ ]](/icons/pdf.gif) | naturecanada-rfs.pdf | 2022-04-08 14:57 | 117K | |
![[ ]](/icons/unknown.gif) | navbar.php | 2024-04-17 15:08 | 13K | |
![[ ]](/icons/pdf.gif) | nominations.pdf | 2022-01-21 16:08 | 868K | |
![[ ]](/icons/pdf.gif) | not_sub_comp_greendale_wtr_2018-05-14.pdf | 2018-05-17 09:20 | 7.3K | |
![[ ]](/icons/pdf.gif) | ocp update.pdf | 2018-09-24 15:56 | 1.5M | |
![[ ]](/icons/pdf.gif) | office24-12-27.pdf | 2024-11-22 14:56 | 524K | |
![[ ]](/icons/pdf.gif) | office2024.pdf | 2024-11-22 14:24 | 524K | |
![[ ]](/icons/pdf.gif) | ohtakidelegation.pdf | 2022-03-18 15:26 | 70K | |
![[ ]](/icons/pdf.gif) | ombudsperson 2024.pdf | 2025-06-20 14:06 | 3.3M | |
![[ ]](/icons/pdf.gif) | openhouse240304.pdf | 2024-02-23 15:00 | 114K | |
![[ ]](/icons/unknown.gif) | opportunities.php | 2023-03-17 16:03 | 2.4K | |
![[ ]](/icons/pdf.gif) | oprapr21.pdf | 2021-05-14 15:58 | 524K | |
![[ ]](/icons/pdf.gif) | oprfeb21.pdf | 2021-03-12 15:07 | 508K | |
![[ ]](/icons/pdf.gif) | oprjan21.pdf | 2021-02-12 15:19 | 3.0M | |
![[ ]](/icons/pdf.gif) | oprjul21.pdf | 2021-08-13 15:29 | 476K | |
![[ ]](/icons/pdf.gif) | oprjun21.pdf | 2021-07-16 15:33 | 457K | |
![[ ]](/icons/pdf.gif) | oprmar21.pdf | 2021-04-16 16:21 | 2.8M | |
![[ ]](/icons/pdf.gif) | oprmay21.pdf | 2021-06-11 15:01 | 395K | |
![[ ]](/icons/pdf.gif) | pallies.pdf | 2021-03-19 15:24 | 157K | |
![[ ]](/icons/pdf.gif) | paperexcellenceweir23.pdf | 2023-09-08 15:24 | 371K | |
![[ ]](/icons/pdf.gif) | parksapr21.pdf | 2021-05-14 15:54 | 220K | |
![[ ]](/icons/pdf.gif) | parksfeb21.pdf | 2021-03-12 15:07 | 325K | |
![[ ]](/icons/pdf.gif) | parksjan21.pdf | 2021-02-12 15:19 | 375K | |
![[ ]](/icons/pdf.gif) | parksmar21.pdf | 2021-04-16 16:22 | 308K | |
![[ ]](/icons/pdf.gif) | pi21-03.pdf | 2021-03-12 15:07 | 156K | |
![[ ]](/icons/pdf.gif) | pm22-06-06.pdf | 2022-06-02 16:31 | 60K | |
![[ ]](/icons/pdf.gif) | praug2021.pdf | 2021-09-17 15:32 | 424K | |
![[ ]](/icons/pdf.gif) | prcb2021.pdf | 2021-01-15 15:53 | 277K | |
![[ ]](/icons/pdf.gif) | prjul21.pdf | 2021-08-13 15:29 | 230K | |
![[ ]](/icons/pdf.gif) | prjun21.pdf | 2021-07-16 15:33 | 240K | |
![[ ]](/icons/pdf.gif) | prmay21.pdf | 2021-06-11 15:01 | 247K | |
![[ ]](/icons/pdf.gif) | procedurebylawamendment.pdf | 2021-07-09 16:10 | 1.0M | |
![[ ]](/icons/pdf.gif) | prospect pine view.pdf | 2025-02-07 15:36 | 68K | |
![[ ]](/icons/pdf.gif) | prsept2021.pdf | 2021-10-15 15:52 | 358K | |
![[ ]](/icons/pdf.gif) | publichearing.pdf | 2020-08-21 15:34 | 1.2M | |
![[ ]](/icons/pdf.gif) | publichearing15-01-27.pdf | 2016-10-19 12:03 | 53K | |
![[ ]](/icons/pdf.gif) | publichearing15-06-23.pdf | 2016-10-19 12:03 | 112K | |
![[ ]](/icons/pdf.gif) | publichearing17-05-23.pdf | 2017-05-19 17:13 | 711K | |
![[ ]](/icons/pdf.gif) | publichearing17-10-24.pdf | 2017-10-20 16:04 | 519K | |
![[ ]](/icons/pdf.gif) | publichearing18-01-30.pdf | 2018-01-26 16:56 | 602K | |
![[ ]](/icons/pdf.gif) | publichearing18-03-06.pdf | 2018-06-15 15:32 | 169K | |
![[ ]](/icons/pdf.gif) | publichearing18-08-28.pdf | 2018-08-25 14:50 | 98K | |
![[ ]](/icons/pdf.gif) | publichearing19-03-26.pdf | 2019-03-22 17:16 | 193K | |
![[ ]](/icons/pdf.gif) | publichearing19-05-28.pdf | 2019-05-24 16:41 | 97K | |
![[ ]](/icons/pdf.gif) | publichearing19-10-22.pdf | 2019-10-18 16:03 | 897K | |
![[ ]](/icons/pdf.gif) | publichearing20-01-28.pdf | 2020-01-24 15:43 | 273K | |
![[ ]](/icons/pdf.gif) | publichearing20-02-25.pdf | 2020-02-21 15:24 | 693K | |
![[ ]](/icons/pdf.gif) | publicnotificationaddtmeans.pdf | 2024-12-06 15:25 | 3.0M | |
![[ ]](/icons/pdf.gif) | public open house pamphlet II.pdf | 2019-01-17 15:18 | 354K | |
![[ ]](/icons/pdf.gif) | pwapr21.pdf | 2021-05-14 15:54 | 306K | |
![[ ]](/icons/pdf.gif) | pwaug2021.pdf | 2021-09-17 15:32 | 347K | |
![[ ]](/icons/pdf.gif) | pwfeb21.pdf | 2021-03-12 15:07 | 455K | |
![[ ]](/icons/pdf.gif) | pwjan21.pdf | 2021-02-12 15:47 | 1.0M | |
![[ ]](/icons/pdf.gif) | pwjul21.pdf | 2021-08-13 15:29 | 204K | |
![[ ]](/icons/pdf.gif) | pwjun21.pdf | 2021-07-16 15:33 | 196K | |
![[ ]](/icons/pdf.gif) | pwmar21.pdf | 2021-04-16 16:21 | 316K | |
![[ ]](/icons/pdf.gif) | pwmay21.pdf | 2021-06-11 15:02 | 159K | |
![[ ]](/icons/pdf.gif) | pwsept2021.pdf | 2021-10-15 15:52 | 490K | |
![[ ]](/icons/pdf.gif) | r3 amends.pdf | 2025-09-15 11:50 | 221K | |
![[ ]](/icons/pdf.gif) | r3setbacks.pdf | 2025-05-09 16:19 | 231K | |
![[ ]](/icons/pdf.gif) | raydebkyle.pdf | 2020-07-24 14:48 | 46K | |
![[ ]](/icons/pdf.gif) | reconsiderprotocol23.pdf | 2023-06-09 15:46 | 67K | |
![[ ]](/icons/pdf.gif) | relocate2023.pdf | 2023-05-05 15:42 | 444K | |
![[ ]](/icons/pdf.gif) | resignation from APC.pdf | 2021-04-20 15:34 | 33K | |
![[ ]](/icons/pdf.gif) | response policy.pdf | 2023-10-06 16:27 | 191K | |
![[ ]](/icons/pdf.gif) | restart.pdf | 2020-11-06 16:01 | 1.1M | |
![[ ]](/icons/pdf.gif) | road profiles.pdf | 2021-03-23 14:33 | 225K | |
![[ ]](/icons/pdf.gif) | sani24.pdf | 2024-09-06 15:12 | 532K | |
![[ ]](/icons/pdf.gif) | sanidump23-07.pdf | 2023-07-23 17:45 | 150K | |
![[ ]](/icons/pdf.gif) | sanisep23.pdf | 2023-09-08 15:24 | 344K | |
![[ ]](/icons/pdf.gif) | seniors.pdf | 2024-10-21 15:35 | 1.5M | |
![[ ]](/icons/pdf.gif) | sff.pdf | 2024-04-08 17:42 | 391K | |
![[ ]](/icons/pdf.gif) | social-distancing-infograph-eng.pdf | 2020-03-25 15:26 | 247K | |
![[ ]](/icons/pdf.gif) | sp4q24.pdf | 2025-01-10 15:07 | 2.3M | |
![[ ]](/icons/pdf.gif) | sp23jan.pdf | 2023-01-06 15:18 | 152K | |
![[ ]](/icons/pdf.gif) | sp24-10-01.pdf | 2024-10-04 15:07 | 1.1M | |
![[ ]](/icons/pdf.gif) | spdec23.pdf | 2023-12-08 15:27 | 131K | |
![[ ]](/icons/pdf.gif) | spiritloop.pdf | 2021-12-03 15:23 | 536K | |
![[ ]](/icons/pdf.gif) | spoct22.pdf | 2022-10-07 14:45 | 215K | |
![[ ]](/icons/pdf.gif) | ssmuh_provincial_policy_manual.pdf | 2024-02-28 10:53 | 3.5M | |
![[ ]](/icons/pdf.gif) | staff report for dv at 340 grants lake.pdf | 2022-04-26 15:00 | 280K | |
![[ ]](/icons/pdf.gif) | staff report on DAP for REG26-04-28.pdf | 2026-04-22 14:14 | 461K | |
![[ ]](/icons/pdf.gif) | str_policy_guidance_2023.pdf | 2024-03-22 12:19 | 808K | |
![[ ]](/icons/pdf.gif) | strategicplan21-22.pdf | 2021-08-06 15:43 | 1.2M | |
![[ ]](/icons/pdf.gif) | strategicplanning.pdf | 2021-02-05 15:34 | 1.1M | |
![[ ]](/icons/pdf.gif) | strategicplanningmar.pdf | 2021-03-05 15:25 | 1.5M | |
![[ ]](/icons/pdf.gif) | strategicplanningquestionnaire.pdf | 2021-01-08 15:54 | 1.2M | |
![[ ]](/icons/pdf.gif) | subdivision works and services bylaw questions and draft changes.pdf | 2021-10-26 14:01 | 421K | |
![[ ]](/icons/pdf.gif) | tdo_watermain_river_crossings_2017-10-25 5.pdf | 2017-10-27 11:53 | 14K | |
![[ ]](/icons/pdf.gif) | temporary utility job posting.pdf | 2025-02-26 14:50 | 124K | |
![[ ]](/icons/pdf.gif) | theslopes.pdf | 2021-02-12 16:22 | 399K | |
![[ ]](/icons/pdf.gif) | ubcm22mtgs.pdf | 2022-07-08 14:35 | 20M | |
![[ ]](/icons/pdf.gif) | ubcm22trs.pdf | 2022-07-08 14:35 | 458K | |
![[ ]](/icons/pdf.gif) | ubcmcwf23.pdf | 2023-12-15 14:31 | 405K | |
![[ ]](/icons/pdf.gif) | ubreverse23-05-09.pdf | 2023-05-05 15:42 | 1.2M | |
![[ ]](/icons/pdf.gif) | updating subdivision works.pdf | 2021-09-20 15:48 | 322K | |
![[ ]](/icons/pdf.gif) | v.pdf | 2016-10-19 12:11 | 4.5M | |
![[ ]](/icons/pdf.gif) | virl2024.pdf | 2023-10-20 14:21 | 320K | |
![[IMG]](/icons/image2.gif) | walk-ins-welcome-twitter.png | 2021-08-12 17:50 | 101K | |
![[ ]](/icons/pdf.gif) | water 6.pdf | 2016-10-19 12:11 | 162K | |
![[ ]](/icons/pdf.gif) | water flushing 2026.pdf | 2026-02-23 10:15 | 60K | |
![[ ]](/icons/pdf.gif) | wcp2022.pdf | 2022-02-08 16:14 | 1.6M | |
![[ ]](/icons/unknown.gif) | weir.pptx | 2021-03-12 15:27 | 52M | |
![[ ]](/icons/pdf.gif) | wff.pdf | 2024-04-08 17:42 | 354K | |
![[ ]](/icons/pdf.gif) | wlpolicy22.pdf | 2022-02-04 15:29 | 1.0M | |
![[ ]](/icons/pdf.gif) | woodforum.pdf | 2021-09-17 15:32 | 390K | |
![[ ]](/icons/pdf.gif) | wtpalumreads22.pdf | 2022-06-10 15:57 | 372K | |
![[ ]](/icons/pdf.gif) | wtpapr21.pdf | 2021-05-14 15:54 | 296K | |
![[ ]](/icons/pdf.gif) | wtpaug2021.pdf | 2021-09-17 15:40 | 501K | |
![[ ]](/icons/pdf.gif) | wtpfeb21.pdf | 2021-02-12 15:19 | 1.0M | |
![[ ]](/icons/pdf.gif) | wtpjan21.pdf | 2021-02-12 15:47 | 853K | |
![[ ]](/icons/pdf.gif) | wtpjul21.pdf | 2021-08-17 10:34 | 303K | |
![[ ]](/icons/pdf.gif) | wtpjun21.pdf | 2021-07-16 15:33 | 296K | |
![[ ]](/icons/pdf.gif) | wtpmar21.pdf | 2021-04-16 16:21 | 512K | |
![[ ]](/icons/pdf.gif) | wtpmay21.pdf | 2021-06-11 15:02 | 302K | |
![[ ]](/icons/pdf.gif) | wtpsept2021.pdf | 2021-10-15 15:52 | 526K | |
![[ ]](/icons/pdf.gif) | youthcouncil.pdf | 2021-01-22 15:23 | 27K | |
![[ ]](/icons/unknown.gif) | ~$FINAL Reg Rec - PPT - TLC.pptx | 2022-09-29 14:01 | 0 | |
|